Misplaced Pages

Cresol Red: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 14:02, 3 March 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits added Category:Cresols using HotCat← Previous edit Latest revision as of 16:57, 7 December 2024 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,071 editsmNo edit summary 
(22 intermediate revisions by 20 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
⚫ | verifiedrevid = 399733216
| Watchedfields = changed
⚫ | verifiedrevid = 416907625
| Name = Cresol Red | Name = Cresol Red
| ImageFile = Cresol Red.svg | ImageFile = Cresol Red.svg
<!-- | ImageSize = 200px --> <!-- | ImageSize = 200px -->
| ImageFile2 = Cresol-red-3D-sticks.png
| IUPACName =
| ImageSize2 = 200px
| PIN = 3,3-Bis(4-hydroxy-3-methylphenyl)-2,1λ<sup>6</sup>-benzoxathiole-1,1(3''H'')-dione
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 65818 | ChemSpiderID = 65818
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 86218
| PubChem = 73013 | PubChem = 73013
| InChI = 1/C21H18O5S/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21/h3-12,22-23H,1-2H3 | InChI = 1/C21H18O5S/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21/h3-12,22-23H,1-2H3
| InChIKey = OBRMNDMBJQTZHV-UHFFFAOYAD | InChIKey = OBRMNDMBJQTZHV-UHFFFAOYAD
| SMILES1 = O=S2(=O)OC(c1ccccc12)(c3ccc(O)c(c3)C)c4ccc(O)c(c4)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H18O5S/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21/h3-12,22-23H,1-2H3 | StdInChI = 1S/C21H18O5S/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21/h3-12,22-23H,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OBRMNDMBJQTZHV-UHFFFAOYSA-N | StdInChIKey = OBRMNDMBJQTZHV-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 1733-12-6 | CASNo = 1733-12-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 839K2R4B8K
| SMILES = Cc1cc(ccc1O)/C(=C/2C=CC(=O)C(=C2)C)c3ccccc3OS(O)=O | SMILES = Cc1cc(ccc1O)/C(=C/2C=CC(=O)C(=C2)C)c3ccccc3OS(O)=O
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>21</sub>H<sub>17</sub>NaO<sub>5</sub>S | Formula = C<sub>21</sub>H<sub>17</sub>NaO<sub>5</sub>S
| MolarMass = 404.41 g/mol | MolarMass = 382.43 g/mol
| Density = | Density =
| MeltingPt = | MeltingPt =
Line 28: Line 36:
}} }}


'''Cresol Red''' (full name: o-Cresolsulfonephthalein) is a ] frequently used for monitoring the ] in ]. '''Cresol red''' (full name: ''o''-cresolsulfonephthalein)<ref>{{Cite web |last=PubChem |title=Cresol red |url=https://pubchem.ncbi.nlm.nih.gov/compound/73013 |access-date=2023-01-25 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> is a ] frequently used for monitoring the ] in ].

⚫ {{pH_indicator_template|indicator_name=Cresol red|low_pH=7.2|high_pH=8.8|low_pH_color=yellow|high_pH_color=#800080|high_pH_text=white}}


==pH indicator==
⚫ {{pH_indicator_template|indicator_name=Cresol Red|low_pH=7.2|high_pH=8.8|low_pH_color=yellow|high_pH_color=#800080}}
<br />
<br />
<br />
<br />
<br />
<br />
==Molecular biology== ==Molecular biology==
Cresol Red can be used in many common molecular biology reactions in place of other loading dyes. Cresol Red does not inhibit Taq polymerase to the same degree as other common loading dyes. Cresol red can be used in many common molecular biology reactions in place of other loading dyes. Cresol Red does not inhibit ] to the same degree as other common loading dyes.


==Color marker== ==Color marker==
Cresol Red can also be used as a ] to monitor the process of ] and ]. In a 1% agarose gel it runs approximately at the size of a 125 base pair (bp) ] molecule (it depends on the concentration of buffer and other component). ] and ] can also be used for this purpose. Cresol red can also be used as an ] to monitor the process of ] and ]. In a 1% agarose gel, it runs approximately at the size of a 125 base pair (bp) ] molecule (it depends on the concentration of buffer and other component). ] and ] can also be used for this purpose.


==References== ==References==
{{Unreferenced|date =September 2007}}
<references/> <references/>


Line 52: Line 53:


] ]
] ]
] ]
]

]
]
]
]
]
]
]
]
]