Misplaced Pages

Cefpimizole: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 23:34, 30 June 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Ph← Previous edit Latest revision as of 18:06, 14 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Pyridines; added Category:Pyridinium compounds using HotCat 
(20 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| UNII_Ref = {{fdacite|changed|FDA}} | Watchedfields = changed
| verifiedrevid = 444707809
| IUPAC_name = 2--2-phenylacetyl]amino)-8-oxo-5-thia-1-azabicyclooct-2-en-3-yl]methyl)pyridin-1-ium-4-yl]ethanesulfonate
| image = Cefpimizole.svg
| width = 280

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = Rx-only
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 84880-03-5
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2103902
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 24S58UHU7N | UNII = 24S58UHU7N
| verifiedrevid = 402797569
| IUPAC_name = 2--2-phenylacetyl]amino)-8-oxo-5-thia-1-azabicyclooct-2-en-3-yl]methyl)pyridin-1-ium-4-yl]ethanesulfonate
| image = Cefpimizole.png
| width = 280
| CAS_number = 84880-03-5
| CAS_supplemental =
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 68597
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03427 | KEGG = D03427
| PubChem = 11765031
| chemical_formula =
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| C=28 | H=26 | N=6 | O=10 | S=2
| ChemSpiderID = 61863
| molecular_weight = 670.67 g/mol
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| smiles = C1C(=C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)NC(=O)C4=C(NC=N4)C(=O)O)C(=O)O)
| StdInChI = 1S/C28H26N6O10S2/c35-23(18(16-4-2-1-3-5-16)31-24(36)19-20(27(38)39)30-14-29-19)32-21-25(37)34-22(28(40)41)17(13-45-26(21)34)12-33-9-6-15(7-10-33)8-11-46(42,43)44/h1-7,9-10,14,18,21,26H,8,11-13H2,(H5-,29,30,31,32,35,36,38,39,40,41,42,43,44)/t18-,21-,26-/m1/s1
C5=CC=C(C=C5)CCS(=O)(=O)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| bioavailability =
| StdInChIKey = LNZMRLHZGOBKAN-KAWPREARSA-N
| protein_bound =

| metabolism =
<!--Chemical data-->
| elimination_half-life =
| excretion = | chemical_formula =
| C=28 | H=26 | N=6 | O=10 | S=2
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| smiles = C1C(=C(N2(S1)(C2=O)NC(=O)(C3=CC=CC=C3)NC(=O)C4=C(N=CN4)C(=O)O)C(=O))C5=CC=C(C=C5)CCS(=O)(=O)O
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = Rx-only
| routes_of_administration =
}} }}


'''Cefpimizole''' (]) is a third-generation ] ]. '''Cefpimizole''' (]) is a third-generation ] ].


==References== == References ==
*{{cite journal |author=Hara K, Shimada J |title= |language=Japanese |journal=Jpn J Antibiot |volume=40 |issue=6 |pages=1108–22 |year=1987 |month=June |pmid=3312705 |doi= |url=}} * {{cite journal | vauthors = Hara K, Shimada J | title = | language = ja | journal = The Japanese Journal of Antibiotics | volume = 40 | issue = 6 | pages = 1108–22 | date = June 1987 | pmid = 3312705 }}

== External links ==
* {{Commonscatinline|Cefpimizole}}


{{antibiotic-stub}}


{{CephalosporinAntiBiotics}} {{CephalosporinAntiBiotics}}
Line 49: Line 69:
] ]
] ]
] ]



]
{{stereochemistry-stub}}
{{antibiotic-stub}}