| Revision as of 22:52, 10 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII', 'CAS_number').← Previous edit |
Latest revision as of 17:31, 15 December 2024 edit undoLaura240406 (talk | contribs)Extended confirmed users904 editsm Cleaned up using AutoEd |
| (17 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 399719744 |
|
| verifiedrevid = 460043413 |
|
| IUPAC_name = |
|
|
|
| imageL = Clofexamide_skeletal.svg |
|
| image = |
|
|
|
| altL = Structure of clofexamide |
|
|
|
|
|
| imageR = Phenylbutazone.svg |
|
|
| altR = Structure of phenylbutazone |
|
|
| captionLR = Structures of clofexamide and phenylbutazone |
|
<!--Combo data--> |
|
<!--Combo data--> |
|
| type = combo |
|
| type = combo |
|
| component1 = Clofexamide |
|
| component1 = Clofexamide |
|
| component2 = Phenylbutazone |
|
| component2 = Phenylbutazone |
|
|
| class1 = ] |
|
| class2 = ] |
|
| class2 = ] |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Perclusone |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = Discontinued |
|
| routes_of_administration = Oral, rectal, topical |
|
| routes_of_administration = Oral, rectal, topical |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 17449-96-6 --> |
|
| CAS_number = 17449-96-6 |
|
| ATC_prefix = M02 |
|
| ATC_prefix = M02 |
|
| ATC_suffix = AA03 |
|
| ATC_suffix = AA03 |
| Line 31: |
Line 34: |
|
| PubChem = 6433695 |
|
| PubChem = 6433695 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4938775 |
|
| ChemSpiderID = 4938775 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = TPT3MH65LD |
|
| UNII = 5RB28NE79Y |
|
|
<!--Chemical data--> |
|
| smiles = O=C(NCCN(CC)CC)COc1ccc(Cl)cc1.O=C2N(c1ccccc1)N(C(=O)C2CCCC)c3ccccc3 |
|
|
| InChI = 1/C19H20N2O2.C14H21ClN2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;1-3-17(4-2)10-9-16-14(18)11-19-13-7-5-12(15)6-8-13/h4-13,17H,2-3,14H2,1H3;5-8H,3-4,9-11H2,1-2H3,(H,16,18) |
|
|
| InChIKey = ICBCZMIEENEERJ-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C19H20N2O2.C14H21ClN2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;1-3-17(4-2)10-9-16-14(18)11-19-13-7-5-12(15)6-8-13/h4-13,17H,2-3,14H2,1H3;5-8H,3-4,9-11H2,1-2H3,(H,16,18) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = ICBCZMIEENEERJ-UHFFFAOYSA-N |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Clofezone''' (trade name '''Perclusone''') is a drug that was used to treat joint and muscular pain, but is not marketed any more. It is a combination of ], an ], and ], a ] (NSAID).<ref name="Hunnius">{{cite book|editor1-first=Artur|editor1-last=Berger|editor2-first=Helmut|editor2-last=Wachter | name-list-style = vanc |title=Hunnius Pharmazeutisches Wörterbuch|edition=8|publisher=Walter de Gruyter Verlag|year=1998|page=343|language=German|isbn=3-11-015793-4}}</ref><ref>{{cite journal | vauthors = Reinicke C, Helbing M, Klingenfeld U, Lasaroff I, Wessel G | title = | journal = Die Pharmazie | volume = 39 | issue = 12 | pages = 824–7 | date = December 1984 | pmid = 6241720 }}</ref> |
|
'''Clofezone''' is a drug used for joint and muscular pain. It is a combination of ] and ]. |
|
|
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{NSAIDs}} |
|
|
{{Topical products for joint and muscular pain}} |
|
{{Topical products for joint and muscular pain}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |
|
{{musculoskeletal-drug-stub}} |