| Revision as of 18:56, 8 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:W← Previous edit |
Latest revision as of 22:16, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers173,077 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (12 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
⚫ |
| verifiedrevid = 443726531 |
| ⚫ |
| UNII = T750UM24H8 |
|
|
⚫ |
| IUPAC_name = (6''R'',7''R'')-7-{amino}-8-oxo-3-{sulfanyl}-5-thia-1- azabicyclooct-2-ene-2-carboxylic acid |
| ⚫ |
| verifiedrevid = 437200211 |
|
|
⚫ |
| image = Cefmatilen.svg |
| ⚫ |
| IUPAC_name = (6''R'',7''R'')-7-{amino}-8-oxo-3-{sulfanyl}-5-thia-1- azabicyclooct-2-ene-2-carboxylic acid |
|
|
⚫ |
| width = 280 |
| ⚫ |
| image = Cefmatilen.svg |
|
|
|
|
| ⚫ |
| width = 280 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| CAS_number = 140128-74-1 |
|
|
|
| tradename = |
| ⚫ |
| CAS_supplemental = <br/>{{CAS|154776-45-1}} (] · ]) |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| ATC_prefix = none |
|
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| ATC_suffix = |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| PubChem = 9690121 |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 140128-74-1 |
|
⚫ |
| CAS_supplemental = <br />{{CAS|154776-45-1}} (] · ]) |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 9690121 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChEMBL = 2104438 |
| ⚫ |
| C=15 |H=14 |N=8 |O=5 |S=4 |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| molecular_weight = 514.582 g/mol |
|
| ⚫ |
| smiles = C1C(=C(N2(S1)(C2=O)NC(=O)/C(=N\O)/C3=CSC(=N3)N)C(=O)O)SCSC4=NNN=C4 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 4912110 |
|
| ChemSpiderID = 4912110 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = T750UM24H8 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=15 | H=14 | N=8 | O=5 | S=4 |
|
⚫ |
| smiles = C1C(=C(N2(S1)(C2=O)NC(=O)/C(=N\O)/C3=CSC(=N3)N)C(=O)O)SCSC4=NNN=C4 |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C15H14N8O5S4/c16-15-18-5(2-30-15)8(21-28)11(24)19-9-12(25)23-10(14(26)27)6(3-29-13(9)23)31-4-32-7-1-17-22-20-7/h1-2,9,13,28H,3-4H2,(H2,16,18)(H,19,24)(H,26,27)(H,17,20,22)/b21-8-/t9-,13-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UEQVTKSAEXANEZ-YCRCPZNHSA-N |
|
| StdInChIKey = UEQVTKSAEXANEZ-YCRCPZNHSA-N |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| ⚫ |
| StdInChI=1S/C15H14N8O5S4/c16-15-18-5(2-30-15)8(21-28)11(24)19-9-12(25)23-10(14(26)27)6(3-29-13(9)23)31-4-32-7-1-17-22-20-7/h1-2,9,13,28H,3-4H2,(H2,16,18)(H,19,24)(H,26,27)(H,17,20,22)/b21-8-/t9-,13-/m1/s1 |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = Oral |
|
|
}} |
|
}} |
|
'''Cefmatilen''' (], codenamed '''S-1090''') is an orally-active ] antibiotic. It was developed in Japan and first described in 1992.<ref name=Tsuji/> |
|
'''Cefmatilen''' (], codenamed '''S-1090''') is an orally-active ] antibiotic. It was developed in Japan and first described in 1992.<ref name=Tsuji/> |
|
|
|
|
|
''In vitro'', cefmatilen is highly active against a variety of ] and ] ], including '']'' and '']''.<ref name=Tsuji>{{cite journal |author=Tsuji M, Ishii Y, Ohno A, Miyazaki S, Yamaguchi K |title=In vitro and in vivo antibacterial activities of S-1090, a new oral cephalosporin |journal=Antimicrob Agents Chemother |volume=39 |issue=11 |pages=2544–51 |year=1995 |month=November |pmid=8585742 |pmc=162981 |doi= |url=http://aac.asm.org/cgi/pmidlookup?view=long&pmid=8585742}}</ref> |
|
''In vitro'', cefmatilen is highly active against a variety of ] and ] ], including '']'' and '']''.<ref name=Tsuji>{{cite journal |vauthors=Tsuji M, Ishii Y, Ohno A, Miyazaki S, Yamaguchi K |title=In vitro and in vivo antibacterial activities of S-1090, a new oral cephalosporin |journal=Antimicrob Agents Chemother |volume=39 |issue=11 |pages=2544–51 |date=November 1995 |pmid=8585742 |pmc=162981 |doi= 10.1128/aac.39.11.2544|url=}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
<references/> |
|
<references /> |
|
|
|
|
|
==Further reading== |
|
==Further reading== |
|
*{{cite journal |author=Cazzola M |title=Novel oral cephalosporins |journal=Expert Opin Investig Drugs |volume=9 |issue=2 |pages=237–46 |year=2000 |month=February |pmid=11060674 |doi=10.1517/13543784.9.2.237}} |
|
* {{cite journal |author=Cazzola M |title=Novel oral cephalosporins |journal=Expert Opin Investig Drugs |volume=9 |issue=2 |pages=237–46 |date=February 2000 |pmid=11060674 |doi=10.1517/13543784.9.2.237|s2cid=45932120 }} |
|
{{-}} |
|
{{Clear}} |
|
{{CephalosporinAntiBiotics}} |
|
{{CephalosporinAntiBiotics}} |
|
|
|
| ⚫ |
{{antibiotic-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
⚫ |
{{antibiotic-stub}} |