| Revision as of 20:00, 20 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wik← Previous edit |
Latest revision as of 18:17, 8 August 2024 edit undoAnomieBOT (talk | contribs)Bots6,570,650 editsm Substing templates: {{W}}. See User:AnomieBOT/docs/TemplateSubster for info. |
| (29 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 449003845 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = 5-phenyl)methyl]-1,3-thiazolidine-2,4-dione |
|
|
⚫ |
| verifiedrevid = 451556609 |
| ⚫ |
| image = Darglitazone_structure.png |
|
|
⚫ |
| IUPAC_name = 5-phenyl)methyl]-1,3-thiazolidine-2,4-dione |
|
⚫ |
| image = Darglitazone_structure.svg |
|
|
| width = 260 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| legal_status = Uncontrolled |
|
| legal_status = Development terminated |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 141200-24-0 |
|
| CAS_number = 141200-24-0 |
|
| PubChem = 60870 |
|
| PubChem = 60870 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| ChEMBL = 55624 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = AVP9C03Z3K |
|
| UNII = AVP9C03Z3K |
|
|
| ChemSpiderID = 54854 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C23H20N2O4S/c1-14-18(24-22(29-14)17-5-3-2-4-6-17)11-12-19(26)16-9-7-15(8-10-16)13-20-21(27)25-23(28)30-20/h2-10,20H,11-13H2,1H3,(H,25,27,28) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = QQKNSPHAFATFNQ-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=20 | N=2 | O=4 | S=1 |
|
| C=23 | H=20 | N=2 | O=4 | S=1 |
|
| molecular_weight = 420.481 g/mol |
|
|
| smiles = CC1=C(N=C(O1)C2=CC=CC=C2)CCC(=O)C3=CC=C(C=C3)CC4C(=O)NC(=O)S4 |
|
| smiles = CC1=C(N=C(O1)C2=CC=CC=C2)CCC(=O)C3=CC=C(C=C3)CC4C(=O)NC(=O)S4 |
|
}} |
|
}} |
|
|
|
|
|
'''Darglitazone''' is a member of the thiazolidinedione class of drugs and an agonist of ] (PPAR-γ), an orphan member of the nuclear receptor superfamily of transcription factors. It has a variety of insulin-sensitizing effects, such as improving glycemic and lipidemic control, and is used in the treatment of metabolic disorders such as type II diabetes. |
|
'''Darglitazone''' (previously known as '''CP 86325-2''') is a member of the ] class of drugs and an agonist of ] (PPAR-γ), an orphan member of the nuclear receptor superfamily of transcription factors. It has a variety of insulin-sensitizing effects, such as improving glycemic and lipidemic control, and was researched by ] as a treatment of metabolic disorders such as ].<ref>{{cite journal | vauthors = Hulin B, Clark DA, Goldstein SW, McDermott RE, Dambek PJ, Kappeler WH, Lamphere CH, Lewis DM, Rizzi JP | display-authors = 6 | title = Novel thiazolidine-2,4-diones as potent euglycemic agents | journal = Journal of Medicinal Chemistry | volume = 35 | issue = 10 | pages = 1853–64 | date = May 1992 | pmid = 1588563 | doi = 10.1021/jm00088a022 }}</ref> |
|
|
|
|
|
Its development was terminated on November 08, 1999.<ref>{{cite web |title=Drug Profile: Darglitazone |url=http://adisinsight.springer.com/drugs/800003002| work = Adis Insight |publisher=Springer Nature Switzerland AG |access-date=28 November 2015}}</ref> |
|
|
|
|
|
==Synthesis== |
|
==Synthesis== |
|
|
]<br /><br /><br /><br /><br /><br /> |
|
The first step in the construction of the terminal side chain in the first glitazones comprises a reaction of ] with the mono-] from ] to afford the corresponding benzoxazole N-oxide. Reaction of that intermediate with phosphorus oxychloride leads to the chlorination of the adjacent methyl group in a version of the ] to afford the choromethyl derivative. This is then used to alkylate the carbanion from the substituted acetoacetate. Heating the first-obtained product in a strong acid leads to the ] of the ]. The resulting β-ketoacid loses ] under reaction conditions; the acetal hydrolyses also to reveal the free ]. ] of this last intermediate in the presence of a ] with readily available ] links the two fragments. The double bond in the first-formed product is then reduced catalytically to afford darglitazone. |
|
|
|
|
|
|
⚫ |
== References == |
|
] |
|
|
|
{{reflist}} |
|
|
|
|
|
|
{{Oral hypoglycemics}} |
| ⚫ |
==References== |
|
|
|
{{PPAR modulators}} |
|
{{Cite journal|doi=10.1021/jm00088a022|title=Novel thiazolidine-2,4-diones as potent euglycemic agents|pmid=1588563|year=1992|last1=Hulin|first1=Bernard|last2=Clark|first2=David A.|last3=Goldstein|first3=Steven W.|last4=McDermott|first4=Ruth E.|last5=Dambek|first5=Paul J.|last6=Kappeler|first6=Werner H.|last7=Lamphere|first7=Charles H.|last8=Lewis|first8=Diana M.|last9=Rizzi|first9=James P.|journal=Journal of Medicinal Chemistry|volume=35|issue=10|pages=1853}} |
|
|
|
|
|
|
⚫ |
] |
|
|
|
| ⚫ |
] |
|
|
] |
|
] |
|
|
] |