| Revision as of 10:39, 11 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'KEGG', 'CAS_number').← Previous edit |
Latest revision as of 15:44, 3 February 2024 edit undoVaccinationist (talk | contribs)Extended confirmed users4,733 editsmNo edit summaryTag: 2017 wikitext editor |
| (39 intermediate revisions by 34 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Barbiturate}} |
|
{{Unreferenced stub|auto=yes|date=December 2009}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 437167714 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 460109682 |
|
| IUPAC_name = ''5-(1-cyclohexenyl)-5-ethyl-1,3-diazinane-2,4,6-trione'' |
|
| IUPAC_name = ''5-(1-cyclohexenyl)-5-ethyl-1,3-diazinane-2,4,6-trione'' |
|
| image = Cyclobarbital.svg |
|
| image = Cyclobarbital.svg |
|
| width = 100 |
|
| width = 100 |
|
|
| image2 = Cyclobarbital ball-and-stick.png |
|
|
| width2 = 180 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
|
| Drugs.com = {{Drugs.com|international|cyclobarbital}} |
|
| tradename = |
|
| tradename = |
|
| pregnancy_category = ? |
|
| pregnancy_category = |
|
| legal_status = ? |
|
| legal_BR = B1 |
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref> |
| ⚫ |
| routes_of_administration = Oral |
|
|
|
| legal_CA = Schedule IV |
|
|
| legal_DE = Anlage II |
|
|
| legal_UK = Class B |
|
|
| legal_UN = P III |
|
⚫ |
| routes_of_administration = Oral (]) |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = ? |
|
| bioavailability = |
|
| metabolism = ] |
|
| metabolism = ] |
|
| elimination_half-life = ? |
|
| elimination_half-life = |
|
| excretion = ] |
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| index2_label = calcium |
|
| CAS_number = <!-- blanked - oldvalue: 143-76-0 --> |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number = 52-31-3 |
|
|
| CAS_number2_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number2 = 143-76-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 0M8A98AD9H |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = 0HZN7FV25R |
|
| ATC_prefix = N05 |
|
| ATC_prefix = N05 |
|
| ATC_suffix = CA10 |
|
| ATC_suffix = CA10 |
| Line 26: |
Line 44: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5632 |
|
| ChemSpiderID = 5632 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| UNII = 0M8A98AD9H |
|
| KEGG = D07323 |
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D07757 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 268164 |
|
| ChEMBL = 268164 |
| Line 35: |
Line 51: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=16 | N=2 | O=3 |
|
| C=12 | H=16 | N=2 | O=3 |
|
| molecular_weight = 236.267 |
|
|
| smiles = O=C1NC(=O)NC(=O)C1(/C2=C/CCCC2)CC |
|
| smiles = O=C1NC(=O)NC(=O)C1(/C2=C/CCCC2)CC |
|
| InChI = 1/C12H16N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h6H,2-5,7H2,1H3,(H2,13,14,15,16,17) |
|
|
| InChIKey = WTYGAUXICFETTC-UHFFFAOYAC |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H16N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h6H,2-5,7H2,1H3,(H2,13,14,15,16,17) |
|
| StdInChI = 1S/C12H16N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h6H,2-5,7H2,1H3,(H2,13,14,15,16,17) |
| Line 44: |
Line 57: |
|
| StdInChIKey = WTYGAUXICFETTC-UHFFFAOYSA-N |
|
| StdInChIKey = WTYGAUXICFETTC-UHFFFAOYSA-N |
|
}} |
|
}} |
|
'''Cyclobarbital''', also known as '''cyclobarbitol''' or '''cyclobarbitone''', is a ] which is a ] ]. |
|
|
|
|
|
|
|
'''Cyclobarbital''', also known as '''cyclobarbitol''' or '''cyclobarbitone''', is a ] ].<ref>{{cite journal | vauthors = Breimer DD, Winten MA | title = Pharmacokinetics and relative bioavailability of cyclobarbital calcium in man after oral administration | journal = European Journal of Clinical Pharmacology | volume = 09 | issue = 5–6 | pages = 443–50 | date = March 1976 | pmid = 989475 | doi = 10.1007/bf00606563 | s2cid = 20271169 }}</ref> It was available in Russia as a fixed-dose combination with ] (100 mg cyclobarbital + 10 mg diazepam; brand name '''Reladorm''') for the treatment of insomnia but was discontinued in 2019. |
|
{{Barbiturates}} |
|
|
|
|
|
|
== References == |
|
|
|
|
|
{{Reflist}} |
|
|
|
|
{{Hypnotics and sedatives}} |
|
{{Hypnotics and sedatives}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{sedative-stub}} |
|
{{sedative-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|