Misplaced Pages

Castalin: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 03:15, 25 December 2010 editYobot (talk | contribs)Bots4,733,870 editsm WP:CHECKWIKI error 61 fixes + general fixes, added wikify tag using AWB (7504)← Previous edit Latest revision as of 08:14, 25 November 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,716 edits more ids 
(24 intermediate revisions by 17 users not shown)
Line 1: Line 1:
{{Wikify|date=December 2010}}

{{chembox {{chembox
| Watchedfields = changed
| verifiedrevid = 441141026
| Name = Castalin | Name = Castalin
| ImageFile = Castalin.PNG | ImageFile = Castalin.svg
| ImageSize = 200px
| ImageName = Chemical structure of castalin | ImageName = Chemical structure of castalin
| IUPACName = | IUPACName =
| OtherNames = <!-- <br> --> | OtherNames = <!-- <br> -->
|Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = 19086-75-0 | CASNo = 19086-75-0
| CASNo_Ref = | CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 59696884
| CASOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = BA7JCC4U52
| PubChem = 99973 | PubChem = 99973
| StdInChI=1S/C27H20O18/c28-2-5-14(31)23-24-20(37)12-11(27(42)45-24)9(18(35)22(39)19(12)36)8-10(26(41)44-23)7(16(33)21(38)17(8)34)6-3(25(40)43-5)1-4(29)13(30)15(6)32/h1,5,14,20,23-24,28-39H,2H2
| StdInChIKey = PPUHUWSVCUJGTD-UHFFFAOYSA-N
| SMILES = C1=C2C(=C(C(=C1O)O)O)C3=C4C(=C(C(=C3O)O)O)C5=C6C(=C(C(=C5O)O)O)C(C(C(C(C(OC2=O)CO)O)OC4=O)OC6=O)O | SMILES = C1=C2C(=C(C(=C1O)O)O)C3=C4C(=C(C(=C3O)O)O)C5=C6C(=C(C(=C5O)O)O)C(C(C(C(C(OC2=O)CO)O)OC4=O)OC6=O)O
}}
| InChI =
|Section2={{Chembox Properties
| MeSHName =
| C=27 | H=20 | O=18
}}
|Section2= {{Chembox Properties
| Formula = C<sub>27</sub>H<sub>20</sub>O<sub>18</sub>
| MolarMass = 632.43 g/mol
| ExactMass = 632.064964
| Appearance = | Appearance =
| Density = | Density =
Line 28: Line 27:
}} }}
}} }}
'''Castalin''' is an ]. It can be found in oak wood<ref></ref> and in '']'' leaves<ref></ref>.


'''Castalin''' is an ]. It can be found in ] wood<ref>{{cite journal | doi = 10.1051/forest:2006021 | title = Effect of species and ecological conditions on ellagitannin content in oak wood from an even-aged and mixed stand of ''Quercus robur'' L. And ''Quercus petraea'' Liebl | date = 2006 | last1 = Prida | first1 = Andrei | last2 = Boulet | first2 = Jean-Claude | last3 = Ducousso | first3 = Alexis | last4 = Nepveu | first4 = Gérard | last5 = Puech | first5 = Jean-Louis | journal = Annals of Forest Science | volume = 63 | issue = 4 | pages = 415–424 | bibcode = 2006AnFSc..63..415P }} {{webarchive|url=https://web.archive.org/web/20070712175537/http://www.afs-journal.org/index.php?option=article&access=standard&Itemid=129&url=%2Farticles%2Fforest%2Fpdf%2F2006%2F04%2Ff6043.pdf |date=2007-07-12 }}</ref> and in '']'' leaves.<ref>{{cite journal | doi = 10.1002/ptr.1214 | title = Polyphenols of ''Melaleuca quinquenervia'' leaves – pharmacological studies of grandinin | date = 2003 | last1 = Moharram | first1 = F. A. | last2 = Marzouk | first2 = M. S. | last3 = El-Toumy | first3 = S. A. A. | last4 = Ahmed | first4 = A. A. E. | last5 = Aboutabl | first5 = E. A. | journal = Phytotherapy Research | volume = 17 | issue = 7 | pages = 767–773 | pmid = 12916075 | s2cid = 45936055 }}</ref>
==References==
{{reflist}}


== References ==
{{Hydrolysable tannin}}
{{reflist}}


{{Ellagitannin}}
]
]


]


{{polyphenol-stub}} {{Aromatic-stub}}