| Revision as of 19:22, 21 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot|bug← Previous edit |
Latest revision as of 23:05, 20 December 2024 edit undoLaura240406 (talk | contribs)Extended confirmed users904 editsm →See also: remove self redirect |
| (50 intermediate revisions by 27 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Nonsteroidal anti-inflammatory drug (NSAID)}} |
|
{{chembox |
|
|
|
{{Chembox |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| Verifiedfields = changed |
| ⚫ |
| UNII = V7DXN0M42R |
|
|
|
| Watchedfields = changed |
|
| verifiedrevid = 444429984 |
|
| verifiedrevid = 451725338 |
|
| ImageFile = Clonixin.png |
|
| ImageFile = Clonixin.png |
|
⚫ |
| PIN = 2-(3-Chloro-2-methylanilino)pyridine-3-carboxylic acid |
|
| ImageSize = 200px |
|
|
|
| OtherNames = Clonixic acid; CBA 93626<ref name="Clinical">{{cite journal|url=http://onlinelibrary.wiley.com/doi/10.1177/009127007101100508/abstract|title=Clonixin: A Clinical Evaluation of a New Oral Analgesic |journal=The Journal of Clinical Pharmacology and New Drugs |volume=11 |issue=5 |pages=371–377 |access-date=2015-05-21|doi=10.1177/009127007101100508|pmid=4935715 |year=1971 |last1=Finch |first1=Jay S. |last2=Dekornfeld |first2=Thomas J. |hdl=2027.42/67636 |s2cid=38883141 |hdl-access=free }}</ref> |
| ⚫ |
| IUPACName = 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| OtherNames = Clonixic acid; CBA 93626<ref name="Clinical">{{cite web|url=http://jcp.sagepub.com/cgi/content/abstract/11/5/371|title=Clonixin: A Clinical Evaluation of a New Oral Analgesic |last=The Journal of Clinical Pharmacology|accessdate=2010-06-16}}</ref> |
|
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = |
|
| Abbreviations = |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 17737-65-4 |
|
| CASNo = 17737-65-4 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = V7DXN0M42R |
|
| PubChem = 28718 |
|
| PubChem = 28718 |
|
| SMILES = O=C(O)C1=CC=CN=C1NC2=C(C)C(Cl)=CC=C2 |
|
| SMILES = O=C(O)C1=CC=CN=C1NC2=C(C)C(Cl)=CC=C2 |
|
| MeSHName = |
|
| MeSHName = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID = |
|
| ChemSpiderID = 26711 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI = |
|
| ChEMBL = 1332971 |
|
|
| InChI = 1/C13H11ClN2O2/c1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12/h2-7H,1H3,(H,15,16)(H,17,18) |
|
| ATCCode_prefix = |
|
|
|
| InChIKey = CLOMYZFHNHFSIQ-UHFFFAOYAG |
|
| ATCCode_suffix = |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| ATC_Supplemental = |
|
|
|
| StdInChI = 1S/C13H11ClN2O2/c1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12/h2-7H,1H3,(H,15,16)(H,17,18) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = CLOMYZFHNHFSIQ-UHFFFAOYSA-N |
|
|
| ChEBI_Ref = {{ebicite|changed|???}} |
|
|
| ChEBI = 76200 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03555 |
|
| KEGG = D03555 |
|
⚫ |
}} |
|
| DCB = 05349 (clonixinato de lisina) <!-- this is brazilian data, pt:Denominação Comum Brasileira //--> |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| Medicamento_de_referência = |
|
| ⚫ |
}} |
|
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
| C=13 | H=11 | Cl=1 | N=2 | O=2 |
|
| C=13 | H=11 | Cl=1 | N=2 | O=2 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| Melting_notes = |
|
| MeltingPt_notes = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Boiling_notes = |
|
| BoilingPt_notes = |
|
| Solubility = |
|
| Solubility = |
|
| SolubleOther = |
|
| SolubleOther = |
|
| Solvent = |
|
| Solvent = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Pharmacology |
|
|Section3={{Chembox Pharmacology |
|
| AdminRoutes = ] |
|
| AdminRoutes = ] |
|
| Bioavail = |
|
| Bioavail = |
|
| Metabolism = |
|
| Metabolism = Glucuronidation via UGT2B7 |
|
| HalfLife = |
|
| HalfLife = |
|
| ProteinBound = |
|
| ProteinBound = |
|
| Excretion = |
|
| Excretion = |
|
| Volume_de_distribuição = |
|
|
| Depuração = |
|
|
| Concentrações_máximas = |
|
|
| Legal_status = |
|
| Legal_status = |
|
| Legal_US = |
|
| Legal_US = Not sold in the U.S. |
|
|
}} |
|
| Legal_BR = |
|
|
⚫ |
|Section4={{Chembox Hazards |
|
⚫ |
| LD50 = |
|
}} |
|
}} |
| ⚫ |
| Section4 = {{Chembox Hazards |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
| ⚫ |
| LD50 = }} |
|
|
|Section5 = |
|
|
|fundo = fármaco |
|
|
}} |
|
}} |
|
|
|
|
|
'''Clonixin''' is a ]. It also has ], ], and ] actions. It is used primarily in the treatment of chronic arthritic conditions and certain soft tissue disorders associated with pain and inflammation. |
|
'''Clonixin''' is a ] (NSAID). It also has ], ], and ] actions. It is used primarily in the treatment of chronic arthritic conditions and certain soft tissue disorders associated with pain and inflammation. |
|
|
|
|
|
==Synthesis== |
|
|
]).]] |
|
|
|
|
|
==Clonixeril== |
|
|
The glyceryl ester of clonixin, clonixeril, is also an NSAID. It was prepared by a somewhat roundabout method. |
|
|
] |
|
|
Clonixin was reacted with ] and ] to give '''2'''. Heating with ] and ] displaced the ] to produce ester '''3''', which was deblocked in ] to produce clonixeril ('''4'''). |
|
|
|
|
|
==See also== |
|
|
*] |
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
{{Prostanoidergics}} |
|
] |
|
|
|
|
| ⚫ |
] |
|
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |
|
{{musculoskeletal-drug-stub}} |
|
|
|
|
] |
|