| Revision as of 10:45, 28 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated '') per Chem/Drugbox validation (report errors or bugs)← Previous edit |
Latest revision as of 13:22, 19 August 2022 edit undoStorchy (talk | contribs)Extended confirmed users35,151 editsNo edit summary |
| (22 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 441710518 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Chebulic acid |
|
|
⚫ |
| verifiedrevid = 441850362 |
|
| ImageFile = Chebulic acid.svg |
|
|
| ImageName = Chebulic acid |
|
| Name = Chebulic acid |
|
⚫ |
| ImageFile = Chebulic acid.svg |
| ⚫ |
| IUPACName = (2R)-2-butanedioic acid |
|
|
|
| ImageCaption = Chebulic acid, according to Lee, 2010.<ref>{{Cite journal | last1 = Lee | first1 = H. S. | last2 = Koo | first2 = Y. C. | last3 = Suh | first3 = H. J. | last4 = Kim | first4 = K. Y. | last5 = Lee | first5 = K. W. | title = Preventive effects of chebulic acid isolated from Terminalia chebula on advanced glycation endproduct-induced endothelial cell dysfunction | doi = 10.1016/j.jep.2010.07.039 | journal = Journal of Ethnopharmacology | volume = 131 | issue = 3 | pages = 567–574 | year = 2010 | pmid = 20659546}}</ref> |
|
| OtherNames = |
|
|
|
| ImageFile1 = Chebulic acid according to Klika, 2004.png |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageAlt1 = Chebulic acid, according to Klika, 2004. |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}= |
|
|
|
| ImageCaption1 = Chebulic acid, according to Klika, 2004.<ref></ref> |
| ⚫ |
| ChemSpiderID = |
|
|
⚫ |
| IUPACName = (2R)-2-butanedioic acid |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}}= |
|
|
| UNII = |
|
| OtherNames = Chebuloyl |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| KEGG_Ref = {{keggcite|correct|kegg}}= |
|
| KEGG_Ref = {{keggcite|correct|kegg}}= |
|
| KEGG = |
|
|
| InChI = |
|
| KEGG = |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}}= |
|
| InChIKey = |
|
|
⚫ |
| ChEMBL = |
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}}= |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| ChEMBL = |
|
|
⚫ |
| CASNo = 23725-05-5 |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}= |
|
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| StdInChI = |
|
|
|
| UNII = G66Q7V3DPP |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}= |
|
|
⚫ |
| PubChem = 25255065 |
|
| StdInChIKey = |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| CASNo_Ref = |
|
|
⚫ |
| ChemSpiderID = 27470963 |
| ⚫ |
| CASNo = 23725-05-5 |
|
|
⚫ |
| SMILES = c1c2c(c(c(c1O)O)O)((OC2=O)C(=O)O)(CC(=O)O)C(=O)O |
| ⚫ |
| PubChem = 25255065 |
|
|
|
| InChI = 1/C14H12O11/c15-5-1-4-7(10(19)9(5)18)8(3(12(20)21)2-6(16)17)11(13(22)23)25-14(4)24/h1,3,8,11,15,18-19H,2H2,(H,16,17)(H,20,21)(H,22,23)/t3-,8-,11-/m0/s1 |
| ⚫ |
| SMILES = Oc2c(O)cc(c1c2O)C(=O)OC(C(O)=O)C1C(C(=O)O)CC(=O)O |
|
|
|
| InChIKey = COZMWVAACFYLBI-XJEVXTIOBW |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C14H12O11/c15-5-1-4-7(10(19)9(5)18)8(3(12(20)21)2-6(16)17)11(13(22)23)25-14(4)24/h1,3,8,11,15,18-19H,2H2,(H,16,17)(H,20,21)(H,22,23)/t3-,8-,11-/m0/s1 |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = COZMWVAACFYLBI-XJEVXTIOSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>14</sub>H<sub>12</sub>O<sub>11</sub> |
|
| Formula = C<sub>14</sub>H<sub>12</sub>O<sub>11</sub> <!-- or C<sub>14</sub>H<sub>12</sub>O<sub>10</sub> --> |
|
| MolarMass = 356.23 g/mol |
|
| MolarMass = 356.23 g/mol |
|
⚫ |
| Appearance = Brown powder |
|
| ExactMass = 356.037961 u |
|
|
⚫ |
| Density = <!-- g/cm<sup>3</sup> --> |
| ⚫ |
| Appearance = Brown powder |
|
|
|
| MeltingPt = |
| ⚫ |
| Density = <!-- g/cm³ --> |
|
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Chebulic acid''' is a ] compound isolated from the ripe fruits of '']''.<ref>Isolation of chebulic acid from Terminalia chebula Retz. and its antioxidant effect in isolated rat hepatocytes. Lee Hyun-Sun, Jung Sung-Hoon, Yun Bong-Sik and Lee Kwang-Won, Archives of Toxicology, Volume 81, Number 3, March 2007 , pp. 211-218, {{doi|10.1007/s00204-006-0139-4}}</ref><ref>Preventive effects of chebulic acid isolated from Terminalia chebula on advanced glycation endproduct-induced endothelial cell dysfunction. Lee HS, Koo YC, Suh HJ, Kim KY and Lee KW, J Ethnopharmacol. 2010 Oct 5, 131(3), pp. 567-74. Epub 2010 Jul 24, {{PMID|20659546}}, {{doi|10.1016/j.jep.2010.07.039}}</ref> |
|
'''Chebulic acid''' is a ] isolated from the ripe fruits of '']''.<ref>{{Cite journal | last1 = Lee | first1 = H. S. | last2 = Jung | first2 = S. H. | last3 = Yun | first3 = B. S. | last4 = Lee | first4 = K. W. | title = Isolation of chebulic acid from Terminalia chebula Retz. And its antioxidant effect in isolated rat hepatocytes | doi = 10.1007/s00204-006-0139-4 | journal = Archives of Toxicology | volume = 81 | issue = 3 | pages = 211–218 | year = 2006 | pmid = 16932919| s2cid = 25751621 }}</ref> |
|
|
|
|
|
|
This compound possesses an ], neochebulic acid. |
| ⚫ |
==References== |
|
|
|
|
|
{{reflist}} |
|
|
|
Chebulic acid is a component of transformed ]s such as ] or ]. |
|
|
|
|
⚫ |
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Phenolic acid}} |
|
{{Phenolic acid}} |
|
|
{{Ellagitannin}} |
|
|
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |