| Revision as of 11:43, 15 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.← Previous edit |
Latest revision as of 05:50, 4 October 2023 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,685,571 editsm Moving Category:Uncoupling agents to Category:Uncouplers per Misplaced Pages:Categories for discussion/Speedy |
| (39 intermediate revisions by 25 users not shown) |
| Line 1: |
Line 1: |
|
|
{{DISPLAYTITLE:Carbonyl cyanide-''p''-trifluoromethoxyphenylhydrazone}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 399705974 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 414048120 |
|
|
| Name = Carbonyl cyanide-''p''-trifluoromethoxyphenylhydrazone |
|
| ImageFile = Carbonyl cyanide-p-trifluoromethoxyphenylhydrazone.svg |
|
| ImageFile = Carbonyl cyanide-p-trifluoromethoxyphenylhydrazone.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
|
| PIN = ''N''-carbonohydrazonoyl dicyanide |
|
| IUPACName = |
|
|
| OtherNames = |
|
| OtherNames = |
|
| Reference = <ref>, ].</ref> |
|
| Reference = <ref>, ].</ref> |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 3213 |
|
| ChemSpiderID = 3213 |
|
| InChI = 1/C10H5F3N4O/c11-10(12,13)18-9-3-1-7(2-4-9)16-17-8(5-14)6-15/h1-4,16H |
|
| InChI = 1/C10H5F3N4O/c11-10(12,13)18-9-3-1-7(2-4-9)16-17-8(5-14)6-15/h1-4,16H |
|
| InChIKey = BMZRVOVNUMQTIN-UHFFFAOYAT |
|
| InChIKey = BMZRVOVNUMQTIN-UHFFFAOYAT |
|
| SMILES1 = FC(F)(F)Oc1ccc(cc1)N/N=C(\C#N)C#N |
|
| SMILES1 = FC(F)(F)Oc1ccc(cc1)N/N=C(\C#N)C#N |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 457504 |
|
| ChEMBL = 457504 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 17: |
Line 22: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BMZRVOVNUMQTIN-UHFFFAOYSA-N |
|
| StdInChIKey = BMZRVOVNUMQTIN-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 370-86-5 |
|
| CASNo = 370-86-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 3330 |
|
|
|
| UNII = SQR3W2FLV5 |
| ⚫ |
| SMILES = C1=CC(=CC=C1NN=C(C#N)C#N)OC(F)(F)F |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| MeSHName = FCCP |
|
|
|
| ChEBI = 75458 |
|
⚫ |
| PubChem = 3330 |
|
⚫ |
| SMILES = C1=CC(=CC=C1NN=C(C#N)C#N)OC(F)(F)F |
|
⚫ |
| MeSHName = FCCP |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| Formula = {{chem2|C10H5F3N4O}} |
|
| Formula = C<sub>10</sub>H<sub>5</sub>F<sub>3</sub>N<sub>4</sub>O |
|
|
| MolarMass = 254.16811 g/mol |
|
| MolarMass = 254.16811 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Carbonyl cyanide-p-trifluoromethoxyphenylhydrazone''' ('''FCCP''') is an ] that is a mobile ]. It referred to as an ] because it disrupts ] ] by transporting ] through a ] before they can be used to provide the energy for ].<ref>, ].</ref> It is a ] and ]. |
|
'''Carbonyl cyanide-''p''-trifluoromethoxyphenylhydrazone''' ('''FCCP''') is an ] that is a mobile ]. It is referred to as an ] because it disrupts ] ] by transporting ] through the ] before they can be used to provide the energy for ].<ref>, ].</ref> It is a ] and ]. FCCP was first described in 1962 by Heytler.<ref>{{cite journal |author=Heytler, P G |title=A new class of uncoupling agents — Carbonyl cyanide phenylhydrazones |journal=Biochemical and Biophysical Research Communications |volume=7 |issue=4 |pages=272–275 |year=1962 | doi=10.1016/0006-291X(62)90189-4|pmid=13907155 }}</ref> |
|
|
|
|
⚫ |
== See also == |
|
⚫ |
* ] (CCCP) |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
| ⚫ |
== See also == |
|
| ⚫ |
* ] (CCCP) |
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
] |
|
{{biochem-stub}} |
|
|
|
|
|
] |
|
|
] |
|