| Revision as of 13:29, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 12:23, 27 June 2019 edit undoEdgar181 (talk | contribs)Extended confirmed users196,325 edits removed Category:Ketones; added Category:Enones using HotCat |
| (16 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 388072095 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 428751289 |
|
| ImageFile = Carvonic acid.svg |
|
| ImageFile = Carvonic acid.svg |
|
| ImageSize = 200px |
|
|
| IUPACName = 2-(4-Methyl-5-oxo-cyclohex-3-enyl)-acrylic acid |
|
| IUPACName = 2-(4-Methyl-5-oxo-cyclohex-3-enyl)-acrylic acid |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 362483-06-5 |
|
| CASNo = 362483-06-5 |
|
| CASNo_Comment = (racemate) |
|
| CASNo_Comment = (racemate) |
|
⚫ |
| SMILES = CC1=CC(CC1=O)C(=C)C(=O)O |
| ⚫ |
| PubChem = |
|
|
|
| SMILES_Comment = (R) |
| ⚫ |
| SMILES = O=C1CC(C(C(O)=O)=C)CC=C1C |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| ChemSpiderID = 27330306 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| ChemSpiderID_Comment = (R) |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C10H12O3/c1-6-3-4-8(5-9(6)11)7(2)10(12)13/h3,8H,2,4-5H2,1H3,(H,12,13)/t8-/m1/s1 |
|
|
| StdInChI_Comment = (R) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = BPJKNHQCPHBIAR-MRVPVSSYSA-N |
|
|
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID1 = 27330305 |
|
|
| ChemSpiderID1_Comment = (S) |
|
⚫ |
| PubChem = 71308172 |
|
|
| SMILES1 = CC1=CC(CC1=O)C(=C)C(=O)O |
|
|
| SMILES1_Comment = (S) |
|
|
| InChI3 = 1S/C10H12O3/c1-6-3-4-8(5-9(6)11)7(2)10(12)13/h3,8H,2,4-5H2,1H3,(H,12,13)/t8-/m0/s1 |
|
|
| InChI3_Comment = (S) |
|
|
| InChIKey3 = BPJKNHQCPHBIAR-QMMMGPOBSA-N |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
| Formula = C<sub>10</sub>H<sub>12</sub>O<sub>3</sub> |
|
| Formula = C<sub>10</sub>H<sub>12</sub>O<sub>3</sub> |
|
| MolarMass = 180.20 g/mol |
|
| MolarMass = 180.20 g/mol |
| Line 18: |
Line 37: |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = |
|
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition = }} |
|
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Carvonic acid''', or α-methylene-4-methyl-5-oxo-3-cyclohexene-1-acetic acid, is a ] formed by metabolism of ] in humans.<ref>{{cite journal |
|
'''Carvonic acid''', or α-methylene-4-methyl-5-oxo-3-cyclohexene-1-acetic acid, is a ] formed by metabolism of ] in humans.<ref>{{cite journal| author = Engel, W. | title = In Vivo Studies on the Metabolism of the Monoterpenes ''S''-(+)- and ''R''-(−)-Carvone in Humans Using the Metabolism of Ingestion-Correlated Amounts (MICA) Approach | journal = J. Agric. Food Chem.| year = 2001| volume = 49| issue = 8| pages = 4069–4075| doi = 10.1021/jf010157q| pmid=11513712}}</ref> |
|
| author = Engel, W. |
|
|
| title = In Vivo Studies on the Metabolism of the Monoterpenes ''S''-(+)- and ''R''-(-)-Carvone in Humans Using the Metabolism of Ingestion-Correlated Amounts (MICA) Approach |
|
|
| journal = J. Agric. Food Chem. |
|
|
| year = 2001 |
|
|
| volume = 49 |
|
|
| issue = 8 |
|
|
| pages = 4069–4075 |
|
|
| doi = 10.1021/jf010157q}}</ref> |
|
|
|
|
|
|
==References== |
|
==References== |
| Line 40: |
Line 53: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|