Misplaced Pages

Ciclonicate: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 17:54, 1 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikiped← Previous edit Latest revision as of 07:54, 25 March 2024 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,467 edits auto mw 
(15 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 447891800
| IUPAC_name = ''trans''-3,3,5-Trimethylcyclohexyl pyridine-3-carboxylate
| image = Ciclonicate.png

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number = 53449-58-4
| ATC_prefix = C04
| ATC_suffix = AC07
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL = 2104521
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7H634NXI03 | UNII = 7H634NXI03
| PubChem = 10444661
| verifiedrevid = 443600474
| ChemSpiderID = 8620080
| IUPAC_name = ''trans''-3,3,5-Trimethylcyclohexyl pyridine-3-carboxylate
| smiles = O=C(O1C(C)CC(C)(C)C1)c2cccnc2
| image = Ciclonicate.png
| StdInChI = 1S/C15H21NO2/c1-11-7-13(9-15(2,3)8-11)18-14(17)12-5-4-6-16-10-12/h4-6,10-11,13H,7-9H2,1-3H3/t11-,13-/m1/s1
| CAS_number = 53449-58-4
| StdInChIKey = GQSGZTBDVNUIQS-DGCLKSJQSA-N
| ATC_prefix = C04

| ATC_suffix = AC07
<!--Chemical data-->
| PubChem = 68703
| C=15 | H=21 | N=1 | O=2
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| C=15|H=21|N=1|O=2
| molecular_weight = 247.33274
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}} }}


'''Ciclonicate''' is a ].<ref>{{cite journal | author = Gregoratti L; Crespi B; Groothold G; Fuligni E; Ghiringhelli L | title = Treatment of arteriosclerotic peripheral vascular diseases with ciclonicate | journal = Minerva cardioangiologica | year = 1982 | volume = 30 | issue = 11 | pages = 659–668 | pmid = 7155375}}</ref> '''Ciclonicate''' is a ].<ref>{{cite journal |vauthors=Gregoratti L, Crespi B, Groothold G, Fuligni E, Ghiringhelli L | title = Treatment of arteriosclerotic peripheral vascular diseases with ciclonicate | journal = Minerva Cardioangiologica | year = 1982 | volume = 30 | issue = 11 | pages = 659–668 | pmid = 7155375}}</ref>


==References== ==References==
{{Reflist}} {{Reflist}}



{{Peripheral vasodilators}} {{Peripheral vasodilators}}


] ]