| Revision as of 03:10, 31 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 10:27, 25 November 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,755 edits chemspider |
| (17 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 440123371 |
|
| verifiedrevid = 442297034 |
|
| Name = Castavinol C3 |
|
| Name = Castavinol C3 |
|
| ImageFile = Castavinol.png |
|
| ImageFile = Castavinol 3.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of castavinol C3 |
|
| ImageName = Chemical structure of castavinol C3 |
| Line 8: |
Line 9: |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
| CASNo = 183607-17-2 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}}= |
|
|
| ChemSpiderID = 59694876 |
|
| CASOther = |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = |
|
|
|
| UNII = ZHZ5SCW9G9 |
|
⚫ |
| PubChem = 57515151 |
|
| SMILES = OC2C(O)C(O)C(OC2CO)OC4C3C(C)(C(C)=O)OC4(c(cc1OC)cc(O)c1O)Oc5c3c(O)cc(O)c5 |
|
| SMILES = OC2C(O)C(O)C(OC2CO)OC4C3C(C)(C(C)=O)OC4(c(cc1OC)cc(O)c1O)Oc5c3c(O)cc(O)c5 |
|
|
| SMILES1 = COc1cc(23Oc4cc(O)ccc4(2O2O(CO)(O)(O)2O)C(C)(C(C)=O)O3)cc(O)c1O |
|
| InChI = |
|
|
|
| InChI=1S/C26H30O14/c1-9(28)25(2)18-17-12(30)6-11(29)7-14(17)39-26(40-25,10-4-13(31)19(32)15(5-10)36-3)23(18)38-24-22(35)21(34)20(33)16(8-27)37-24/h4-7,16,18,20-24,27,29-35H,8H2,1-3H3 |
|
|
| InChIKey = ADFRCNLBRJARNV-UHFFFAOYSA-N |
|
|
| InChIKey1 =ALSDFAORYWHNNX-UFFWUXHJSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>26</sub>H<sub>30</sub>O<sub>14</sub> |
|
| C=26 | H=30 | O=14 |
|
| MolarMass = 566.50 g/mol |
|
|
| ExactMass = 566.163555 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
|
| GHSPictograms = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
|
| GHSSignalWord = |
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
|
| HPhrases = {{HPhrases|}} |
|
|
| PPhrases = {{PPhrases|}} |
|
|
| GHS_ref = <!-- no GHS data in pubchem Dec2021 --> |
|
}} |
|
}} |
|
}} |
|
}} |
| ⚫ |
'''Castavinol C3''' is a ], a natural phenolic compound found in ].<ref>Castavinol, a new series of polyphenols from Bordeaux red wines. Chantal Castagnino and Joseph Vercauteren, Tetrahedron Letters, Volume 37, Issue 43, 21 October 1996, pp. 7739-7742, {{doi|10.1016/0040-4039(96)01761-3}}</ref> |
|
|
|
|
|
|
⚫ |
'''Castavinol C3''' is a ], a natural phenolic compound found in ]s.<ref>{{cite journal | doi = 10.1016/0040-4039(96)01761-3| title = Castavinol, a new series of polyphenols from Bordeaux red wines| date = 1996| last1 = Castagnino| first1 = Chantal| last2 = Vercauteren| first2 = Joseph| journal = Tetrahedron Letters| volume = 37| issue = 43| pages = 7739–7742}}</ref> |
| ⚫ |
==See also== |
|
|
|
|
|
⚫ |
== See also == |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
== External links == |
|
* (French) |
|
* {{Webarchive|url=https://web.archive.org/web/20111004120343/http://www.socpharmbordeaux.asso.fr/pdf/pdf-136/136-019-036.pdf |date=2011-10-04 }} (French) |
|
|
|
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |