Revision as of 22:14, 10 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Latest revision as of 14:19, 25 December 2023 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,799 edits consistent citation formatting |
(44 intermediate revisions by 32 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Local anaesthetic drug}} |
|
{{merge|Dibucaine number|discuss=Talk:Cinchocaine#Merger proposal|date=November 2009}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443524583 |
|
| verifiedrevid = 460037677 |
|
| IUPAC_name = 2-butoxy-''N''-quinoline-4-carboxamide |
|
| IUPAC_name = 2-butoxy-''N''-quinoline-4-carboxamide |
|
| image = Cinchocaine.svg |
|
| image = Cinchocaine.svg |
|
|
| image2 = Cinchocaine 3D ball-and-stick.png |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
Line 13: |
Line 14: |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_US = OTC |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = topical, intravenous (equine euthanasia) |
|
| routes_of_administration = topical, intravenous (for ]) |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
Line 23: |
Line 23: |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 7159 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 85-79-0 |
|
| CAS_number = 85-79-0 |
|
| ATC_prefix = C05 |
|
| ATC_prefix = C05 |
|
| ATC_suffix = AD04 |
|
| ATC_suffix = AD04 |
|
| ATC_supplemental = {{ATC|D04|AB02}} {{ATC|N01|BB06}} {{ATC|S01|HA06}} |
|
| ATC_supplemental = {{ATC|D04|AB02}} {{ATC|N01|BB06}} {{ATC|S01|HA06}} {{ATC|S02|DA04}} |
|
| PubChem = 3025 |
|
| PubChem = 3025 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
Line 43: |
Line 43: |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1086 |
|
| ChEMBL = 1086 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=20 | H=29 | N=3 | O=2 |
|
| C=20 | H=29 | N=3 | O=2 |
|
| molecular_weight = 343.463 g/mol |
|
|
| smiles = O=C(c1c2ccccc2nc(OCCCC)c1)NCCN(CC)CC |
|
| smiles = O=C(c1c2ccccc2nc(OCCCC)c1)NCCN(CC)CC |
|
| InChI = 1/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24) |
|
|
| InChIKey = PUFQVTATUTYEAL-UHFFFAOYAU |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24) |
|
| StdInChI = 1S/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24) |
Line 55: |
Line 51: |
|
| StdInChIKey = PUFQVTATUTYEAL-UHFFFAOYSA-N |
|
| StdInChIKey = PUFQVTATUTYEAL-UHFFFAOYSA-N |
|
}} |
|
}} |
|
'''Cinchocaine''' (or '''Dibucaine''') is an ] ]. It is the active ingredient in some topical hemorrhoid creams such as ]. It is sold under the brand names '''Cincain''', '''Nupercainal''', '''Nupercaine''' and '''Sovcaine''' . |
|
'''Cinchocaine''' (]/]) or '''dibucaine''' (]) is an ] ]. Among the most potent and toxic of the long-acting local anesthetics, current use of cinchocaine is generally restricted to spinal and topical anesthesia.<ref>Martindale, The Extra Pharmacopoeia, 30th ed, p1006</ref><ref>{{cite web | url = https://meshb.nlm.nih.gov/record/ui?ui=D003992 | title = Dibucaine | work = MeSH Browser | publisher = U.S. National Library of Medicine }}</ref> It is sold under the brand names '''Cincain''', '''Nupercainal''', '''Nupercaine''' and '''Sovcaine'''. |
|
|
|
|
|
|
==Medical use== |
|
Dibucaine is insoluble in alkaline aquatic environments. |
|
|
|
Cinchocaine is the active ingredient in some topical ] creams such as ].<ref name="Netdoctor">{{Cite web | vauthors = Henderson R | date = 29 November 2020 | url=https://www.netdoctor.co.uk/medicines/digestion/a7401/proctosedyl-ointment-suppositories-cinchocaine-hydrocortisone/ | title=Proctosedyl ointment/suppositories (cinchocaine, hydrocortisone) | publisher = Netdoctor | access-date=25 December 2019}}</ref> It is also a component of the ] drug Somulose, used for ] of ]s and ]. |
|
|
|
|
|
|
==Physical properties== |
|
It is also a component of the ] drug '''Somulose''', used for ] of ] and ]. |
|
|
|
Cinchocaine is relatively ] in ] aqueous solutions. |
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
* ] |
|
|
|
|
|
==External links== |
|
== References == |
|
|
{{reflist}} |
⚫ |
* {{cite journal | author = Abdel-Ghani N, Youssef A, Awady M | title = Cinchocaine hydrochloride determination by atomic absorption spectrometry and spectrophotometry. | journal = Farmaco | volume = 60 | issue = 5 | pages = 419–24 | year = 2005 | pmid = 15910814 | doi = 10.1016/j.farmac.2005.03.001}} |
|
⚫ |
* {{cite journal | author = Souto-Padron T, Lima AP, de Oliveira Ribeiro R. | title = Effects of dibucaine on the endocytic/exocytic pathways in Trypanosoma cruzi. | journal = Parasitol Res | volume = 99| issue = 4| pages = 317| year = 2006 | pmid = 16612626 | doi = 10.1007/s00436-006-0192-1}} |
|
⚫ |
* {{cite journal | author = Nounou M, El-Khordagui L, Khalafallah N | title = Effect of various formulation variables on the encapsulation and stability of dibucaine base in multilamellar vesicles. | journal = Acta Pol Pharm | volume = 62 | issue = 5 | pages = 369–79 | year = 2005| pmid = 16459486}} |
|
|
* {{cite journal | author = Aroti,A.;Leontidis, E. | title = | journal = Journal of Chemical Education| volume = 76 | issue = | pages = 786–788 | year = 2001 | unused_data = pmid }} |
|
|
|
|
|
|
|
== Further reading == |
|
|
{{refbegin}} |
|
⚫ |
* {{cite journal | vauthors = Abdel-Ghani NT, Youssef AF, Awady MA | title = Cinchocaine hydrochloride determination by atomic absorption spectrometry and spectrophotometry | journal = Farmaco | volume = 60 | issue = 5 | pages = 419–424 | date = May 2005 | pmid = 15910814 | doi = 10.1016/j.farmac.2005.03.001 }} |
|
⚫ |
* {{cite journal | vauthors = Souto-Padrón T, Lima AP, ((Ribeiro Rd)) | title = Effects of dibucaine on the endocytic/exocytic pathways in Trypanosoma cruzi | journal = Parasitology Research | volume = 99 | issue = 4 | pages = 317–320 | date = September 2006 | pmid = 16612626 | doi = 10.1007/s00436-006-0192-1 | s2cid = 5933459 }} |
|
⚫ |
* {{cite journal | vauthors = Nounou MM, El-Khordagui LK, Khalafallah N | title = Effect of various formulation variables on the encapsulation and stability of dibucaine base in multilamellar vesicles | journal = Acta Poloniae Pharmaceutica | volume = 62 | issue = 5 | pages = 369–379 | year = 2005 | pmid = 16459486 }} |
|
|
* {{cite journal | vauthors = Aroti A, Leontidis E | title = Simultaneous Determination of the Ionization Constant and the Solubility of Sparingly Soluble Drug Substances. A Physical Chemistry Experiment. | journal = Journal of Chemical Education| volume = 78 | issue = 6 | pages = 786–788 | year = 2001 | doi = 10.1021/ed078p786 | bibcode = 2001JChEd..78..786A }} |
|
|
{{refend}} |
|
|
|
|
|
{{Vasoprotectives}} |
|
{{Vasoprotectives}} |
|
{{Antipruritics}} |
|
{{Antipruritics}} |
|
{{local anesthetics}} |
|
{{local anesthetics}} |
|
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{cardiovascular-drug-stub}} |
|
|
{{dermatologic-drug-stub}} |
|
{{dermatologic-drug-stub}} |
|
{{nervous-system-drug-stub}} |
|
{{nervous-system-drug-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|