| Revision as of 22:39, 18 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - updated 'ChemSpiderID_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:Wik← Previous edit |
Latest revision as of 16:33, 17 September 2023 edit undoKoIobok (talk | contribs)Extended confirmed users1,350 edits Added Category:Alpha-Amino acids |
| (15 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 427406643 |
|
| verifiedrevid = 451225984 |
|
| IUPAC_name = 4-phthalic acid |
|
| IUPAC_name = 4-phthalic acid |
|
| image = DCPG_structure.png |
|
| image = DCPG_structure.png |
| Line 16: |
Line 18: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 23: |
Line 25: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = 201730-11-2 |
|
| CAS_number = 201730-11-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = W3Y53JA9W3 |
|
| ATC_prefix = |
|
| ATC_prefix = |
|
| ATC_suffix = |
|
| ATC_suffix = |
| Line 33: |
Line 38: |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 17222214 |
|
⚫ |
| smiles = O=C(O)(N)c1cc(c(C(=O)O)cc1)C(=O)O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C10H9NO6/c11-7(10(16)17)4-1-2-5(8(12)13)6(3-4)9(14)15/h1-3,7H,11H2,(H,12,13)(H,14,15)(H,16,17)/t7-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = IJVMOGKBEVRBPP-ZETCQYMHSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=10 | H=9 | N=1 | O=6 |
|
| C=10 | H=9 | N=1 | O=6 |
|
| molecular_weight = 239.181 g/mol |
|
| ⚫ |
| smiles = OC(=O)c1cc(C(N)C(O)=O)ccc1C(=O)O |
|
|
}} |
|
}} |
|
|
|
|
|
'''DCPG''' ('''(S)-3,4-DCPG''') is a drug used in scientific research, which acts as a potent and subtype-selective ] for the ] ]. It has ] effects in animal studies,<ref>Moldrich RX, Chapman AG, De Sarro G, Meldrum BS. Glutamate metabotropic receptors as targets for drug therapy in epilepsy. ''European Journal of Pharmacology''. 2003 Aug 22;476(1-2):3-16. {{DOI|10.1016/S0014-2999(03)02149-6}} PMID 12969743</ref><ref>Folbergrová J, Druga R, Haugvicová R, Mares P, Otáhal J. Anticonvulsant and neuroprotective effect of (S)-3,4-dicarboxyphenylglycine against seizures induced in immature rats by homocysteic acid. ''Neuropharmacology''. 2008 Mar;54(4):665-75. PMID 18191956</ref> and has also been investigated as a possible treatment for ].<ref>Marabese I, de Novellis V, Palazzo E, Scafuro MA, Vita D, Rossi F, Maione S. Effects of (S)-3,4-DCPG, an mGlu8 receptor agonist, on inflammatory and neuropathic pain in mice. ''Neuropharmacology''. 2007 Feb;52(2):253-62. PMID 17113112</ref> |
|
'''DCPG''' ('''(S)-3,4-DCPG''') is a drug used in scientific research, which acts as a potent and subtype-selective ] for the ] ]. It has ] effects in animal studies,<ref>{{cite journal | vauthors = Moldrich RX, Chapman AG, De Sarro G, Meldrum BS | title = Glutamate metabotropic receptors as targets for drug therapy in epilepsy | journal = European Journal of Pharmacology | volume = 476 | issue = 1–2 | pages = 3–16 | date = August 2003 | pmid = 12969743 | doi = 10.1016/s0014-2999(03)02149-6 }}</ref><ref>{{cite journal | vauthors = Folbergrová J, Druga R, Haugvicová R, Mares P, Otáhal J | title = Anticonvulsant and neuroprotective effect of (S)-3,4-dicarboxyphenylglycine against seizures induced in immature rats by homocysteic acid | journal = Neuropharmacology | volume = 54 | issue = 4 | pages = 665–75 | date = March 2008 | pmid = 18191956 | doi = 10.1016/j.neuropharm.2007.11.015 | s2cid = 20697899 }}</ref> and has also been investigated as a possible treatment for ].<ref>{{cite journal | vauthors = Marabese I, de Novellis V, Palazzo E, Scafuro MA, Vita D, Rossi F, Maione S | title = Effects of (S)-3,4-DCPG, an mGlu8 receptor agonist, on inflammatory and neuropathic pain in mice | journal = Neuropharmacology | volume = 52 | issue = 2 | pages = 253–62 | date = February 2007 | pmid = 17113112 | doi = 10.1016/j.neuropharm.2006.04.006 | s2cid = 25646746 }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{Reflist|30em}} |
|
|
|
|
|
|
{{Metabotropic glutamate receptor modulators}} |
|
{{Glutamate_receptor_ligands}} |
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{anticonvulsant-stub}} |
|
{{anticonvulsant-stub}} |