| Revision as of 02:03, 24 December 2010 editPashihiko (talk | contribs)Extended confirmed users3,563 editsNo edit summary← Previous edit |
Latest revision as of 11:09, 24 August 2023 edit undoVaccinationist (talk | contribs)Extended confirmed users4,736 edits svg formulaTag: 2017 wikitext editor |
| (43 intermediate revisions by 31 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = 1--5-methylpyrimidine- 2,4-dione |
|
|
|
| Watchedfields = changed |
| ⚫ |
| image = Clevudine.png |
|
|
|
| verifiedrevid = 403967114 |
| ⚫ |
| CAS_number = 69256-17-3 |
|
|
⚫ |
| IUPAC_name = 1--5-methylpyrimidine- 2,4-dione |
|
| CAS_supplemental = |
|
|
⚫ |
| image = Clevudine structure.svg |
| ⚫ |
| ATC_prefix = J05 |
|
|
|
| width = 155 |
| ⚫ |
| ATC_suffix = AF12 |
|
|
|
|
| ⚫ |
| ATC_supplemental = <ref>{{cite web |url=http://www.whocc.no/atcddd/new_atc_ddd.html#ATCDDD_FINAL |title=ATC/DDD Classification (FINAL): New ATC 5th level codes |date=August 27, 2008 |author=WHO International Working Group for Drug Statistics Methodology |publisher=WHO Collaborating Centre for Drug Statistics Methodology |accessdate=2008-09-05 |archiveurl = http://web.archive.org/web/20080506023243/http://www.whocc.no/atcddd/new_atc_ddd.html#ATCDDD_FINAL <!-- Bot retrieved archive --> |archivedate = 2008-05-06}}</ref> |
|
|
|
<!--Clinical data--> |
| ⚫ |
| PubChem = 73115 |
|
|
| DrugBank = |
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| KEGG = D03537 |
|
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| chemical_formula = |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| C=10 | H=13 | F=1 | N=2 | O=5 |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| molecular_weight = 260.219 g/mol |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| bioavailability = |
|
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| ⚫ |
| protein_bound = |
|
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| ⚫ |
| metabolism = |
|
|
⚫ |
| legal_status = |
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number = 163252-36-6 |
|
⚫ |
| ATC_prefix = J05 |
|
⚫ |
| ATC_suffix = AF12 |
|
⚫ |
| ATC_supplemental = <ref>{{cite web|url=http://www.whocc.no/atcddd/new_atc_ddd.html#ATCDDD_FINAL |title=ATC/DDD Classification (FINAL): New ATC 5th level codes |date=August 27, 2008 |author=WHO International Working Group for Drug Statistics Methodology |publisher=WHO Collaborating Centre for Drug Statistics Methodology |access-date=2008-09-05 |archive-url=https://web.archive.org/web/20080506023243/http://www.whocc.no/atcddd/new_atc_ddd.html#ATCDDD_FINAL |archive-date=2008-05-06 |url-status=dead }}</ref> |
|
⚫ |
| PubChem = 73115 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = IN51MVP5F1 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D03537 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 458875 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 65894 |
|
|
| smiles = O=C/1NC(=O)N(\C=C\1C)2O((O)2F)CO |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C10H13FN2O5/c1-4-2-13(10(17)12-8(4)16)9-6(11)7(15)5(3-14)18-9/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)/t5-,6+,7-,9-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = GBBJCSTXCAQSSJ-XQXXSGGOSA-N |
|
|
| index2_label = active moiety |
|
|
| CAS_number2_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number2 = 69256-17-3 |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = 37F7D05ANB |
|
|
<!--Chemical data--> |
|
⚫ |
| chemical_formula = |
|
⚫ |
| C=10 | H=13 | F=1 | N=2 | O=5 |
|
}} |
|
}} |
|
|
|
|
|
'''Clevudine''' (]) is an antiviral drug for the treatment of ]. Clevudine is already approved for HBV in South Korea and the Philippines. It is marketed by ] in South Korea under the tradenames '''Levovir''' and '''Revovir'''. |
|
'''Clevudine''' (]) is an antiviral drug for the treatment of ] (HBV). It is already approved for HBV in ] and the ]. It is marketed by Bukwang Pharmaceuticals in South Korea under the tradenames '''Levovir''' and '''Revovir'''. |
|
Under license from Bukwang, Pharmasset was developing the drug, but its phase III clinical trial (international, multicenter, randomized, double-blind, 96 week QUASH studies) was terminated due to some myopathy cases in patients. |
|
|
|
|
|
|
It is a ].<ref name="pmid16628625">{{cite journal |unused_data=DUPLICATE DATA: doi=10.1002/hep.21166 |author=Lee HS, Chung YH, Lee K, ''et al.'' |title=A 12-week clevudine therapy showed potent and durable antiviral activity in HBeAg-positive chronic hepatitis B |journal=Hepatology |volume=43 |issue=5 |pages=982–8 |year=2006 |month=May |pmid=16628625 |doi=10.1002/hep.21166}}</ref> |
|
Researchers in South Korea are testing clevudine at lower doses in combination with ] for continued use.<ref name="pmid25101150 ">{{cite journal |vauthors=Tak WY, Yang JM, Kim BI, Baik SK, Cheon GJ, Byun KS, Kim DY, Yoo BC |title=A randomized, open-label study comparing low-dose clevudine plus adefovir combination therapy with clevudine monotherapy in naïve chronic hepatitis B patients. |journal=Hepatology International |volume=8 |issue=3 |pages=375–381 |date=May 2014 |pmid=25101150 |display-authors=etal |doi=10.1007/s12072-014-9537-5 |pmc=4116600}}</ref> |
|
|
|
|
|
It is a ].<ref name="pmid16628625">{{cite journal |vauthors=Lee HS, Chung YH, Lee K |title=A 12-week clevudine therapy showed potent and durable antiviral activity in HBeAg-positive chronic hepatitis B |journal=Hepatology |volume=43 |issue=5 |pages=982–8 |date=May 2006 |pmid=16628625 |doi=10.1002/hep.21166|display-authors=etal|doi-access=free }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 38: |
Line 69: |
|
|
|
|
|
{{Antivirals}} |
|
{{Antivirals}} |
|
|
|
|
|
|
| ⚫ |
{{antiinfective-drug-stub}} |
|
|
|
|
|
] |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
⚫ |
{{antiinfective-drug-stub}} |