| Revision as of 19:45, 1 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot|b← Previous edit |
Latest revision as of 03:35, 12 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
| (17 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Watchedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 443675790 |
|
| verifiedrevid = 447909656 |
|
| IUPAC_name = 2-methyl-4-(2,2,2-trichloro-1-hydroxyethoxy)<br>pentan-2-ol |
|
| IUPAC_name = 2-methyl-4-(2,2,2-trichloro-1-hydroxyethoxy)<br>pentan-2-ol |
|
| image = Chloralodol.svg |
|
| image = Chloralodol.svg |
|
|
| image_class = skin-invert-image |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 11: |
Line 13: |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_BR = C1 |
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = Schedule III |
|
| legal_US = Schedule III (No longer marketed in the US) |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
| Line 25: |
Line 29: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 3563-58-4 |
|
| CAS_number = 3563-58-4 |
|
| ATC_prefix = N05 |
|
| ATC_prefix = N05 |
|
| ATC_suffix = CC02 |
|
| ATC_suffix = CC02 |
|
| PubChem = 19094 |
|
| PubChem = 19094 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2104116 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01534 |
|
| DrugBank = DB01534 |
| Line 40: |
Line 47: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=8 | H=15 | Cl=3 | O=3 |
|
| C=8 | H=15 | Cl=3 | O=3 |
|
| molecular_weight = 265.561 g/mol |
|
|
| smiles = ClC(Cl)(Cl)C(O)OC(CC(O)(C)C)C |
|
| smiles = ClC(Cl)(Cl)C(O)OC(CC(O)(C)C)C |
|
| InChI = 1/C8H15Cl3O3/c1-5(4-7(2,3)13)14-6(12)8(9,10)11/h5-6,12-13H,4H2,1-3H3 |
|
|
| InChIKey = QVFWZNCVPCJQOP-UHFFFAOYAT |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C8H15Cl3O3/c1-5(4-7(2,3)13)14-6(12)8(9,10)11/h5-6,12-13H,4H2,1-3H3 |
|
| StdInChI = 1S/C8H15Cl3O3/c1-5(4-7(2,3)13)14-6(12)8(9,10)11/h5-6,12-13H,4H2,1-3H3 |
| Line 49: |
Line 53: |
|
| StdInChIKey = QVFWZNCVPCJQOP-UHFFFAOYSA-N |
|
| StdInChIKey = QVFWZNCVPCJQOP-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
'''Chloralodol''' ('''Chlorhexadol''') is a ]/]. It is a ] drug in the USA. |
|
|
|
'''Chloralodol''' ('''Chlorhexadol''') is a ]/].<ref>{{cite book | vauthors = Sittig M | publisher = William Andrew Publishing | chapter = Chloralodol | chapter-url = https://books.google.com/books?id=_J2ti4EkYpkC&dq=Chloralodol&pg=PA945 | title = Pharmaceutical Manufacturing Encyclopedia | date = 22 October 2013 | edition = 3rd | isbn = 978-0-8155-1856-3 | pages = 945–946 }}</ref> It is a ] drug in the USA; however, it is not currently marketed in the United States so it is no longer prescribed. |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
|
|
|
{{Hypnotics and sedatives}} |
|
{{Hypnotics and sedatives}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
] |
|
] |
| Line 57: |
Line 67: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
{{sedative-stub}} |
|
{{sedative-stub}} |
|
|
|
|
] |
|