| Revision as of 15:27, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 472145026 of page Carumonam for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
Latest revision as of 13:12, 29 January 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,984 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 472143429 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = 2-<nowiki>amino]-2-oxoethylidene]amino]oxyacetic acid |
|
|
⚫ |
| verifiedrevid = 477377971 |
| ⚫ |
| image = Carumonam.png |
|
|
⚫ |
| IUPAC_name = 2-amino]-2-oxoethylidene]amino]oxyacetic acid |
|
⚫ |
| image = Carumonam.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Amasulin |
|
| Drugs.com = {{drugs.com|international|carumonam}} |
|
| Drugs.com = {{drugs.com|international|carumonam}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = <!-- blanked - oldvalue: 87638-04-8 --> |
|
| CAS_number = 87638-04-8 |
|
| ATC_prefix = J01 |
|
| ATC_prefix = J01 |
|
| ATC_suffix = DF02 |
|
| ATC_suffix = DF02 |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB13553 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 486890PI06 |
|
| UNII = 486890PI06 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1256767 --> |
|
| ChEMBL = 1614658 |
|
| PubChem = 6857983 |
|
| PubChem = 6540466 |
|
|
| ChEBI = 55486 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5257278 |
|
| ChemSpiderID = 5022832 |
|
| SMILES = O=S(=O)(O)N2C(=O)(NC(=O)C(=N\OCC(=O)O)\c1nc(sc1)N)2COC(=O)N |
|
| smiles = C1=C(N=C(S1)N)/C(=N/OCC(=O)O)/C(=O)N2(N(C2=O)S(=O)(=O)O)COC(=O)N |
|
| InChI = 1/C12H14N6O10S2/c13-11-15-4(3-29-11)7(17-28-2-6(19)20)9(21)16-8-5(1-27-12(14)23)18(10(8)22)30(24,25)26/h3,5,8H,1-2H2,(H2,13,15)(H2,14,23)(H,16,21)(H,19,20)(H,24,25,26)/b17-7+/t5-,8+/m1/s1 |
|
|
| InChIKey = UIMOJFJSJSIGLV-PDWQJGMQBB |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H14N6O10S2/c13-11-15-4(3-29-11)7(17-28-2-6(19)20)9(21)16-8-5(1-27-12(14)23)18(10(8)22)30(24,25)26/h3,5,8H,1-2H2,(H2,13,15)(H2,14,23)(H,16,21)(H,19,20)(H,24,25,26)/b17-7+/t5-,8+/m1/s1 |
|
| StdInChI = 1S/C12H14N6O10S2/c13-11-15-4(3-29-11)7(17-28-2-6(19)20)9(21)16-8-5(1-27-12(14)23)18(10(8)22)30(24,25)26/h3,5,8H,1-2H2,(H2,13,15)(H2,14,23)(H,16,21)(H,19,20)(H,24,25,26)/b17-7-/t5-,8+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UIMOJFJSJSIGLV-PDWQJGMQSA-N |
|
| StdInChIKey = UIMOJFJSJSIGLV-JNHMLNOCSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=12 | H=14 | N=6 | O=10 | S=2 |
|
| C=12 | H=14 | N=6 | O=10 | S=2 |
|
| molecular_weight = 466.40 g/mol |
|
|
}} |
|
}} |
|
|
|
|
|
'''Carumonam''' (]) is a ] antibiotic.<ref>{{cite journal | vauthors = McNulty CA, Garden GM, Ashby J, Wise R | title = Pharmacokinetics and tissue penetration of carumonam, a new synthetic monobactam | journal = Antimicrobial Agents and Chemotherapy | volume = 28 | issue = 3 | pages = 425–7 | date = September 1985 | pmid = 4073864 | pmc = 180266 | doi = 10.1128/aac.28.3.425 }}</ref> It is very resistant to ]s, which means that it is more difficult for bacteria to break down using β-lactamase enzymes.<ref>{{Cite web|last=PubChem|title=Carumonam|url=https://pubchem.ncbi.nlm.nih.gov/compound/6540466|access-date=2021-12-08|website=pubchem.ncbi.nlm.nih.gov|language=en}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Cell wall disruptive antibiotics|state=collapsed}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antibiotic-stub}} |