| Revision as of 12:39, 15 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.← Previous edit |
Latest revision as of 01:14, 7 January 2025 edit undoYeshu972 (talk | contribs)Extended confirmed users1,598 editsm Added linksTags: Mobile edit Mobile app edit iOS app edit App section source |
| (116 intermediate revisions by 80 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Antibiotic}} |
|
{{drugbox | verifiedrevid = 401949189 |
|
|
|
{{Drugbox |
|
| |
|
|
|
| Verifiedfields = changed |
|
| IUPAC_name = (6''R'',7''R'')-7-{amino}-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylic acid |
|
|
|
| verifiedrevid = 414053518 |
|
| image = Cefpodoxime.svg |
|
| image = Cefpodoxime.svg |
|
| width = 200 |
|
| width = 200 |
|
|
| alt = |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = Vantin, others |
|
|
| Drugs.com = {{drugs.com|monograph|vantin}} |
|
|
| MedlinePlus = a698024 |
|
|
| pregnancy_AU = B1 |
|
|
| routes_of_administration = ] |
|
|
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
|
| legal_CA = Rx-only |
|
|
| legal_CA_comment = |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = Rx-only |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = 50% |
|
|
| protein_bound = 21% to 29% |
|
|
| metabolism = Negligible. Cefpodoxime proxetil is metabolized to cefpodoxime by the ] |
|
|
| elimination_half-life = 2 hours |
|
|
| excretion = ], unchanged |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|CAS}} |
|
|
| CAS_number = 80210-62-4 |
|
|
| ATC_prefix = J01 |
|
|
| ATC_suffix = DD13 |
|
|
| PubChem = 6335986 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB01416 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4891496 |
|
| ChemSpiderID = 4891496 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| InChI = 1/C15H17N5O6S2/c1-25-3-6-4-27-13-9(12(22)20(13)10(6)14(23)24)18-11(21)8(19-26-2)7-5-28-15(16)17-7/h5,9,13H,3-4H2,1-2H3,(H2,16,17)(H,18,21)(H,23,24)/b19-8-/t9-,13-/m1/s1 |
|
|
|
| UNII = 7R4F94TVGY |
|
| smiles = O=C2N1/C(=C(\CS12NC(=O)C(=N\OC)/c3nc(sc3)N)COC)C(=O)O |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| InChIKey = WYUSVOMTXWRGEK-HBWVYFAYBO |
|
|
|
| KEGG = D07650 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 3504 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1672 |
|
| ChEMBL = 1672 |
|
|
| synonyms = Cefpodoxime proxetil |
|
|
|
|
|
<!--Chemical data--> |
|
|
| IUPAC_name = (6''R'',7''R'')-7-{amino}-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclooct-2-ene-2-carboxylic acid |
|
|
| C=15 | H=17 | N=5 | O=6 | S=2 |
|
|
| smiles = O=C2N1/C(=C(\CS12NC(=O)C(=N\OC)/c3nc(sc3)N)COC)C(=O)O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H17N5O6S2/c1-25-3-6-4-27-13-9(12(22)20(13)10(6)14(23)24)18-11(21)8(19-26-2)7-5-28-15(16)17-7/h5,9,13H,3-4H2,1-2H3,(H2,16,17)(H,18,21)(H,23,24)/b19-8-/t9-,13-/m1/s1 |
|
| StdInChI = 1S/C15H17N5O6S2/c1-25-3-6-4-27-13-9(12(22)20(13)10(6)14(23)24)18-11(21)8(19-26-2)7-5-28-15(16)17-7/h5,9,13H,3-4H2,1-2H3,(H2,16,17)(H,18,21)(H,23,24)/b19-8-/t9-,13-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WYUSVOMTXWRGEK-HBWVYFAYSA-N |
|
| StdInChIKey = WYUSVOMTXWRGEK-HBWVYFAYSA-N |
|
| CAS_number = 82619-04-3 |
|
|
| ATC_prefix = J01 |
|
|
| ATC_suffix = DD13 |
|
|
| PubChem = 6335986 |
|
|
| DrugBank = |
|
|
| KEGG = D07650 |
|
|
| C = 15 | H = 17 | N = 5 | O = 6 | S = 2 |
|
|
| molecular_weight = 427.458 g/mol |
|
|
| bioavailability = 50% |
|
|
| protein_bound = 21% to 29% |
|
|
| metabolism = Negligible. Cefpodoxime proxetil is metabolized to cefpodoxime by the ] |
|
|
| elimination_half-life = 2 hours |
|
|
| excretion = ], unchanged |
|
|
| pregnancy_AU = B1 |
|
|
| pregnancy_US = B |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = Rx-only |
|
|
| routes_of_administration = Oral |
|
|
}} |
|
}} |
|
|
|
|
|
'''Cefpodoxime''' is an oral third generation ] ]. It is marketed as the ] '''cefpodoxime proxetil''' by ] under the trade name '''Vantin''' and under the name '''Orelox''' by ; '''PECEF''' in Dr Reddy's (Farhaad)]. It is active against most ] and ] organisms. Notable exceptions include '']'', '']'', and '']''. It is commonly used to treat acute ], ], and ]. It also finds use as oral continuation therapy when ] cephalosporins (such as ]) are no longer necessary for continued treatment. |
|
'''Cefpodoxime''' is an oral, third-generation ] ] available in various generic preparations. It is active against both ] and ] organisms with notable exceptions including '']'', '']'', and '']''. It is typically used to treat acute ], ], ], and gonorrhea. It also finds use as oral continuation therapy when ] cephalosporins (such as ]) are no longer necessary for continued treatment. |
|
|
|
|
|
|
Cefpodoxime inhibits peptidoglycan synthesis in bacterial cell walls. It has an oral ] of approximately 50%, which is increased when taken with food. It has an elimination half-life of 2-3 hours in adults, which is prolonged in renal failure. Approved indications include community acquired pneumonia, uncomplicated skin and skin structure infections, and uncomplicated urinary tract infections. |
|
], the parent company of ], markets cefpodoxime proxetil under the trade name '''Simplicef''' for veterinary use. The dose range in dogs is 5–10 mg/kg body weight, administered orally, once a day. |
|
|
|
|
|
|
|
<!-- Society and culture --> |
|
] of cefpodoxime '''proxetil''']]{{clear-left}} |
|
|
|
It was patented in 1980 and approved for medical use in 1989.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=495 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA495 |language=en}}</ref> |
|
|
|
|
|
==Spectrum of bacterial susceptibility and resistance== |
|
|
Cefpodoxime has been used to treat gonorrhoea, tonsillitis, pneumonia, and bronchitis. The following minimum inhibitory concentrations have been reported:<ref>{{cite web | title = Cefpodoxime, Free Acid Susceptibility and Minimum Inhibitory Concentration (MIC) Data | url = http://www.toku-e.com/Assets/MIC/Cefpodoxime%20Free%20acid.pdf }}</ref> |
|
|
|
|
|
* '']'': ≤0.03 – 1 μg/ml |
|
|
* ''Neisseria gonorrhoeae'': 0.004 – 0.06 μg/ml |
|
|
* ''Streptococcus pyogenes'': ≤0.004 – 2 μg/ml |
|
|
|
|
|
==Brand names== |
|
|
] markets cefpodoxime proxetil under the trade name <!-- (C-doxim 50Dt,drysyp,100Dt/drysyp,200 and Cv200by Neomed(India) --> Simplicef for veterinary use, and Finecure in ] markets the drug as Cefpo.<ref>{{Cite web|url=http://www.finecurepharma.com/|title=Pharmaceuticals Manufacturer, Marketer, Pharmaceutical Manufacturing Company India|website=www.finecurepharma.com|access-date=2019-05-26}}</ref><!-- (Cefpo 100Dt, 200, Cv and Dry Syrup) --><ref>{{cite web |title=Anti Biotics and Anti Bacterial |url=http://www.finecurepharma.com/cephalosporins.htm#cefu5 |publisher=Finecurepharmaceuticalsltd |access-date=2012-03-27 |archive-url=https://web.archive.org/web/20120306080133/http://www.finecurepharma.com/cephalosporins.htm#cefu5 |archive-date=2012-03-06 |url-status=dead }}</ref> |
|
|
|
|
|
Vantin (by ])<ref>{{Cite web|title = Vantin – Drugs.com|url = https://www.drugs.com/international/vantin.html|website = www.drugs.com|access-date = 2019-05-02}}</ref> in suspension or tablet form. |
|
|
|
|
|
Toraxim (by Delta Pharma Ltd., ]) |
|
|
|
|
|
Trucef (by ], Bangladesh) |
|
|
|
|
|
Tricef (by ], ]) |
|
|
|
|
|
Orelox (by ])<ref>{{Cite web|title = Orelox – Drugs.com|url = https://www.drugs.com/international/orelox.html|website = www.drugs.com|access-date = 2015-11-28}}</ref> |
|
|
|
|
|
MAPDOX-CV: Combination cefpodoxime–clavulanic acid{{By whom|date=January 2025|reason=Marketer not given.}} |
|
|
|
|
|
MONOTAX O (cefpodoxime)/MONOTAX CV (cefpodoxime–clavulanic acid) by ] |
|
|
|
|
|
ACXIME 200/CV (by Allencia Biosciences, India) |
|
|
|
|
|
POSTPOD-50 (cefpodoxime 50mg/5ml) by Laafon Galaxy Pharmaceuticals<ref>{{Cite web|title=Postpod dry syrup|url=https://www.laafon.com/product/postpod-dry-syrup/|access-date=2020-09-16|website=Laafon Galaxy Pharmaceuticals Company in Karnal|language=en-US}}</ref> |
|
|
|
|
|
==References== |
|
|
<references /> |
|
|
|
|
|
== External links == |
|
== External links == |
|
* {{PubChem|6526396}} - cefpodoxime proxetil |
|
* {{PubChem|6526396}} – cefpodoxime proxetil |
|
* (from manufacturer's website) |
|
* (from manufacturer's website) |
|
* (from manufacturer's website) |
|
* (from manufacturer's website) |
|
|
* |
|
|
|
|
{{CephalosporinAntiBiotics}} |
|
{{CephalosporinAntiBiotics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
{{antibiotic-stub}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
'''Side effects:''' After 3 dose, I suffered from blocked nose or worse, in cold weather, blocked or frozen sputum in chest leading to difficulty in breathing. Confirm with your doctor about possible side effects or allergies |
|