Misplaced Pages

Candicidin: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 13:06, 11 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').← Previous edit Latest revision as of 13:45, 30 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers173,039 edits Importing Wikidata short description: "Pharmaceutic extract from Streptomyces griseus"Tag: Shortdesc helper 
(24 intermediate revisions by 20 users not shown)
Line 1: Line 1:
{{Short description|Pharmaceutic extract from Streptomyces griseus}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 376087253 | verifiedrevid = 460122980
| IUPAC_name = 33--17--1,3,5,7,37-pentahydroxy-18-methyl-9,13,15-trioxo-16,39-dioxabicyclononatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid | IUPAC_name = 33--17--1,3,5,7,37-pentahydroxy-18-methyl-9,13,15-trioxo-16,39-dioxabicyclononatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid
| image = Candicidin.png | image = Candicidin.png


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = | pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = | legal_status =
| routes_of_administration = | routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound = | protein_bound =
| metabolism = | metabolism =
| elimination_half-life = | elimination_half-life =
| excretion = | excretion =


<!--Identifiers--> <!--Identifiers-->
Line 30: Line 31:
| ATC_prefix = G01 | ATC_prefix = G01
| ATC_suffix = AA04 | ATC_suffix = AA04
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C59H84N2O18/c1-35-18-15-13-11-9-7-5-6-8-10-12-14-16-21-46(77-58-55(72)53(61)54(71)38(4)76-58)31-50-52(57(73)74)49(69)34-59(75,79-50)33-45(66)29-44(65)28-43(64)27-41(62)19-17-20-42(63)30-51(70)78-56(35)37(3)26-36(2)47(67)32-48(68)39-22-24-40(60)25-23-39/h5-16,18,21-25,35-38,43-47,49-50,52-56,58,64-67,69,71-72,75H,17,19-20,26-34,60-61H2,1-4H3,(H,73,74)/b6-5-,9-7-,10-8-,13-11-,14-12-,18-15-,21-16-/t35?,36?,37?,38-,43?,44?,45?,46?,47?,49?,50?,52?,53+,54-,55+,56?,58?,59?/m1/s1 | StdInChI = 1S/C59H84N2O18/c1-35-18-15-13-11-9-7-5-6-8-10-12-14-16-21-46(77-58-55(72)53(61)54(71)38(4)76-58)31-50-52(57(73)74)49(69)34-59(75,79-50)33-45(66)29-44(65)28-43(64)27-41(62)19-17-20-42(63)30-51(70)78-56(35)37(3)26-36(2)47(67)32-48(68)39-22-24-40(60)25-23-39/h5-16,18,21-25,35-38,43-47,49-50,52-56,58,64-67,69,71-72,75H,17,19-20,26-34,60-61H2,1-4H3,(H,73,74)/b6-5-,9-7-,10-8-,13-11-,14-12-,18-15-,21-16-/t35?,36?,37?,38-,43?,44?,45?,46?,47?,49?,50?,52?,53+,54-,55+,56?,58?,59?/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YKSVGLFNJPQDJE-WDANKXQLSA-N | StdInChIKey = YKSVGLFNJPQDJE-WDANKXQLSA-N
| PubChem = 441142 | PubChem = 441142
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01152 | DrugBank = DB01152
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10128184 | ChemSpiderID = 10128184
| UNII_Ref = {{fdacite|changed|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 48N2IYJ202 | UNII = 48N2IYJ202
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1200647 --> | ChEMBL = 1200647

⚫ | C=59 | H=84 | N=2 | O=18
<!--Chemical data-->
| molecular_weight = 875.9947 g/mol
⚫ | C=59 | H=84 | N=2 | O=18
| smiles = Nc1ccc(cc1)C(=O)CC(O)C(C)CC(C)C3OC(=O)CC(=O)CCCC(=O)CC(O)CC(O)CC(O)CC4(O)CC(O)C(C(=O)O)C(CC(OC2O(C)(O)(N)2O)C=CC=CC=CC=CC=CC=CC=CC3C)O4 | smiles = Nc1ccc(cc1)C(=O)CC(O)C(C)CC(C)C3OC(=O)CC(=O)CCCC(=O)CC(O)CC(O)CC(O)CC4(O)CC(O)C(C(=O)O)C(CC(OC2O(C)(O)(N)2O)C=CC=CC=CC=CC=CC=CC=CC3C)O4
}} }}


'''Candicidin''' is an ] compound obtained from '']''. It is active against some fungi including '']''. Candicidin is administered intravaginally in the treatment of vulvovaginal ].<ref>{{cite web | title = Product information Candicidin | url = http://www.toku-e.com/Upload/Products/PDS/20120604006556.pdf | publisher = Toku-E | date = 2012-01-11 | access-date = 2012-06-11 | archive-url = https://web.archive.org/web/20140408224713/http://www.toku-e.com/Upload/Products/PDS/20120604006556.pdf | archive-date = 2014-04-08 | url-status = dead }}</ref>
'''Candicidin''' is an ].


This ] was named candicidin, because of its high activity on '' Candida albicans''.<ref name="pmid5320588">{{cite journal | vauthors = Waksman SA, Lechevalier HA, Schaffner CP | title = Candicidin and other polyenic antifungal antibiotics | journal = Bulletin of the World Health Organization | volume = 33 | issue = 2 | pages = 219–26 | date = 1965 | pmid = 5320588 | pmc = 2475843 }}</ref>


== References ==
{{reflist}}


{{Gynecological anti-infectives and antiseptics}} {{Gynecological anti-infectives and antiseptics}}


] ]
]
]