| Revision as of 08:19, 30 September 2010 editAlvin Seville (talk | contribs)Extended confirmed users, Pending changes reviewers33,089 edits removing and categorizing← Previous edit |
Latest revision as of 16:26, 23 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits added Category:3-Methoxyphenyl compounds using HotCat |
| (21 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
| ⚫ |
| IUPAC_name = 1-(3-methoxyphenyl)-N-methanimine |
|
|
|
| Verifiedfields = changed |
| ⚫ |
| image = DMeOB_structure.png |
|
|
|
| Watchedfields = changed |
|
| width = 200 |
|
|
|
| verifiedrevid = 387877002 |
| ⚫ |
| CAS_number = 40252-74-2 |
|
|
⚫ |
| IUPAC_name = 1-(3-methoxyphenyl)-N-methanimine |
|
| ATC_prefix = |
|
|
⚫ |
| image = DMeOB_structure.png |
|
| ATC_suffix = |
|
|
|
| width = 220 |
| ⚫ |
| PubChem = 6891506 |
|
|
|
| image2 = DMeOB 3D spacefill.png |
|
| DrugBank = |
|
|
|
| width2 = 240 |
| ⚫ |
| C=16|H=16|N=2|O=2 |
|
|
|
| alt2 = Space-filling model of the DMeOB |
|
| molecular_weight = 268.310 g/mol |
|
|
|
|
| ⚫ |
| smiles = COc2cc(ccc2)C=NN=Cc1cccc(OC)c1 |
|
|
|
<!--Clinical data--> |
|
| bioavailability = |
|
|
| protein_bound = |
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| metabolism = |
|
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| elimination_half-life = |
|
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| pregnancy_category= |
|
|
|
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
<!--Identifiers--> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
⚫ |
| CAS_number = 40252-74-2 |
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
⚫ |
| PubChem = 6891506 |
|
| legal_status = |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| routes_of_administration = |
|
|
|
| ChemSpiderID = 5277863 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H16N2O2/c1-19-15-7-3-5-13(9-15)11-17-18-12-14-6-4-8-16(10-14)20-2/h3-12H,1-2H3/b17-11+,18-12+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FBNPHFBYHYNMHC-JYFOCSDGSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=16 | H=16 | N=2 | O=2 |
|
⚫ |
| smiles = COc2cc(ccc2)C=NN=Cc1cccc(OC)c1 |
|
}} |
|
}} |
|
|
|
|
|
'''DMeOB''' is a drug used in scientific research which acts as a ] of the ] subtype ].<ref name="pmid12920211">{{cite journal |author=O'Brien JA, Lemaire W, Chen TB, Chang RS, Jacobson MA, Ha SN, Lindsley CW, Schaffhauser HJ, Sur C, Pettibone DJ, Conn PJ, Williams DL |title=A family of highly selective allosteric modulators of the metabotropic glutamate receptor subtype 5 |journal=Molecular Pharmacology |volume=64 |issue=3 |pages=731–40 |year=2003 |month=September |pmid=12920211 |doi=10.1124/mol.64.3.731 |url= |issn=}}</ref> |
|
'''DMeOB''' is a drug used in scientific research which acts as a ] of the ] subtype ].<ref name="pmid12920211">{{cite journal |vauthors=O'Brien JA, Lemaire W, Chen TB, Chang RS, Jacobson MA, Ha SN, Lindsley CW, Schaffhauser HJ, Sur C, Pettibone DJ, Conn PJ, Williams DL |title=A family of highly selective allosteric modulators of the metabotropic glutamate receptor subtype 5 |journal=Molecular Pharmacology |volume=64 |issue=3 |pages=731–40 |date=September 2003 |pmid=12920211 |doi=10.1124/mol.64.3.731 }}</ref> |
|
|
|
|
⚫ |
==References== |
|
⚫ |
{{Reflist|2}} |
|
|
|
|
|
|
{{Metabotropic glutamate receptor modulators}} |
| ⚫ |
== References == |
|
| ⚫ |
{{Reflist}} |
|
|
|
|
|
|
|
] |
|
{{Glutamate_receptor_ligands}} |
|
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{pharma-stub}} |
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
| ⚫ |
] |
|
|
] |
|
|
] |
|