Misplaced Pages

Coumermycin A1: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 23:16, 27 September 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsNo edit summary← Previous edit Latest revision as of 19:01, 8 January 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,633 editsmNo edit summary 
(35 intermediate revisions by 22 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
| IUPAC_name = oxy-8-methyl-4-oxochromen-3-yl]carbamoyl]-3-methyl-1''H''-pyrrole-2-carbonyl]amino]-8-methyl-4-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1''H''-pyrrole-2-carboxylate
| Watchedfields = changed
| image = Coumermycin A1.png
| verifiedrevid = 387419821
| synonyms = Coumamycin
| IUPAC_name = 3-methyl-1''H''-pyrrole-2,4-diyl)bis bis(5-methyl-1''H''-pyrrole-2-carboxylate
| CAS_number = 4434-05-3
| image = Coumermycin A1.svg
| ATC_prefix = none

| ATC_suffix =
<!--Clinical data-->
| PubChem = 451651
| tradename =
| DrugBank =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| chemical_formula =
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 4434-05-3
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = PCH9QZ1IIH
| ATC_prefix = none
| ATC_suffix =
| PubChem = 54675768
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 389471
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 3907
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 16736904

<!--Chemical data-->
| C=55 | H=59 | N=5 | O=20 | C=55 | H=59 | N=5 | O=20
| smiles = CO1(OC(=O)c2ccc(C)2)(O)(Oc2ccc3c(O)c(NC(=O)c4cc(C(=O)Nc5c(=O)oc6c(C)c(ccc6c5O)O5OC(C)(C)(OC)(OC(=O)c6ccc(C)6)5O)c4C)c(=O)oc3c2C)OC1(C)C
| molecular_weight = 1110.08 g/mol
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| smiles = CC1=CC=C(N1)C(=O)O2(C(OC(2OC)(C)C)OC3=C(C4=C(C=C3)C(=O)C(=C(O4)O)NC(=O)C5=CNC(=C5C)C(=O)NC6=C(OC7=C(C6=O)C=CC(=C7C)OC8(((C(O8)(C)C)OC)OC(=O)C9=CC=C(N9)C)O)O)C)O
| StdInChI = 1S/C55H59N5O20/c1-21-12-16-29(57-21)48(67)77-42-38(63)52(79-54(6,7)44(42)71-10)73-31-18-14-26-36(61)34(50(69)75-40(26)24(31)4)59-46(65)28-20-56-33(23(28)3)47(66)60-35-37(62)27-15-19-32(25(5)41(27)76-51(35)70)74-53-39(64)43(45(72-11)55(8,9)80-53)78-49(68)30-17-13-22(2)58-30/h12-20,38-39,42-45,52-53,56-58,61-64H,1-11H3,(H,59,65)(H,60,66)/t38-,39-,42+,43+,44-,45-,52-,53-/m1/s1
| bioavailability =
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| protein_bound =
| StdInChIKey = WTIJXIZOODAMJT-DHFGXMAYSA-N
| metabolism =
| synonyms = Coumamycin
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}} }}


'''Coumermycin A1''' is an ].<ref>{{cite journal | vauthors = Heide L | title = Genetic engineering of antibiotic biosynthesis for the generation of new aminocoumarins | journal = Biotechnology Advances | volume = 27 | issue = 6 | pages = 1006–1014 | year = 2009 | pmid = 19463934 | doi = 10.1016/j.biotechadv.2009.05.017 }}</ref><ref>{{cite journal | vauthors = Heide L, Gust B, Anderle C, Li SM | title = Combinatorial biosynthesis, metabolic engineering and mutasynthesis for the generation of new aminocoumarin antibiotics | journal = Current Topics in Medicinal Chemistry | volume = 8 | issue = 8 | pages = 667–79 | year = 2008 | pmid = 18473891 | doi = 10.2174/156802608784221505 }}</ref> Its main target is the ] site of the ] GyrB subunit.<ref>{{cite journal | vauthors = Vanden Broeck A, McEwen AG, Chebaro Y, Potier N, Lamour V | title = Structural Basis for DNA Gyrase Interaction with Coumermycin A1 | journal = Journal of Medicinal Chemistry | volume = 62 | issue = 8 | pages = 4225–4231 | date = April 2019 | pmid = 30920824 | doi = 10.1021/acs.jmedchem.8b01928 | doi-access = free }}</ref>
'''Coumermycin A1''' is an ].<ref>{{cite pmid|19463934}}</ref><ref>{{cite pmid|18473891}}</ref>


==References== == See also ==
* ]

== References ==
{{reflist}} {{reflist}}


{{antibiotic-stub}}
{{Nucleic acid inhibitors}} {{Nucleic acid inhibitors}}

] ]
] ]

{{antibiotic-stub}}
Coumermycin A1: Difference between revisions Add topic