Revision as of 23:34, 30 June 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Ph← Previous edit |
Latest revision as of 18:06, 14 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Pyridines; added Category:Pyridinium compounds using HotCat |
(20 intermediate revisions by 15 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444707809 |
|
⚫ |
| IUPAC_name = 2--2-phenylacetyl]amino)-8-oxo-5-thia-1-azabicyclooct-2-en-3-yl]methyl)pyridin-1-ium-4-yl]ethanesulfonate |
|
⚫ |
| image = Cefpimizole.svg |
|
⚫ |
| width = 280 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Rx-only |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 84880-03-5 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2103902 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 24S58UHU7N |
|
| UNII = 24S58UHU7N |
⚫ |
| verifiedrevid = 402797569 |
|
⚫ |
| IUPAC_name = 2--2-phenylacetyl]amino)-8-oxo-5-thia-1-azabicyclooct-2-en-3-yl]methyl)pyridin-1-ium-4-yl]ethanesulfonate |
|
⚫ |
| image = Cefpimizole.png |
|
⚫ |
| width = 280 |
|
⚫ |
| CAS_number = 84880-03-5 |
|
|
| CAS_supplemental = |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
|
| PubChem = 68597 |
|
⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03427 |
|
| KEGG = D03427 |
|
|
| PubChem = 11765031 |
|
| chemical_formula = |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
⚫ |
| C=28 | H=26 | N=6 | O=10 | S=2 |
|
|
|
| ChemSpiderID = 61863 |
|
| molecular_weight = 670.67 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
⚫ |
| smiles = C1C(=C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)NC(=O)C4=C(NC=N4)C(=O)O)C(=O)O) |
|
|
|
| StdInChI = 1S/C28H26N6O10S2/c35-23(18(16-4-2-1-3-5-16)31-24(36)19-20(27(38)39)30-14-29-19)32-21-25(37)34-22(28(40)41)17(13-45-26(21)34)12-33-9-6-15(7-10-33)8-11-46(42,43)44/h1-7,9-10,14,18,21,26H,8,11-13H2,(H5-,29,30,31,32,35,36,38,39,40,41,42,43,44)/t18-,21-,26-/m1/s1 |
|
C5=CC=C(C=C5)CCS(=O)(=O) |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
⚫ |
| bioavailability = |
|
|
|
| StdInChIKey = LNZMRLHZGOBKAN-KAWPREARSA-N |
⚫ |
| protein_bound = |
|
|
|
|
⚫ |
| metabolism = |
|
|
|
<!--Chemical data--> |
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| chemical_formula = |
|
⚫ |
| C=28 | H=26 | N=6 | O=10 | S=2 |
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| smiles = C1C(=C(N2(S1)(C2=O)NC(=O)(C3=CC=CC=C3)NC(=O)C4=C(N=CN4)C(=O)O)C(=O))C5=CC=C(C=C5)CCS(=O)(=O)O |
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Rx-only |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Cefpimizole''' (]) is a third-generation ] ]. |
|
'''Cefpimizole''' (]) is a third-generation ] ]. |
|
|
|
|
|
==References== |
|
== References == |
|
*{{cite journal |author=Hara K, Shimada J |title= |language=Japanese |journal=Jpn J Antibiot |volume=40 |issue=6 |pages=1108–22 |year=1987 |month=June |pmid=3312705 |doi= |url=}} |
|
* {{cite journal | vauthors = Hara K, Shimada J | title = | language = ja | journal = The Japanese Journal of Antibiotics | volume = 40 | issue = 6 | pages = 1108–22 | date = June 1987 | pmid = 3312705 }} |
|
|
|
|
|
== External links == |
|
|
* {{Commonscatinline|Cefpimizole}} |
|
|
|
|
⚫ |
{{antibiotic-stub}} |
|
|
|
|
|
|
{{CephalosporinAntiBiotics}} |
|
{{CephalosporinAntiBiotics}} |
Line 49: |
Line 69: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
] |
|
|
|
{{stereochemistry-stub}} |
|
⚫ |
{{antibiotic-stub}} |