| Revision as of 00:54, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 12:15, 15 April 2020 edit undoOAbot (talk | contribs)Bots441,761 editsm Open access bot: doi added to citation with #oabot. |
| (15 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 383817542 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 424779217 |
|
|ImageFile=Cefclidine.png |
|
|ImageFile=Cefclidine.png |
|
|ImageSize=200px |
|
|ImageSize=200px |
|
|IUPACName= (6''R'',7''R'')-7-<nowiki>amino]-3-octan-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo |
|
|IUPACName= (6''R'',7''R'')-7-<nowiki>amino]-3-octan-1-yl)methyl]-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylate |
|
⚫ |
|OtherNames=Antibiotic E 1040; Cefclidine; Cefaclidine |
|
oct-2-ene-2-carboxylate |
|
|
|IUPACName_hidden=yes |
|
| ⚫ |
|OtherNames=Antibiotic E 1040; Cefclidin; Cefaclidine |
|
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=105239-91-6 |
|
| CASNo=105239-91-6 |
| ⚫ |
| PubChem=6537446 |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| SMILES=CO/N=C(/C1=NSC(=N1)N)\C(=O)N23N(C2=O)C(=C(CS3)C45CCC(CC4)(CC5)C(=O)N)C(=O) |
|
|
|
| UNII = 78963CJ0OG |
|
⚫ |
| PubChem=6537446 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1614665 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 5020608 |
|
⚫ |
| SMILES = O=C2N1/C(=C(\CS12NC(=O)C(=N\OC)/c3nc(sn3)N)C45CCC(C(=O)N)(CC4)CC5)C()=O |
|
|
| InChI = 1/C21H26N8O6S2/c1-35-26-11(14-25-20(23)37-27-14)15(30)24-12-16(31)28-13(18(32)33)10(9-36-17(12)28)8-29-5-2-21(3-6-29,4-7-29)19(22)34/h12,17H,2-9H2,1H3,(H5-,22,23,24,25,27,30,32,33,34)/b26-11-/t12-,17-,21?,29?/m1/s1 |
|
|
| InChIKey = JUVHVMCKLDZLGN-TVNFHGJBBE |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C21H26N8O6S2/c1-35-26-11(14-25-20(23)37-27-14)15(30)24-12-16(31)28-13(18(32)33)10(9-36-17(12)28)8-29-5-2-21(3-6-29,4-7-29)19(22)34/h12,17H,2-9H2,1H3,(H5-,22,23,24,25,27,30,32,33,34)/b26-11-/t12-,17-,21?,29?/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JUVHVMCKLDZLGN-TVNFHGJBSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=21|H=26|N=8|O=6|S=2 |
|
| C=21|H=26|N=8|O=6|S=2 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt= |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Cefclidin''' (also known as '''cefclidin''', '''cefaclidine''', or '''E1040''') is a ] ].<ref>{{Cite journal | pmid = 1399855| year = 1992| last1 = Watanabe| first1 = N. A.| title = Cefclidin (E1040), a novel cephalosporin: Lack of selection of beta-lactamase overproducing mutants in an in vitro pharmacokinetic model system| journal = The Journal of Antibiotics| volume = 45| issue = 8| pages = 1335–45| last2 = Katsu| first2 = K| doi=10.7164/antibiotics.45.1335| doi-access = free}}</ref> |
|
'''Cefclidine''' (or '''cefaclidine''') is a ]. |
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Cell wall disruptive antibiotics}} |
|
{{Cell wall disruptive antibiotics}} |
|
|
|
|
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
|
|
|
|
|