| Revision as of 03:05, 13 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validati← Previous edit |
Latest revision as of 06:36, 10 February 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,058 edits Removed proxy/dead URL that duplicated identifier. | Use this bot. | #UCB_Other |
| (20 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 437168571 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Chlorproguanil.png |
|
|
⚫ |
| verifiedrevid = 444557296 |
|
|ImageSize=200px |
|
|
⚫ |
| ImageFile = Chlorproguanil.png |
|
|IUPACName=1--2-propan-2-ylguanidine |
|
| IUPACName = 1--2-propan-2-ylguanidine |
|
|OtherNames= |
|
| OtherNames = |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 8O3249M729 |
|
| UNII = 8O3249M729 |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=537-21-3 |
|
| CASNo = 537-21-3 |
|
| PubChem=22323 |
|
| PubChem = 22323 |
|
| SMILES=CC(C)N=C(N)N=C(N)NC1=CC(=C(C=C1)Cl)Cl |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| ChemSpiderID = 20950 |
|
|
| SMILES = Clc1ccc(NC(=N/C(=N/C(C)C)N)N)cc1Cl |
|
|
| InChI = 1/C11H15Cl2N5/c1-6(2)16-10(14)18-11(15)17-7-3-4-8(12)9(13)5-7/h3-6H,1-2H3,(H5,14,15,16,17,18) |
|
|
| InChIKey = ISZNZKHCRKXXAU-UHFFFAOYAU |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C11H15Cl2N5/c1-6(2)16-10(14)18-11(15)17-7-3-4-8(12)9(13)5-7/h3-6H,1-2H3,(H5,14,15,16,17,18) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ISZNZKHCRKXXAU-UHFFFAOYSA-N |
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>11</sub>H<sub>15</sub>Cl<sub>2</sub>N<sub>5</sub> |
|
| Formula = C<sub>11</sub>H<sub>15</sub>Cl<sub>2</sub>N<sub>5</sub> |
|
| MolarMass=288.18 g/mol |
|
| MolarMass = 288.18 g/mol |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Chlorproguanil''' is an ].<ref name=":0">{{Cite journal|title=High Risk of Severe Anaemia after Chlorproguanil-Dapsone+Artesunate Antimalarial Treatment in Patients with G6PD (A-) Deficiency|year=2008|doi=10.1371/journal.pone.0004031|doi-access=free|last1=Fanello|first1=Caterina I.|last2=Karema|first2=Corine|last3=Avellino|first3=Pamela|last4=Bancone|first4=Germana|last5=Uwimana|first5=Aline|last6=Lee|first6=Sue J.|last7=d'Alessandro|first7=Umberto|last8=Modiano|first8=David|journal=PLOS ONE|volume=3|issue=12|pages=e4031|pmid=19112496|pmc=2603295|bibcode=2008PLoSO...3.4031F}}</ref> In the late 90s and early 2000s, it was studied under collaboration with the UNICEF/UNDP/World Bank Special Program for Research and Training on Tropical Diseases and GlaxoSmithKline.<ref>{{Cite journal |last=Ridley |first=Robert G. |date=December 2004 |title=Research on infectious diseases requires better coordination |journal=Nature Medicine |language=en |volume=10 |issue=12 |pages=S137–S140 |doi=10.1038/nm1153 |pmid=15577932 |s2cid=15045454 |issn=1546-170X|doi-access=free |pmc=7095967 }}</ref> It was a potential alternative to the preexisting ] of ] and ], as malaria was showing ] to this approach.<ref>{{Citation |last1=Bukirwa |first1=H |title=Chlorproguanil-dapsone for treating uncomplicated malaria |date=2003-07-21 |url=http://dx.doi.org/10.1002/14651858.cd004387 |work=The Cochrane Database of Systematic Reviews |access-date=2023-12-08 |place=Chichester, UK |publisher=John Wiley & Sons, Ltd |last2=Critchley |first2=J|doi=10.1002/14651858.cd004387 }}</ref> It has been trialled in combination therapy with ] to treat ] after malaria treatment, however its development was prematurely stopped because of safety concerns secondary to its associated risk of ] in individuals with ].<ref>{{Cite journal |last1=Van Malderen |first1=Carine |last2=Van Geertruyden |first2=Jean-Pierre |last3=Machevo |first3=Sonia |last4=González |first4=Raquel |last5=Bassat |first5=Quique |last6=Talisuna |first6=Ambrose |last7=Yeka |first7=Adoke |last8=Nabasumba |first8=Carolyn |last9=Piola |first9=Patrice |last10=Daniel |first10=Atwine |last11=Turyakira |first11=Eleanor |last12=Forret |first12=Pascale |last13=Van Overmeir |first13=Chantal |last14=Van Loen |first14=Harry |last15=Robert |first15=Annie |date=30 April 2012 |title=Glucose-6-phosphate dehydrogenase deficiency, chlorproguanil-dapsone with artesunate and post-treatment haemolysis in African children treated for uncomplicated malaria |journal=Malaria Journal |volume=11 |issue=1 |pages=139 |doi=10.1186/1475-2875-11-139 |issn=1475-2875 |pmc=3393623 |pmid=22546009 |doi-access=free }}</ref><ref name=":0" /> |
|
'''Chlorproguanil''' is an ]. |
|
|
|
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 39: |
Line 53: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|