Revision as of 23:28, 7 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified and watched fields - added verified revid - updated 'DrugBank_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmac← Previous edit |
Latest revision as of 07:12, 15 April 2024 edit undoحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Benzene derivatives using HotCat |
(54 intermediate revisions by 37 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
| Verifiedfields = changed |
|
|
|
{{Infobox drug |
|
| Watchedfields = changed |
|
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414417007 |
|
|
| IUPAC_name = (2S)-2-propanoic acid |
|
| verifiedrevid = 443586803 |
|
|
| IUPAC_name = (2''S'')-2-propanoic acid |
|
| image = Dexibuprofen Structural Formulae V.1.svg |
|
| image = Dexibuprofen_Structural_Formulae_v2.png |
|
| image2 = (S)-ibuprofen-3D-balls.png |
|
| image2 = (S)-ibuprofen-3D-balls.png |
|
|
| width = 150px |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| width2 = 150px |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
<!--Clinical data-->| tradename = Seractil, Deltaran, Ibusoft, Monactil |
|
| ChemSpiderID = 36498 |
|
|
|
| Drugs.com = {{drugs.com|international|dexibuprofen}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| UNII = 671DKG7P5S |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| InChI = 1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1 |
|
|
|
| pregnancy_category = |
|
| smiles = C(c1ccc(cc1)CC(C)C)C(=O)O |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| InChIKey = HEFNNWSXXWATRW-JTQLQIEIBT |
|
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ChEMBL = 175 |
|
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| legal_status = |
|
| StdInChI = 1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1 |
|
|
|
| routes_of_administration = Oral |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
<!--Pharmacokinetic data-->| bioavailability = |
|
| StdInChIKey = HEFNNWSXXWATRW-JTQLQIEISA-N |
|
|
| CAS_number = 51146-56-6 |
|
| protein_bound = |
|
| ATC_prefix = M01 |
|
| metabolism = |
|
| ATC_suffix = AE14 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 43415 |
|
|
| PubChem = 39912 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D03715 |
|
|
| C=13|H=18|O=2 |
|
|
| molecular_weight = 206.28082 g/mol |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = <!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| CAS_number = 51146-56-6 |
|
|
| ATC_prefix = M01 |
|
| pregnancy_category= |
|
|
|
| ATC_suffix = AE14 |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| PubChem = 39912 |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
|
| DrugBank = |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| legal_status = |
|
|
|
| ChemSpiderID = 36498 |
|
| routes_of_administration = Oral, Other ROAs Unknown |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 671DKG7P5S |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D03715 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 43415 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| synonyms = S(+)Ibuprofen |
|
|
| ChEMBL = 175 |
|
|
<!--Chemical data-->| C = 13 |
|
|
| H = 18 |
|
|
| O = 2 |
|
|
| smiles = C(c1ccc(cc1)CC(C)C)C(=O)O |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = HEFNNWSXXWATRW-JTQLQIEISA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Dexibuprofen''' is a ]. It is the active ] ] of ]. Most ibuprofen formulations contain a ] of dexibuprofen and (−)-ibuprofen. |
|
'''Dexibuprofen''' is a ] (NSAID). It is the active ] ] of ].<ref name=pmid19552094>{{cite journal | vauthors = Hardikar MS | title = Chiral non-steroidal anti-inflammatory drugs--a review | journal = Journal of the Indian Medical Association | volume = 106 | issue = 9 | pages = 615–8, 622, 624 | date = September 2008 | pmid = 19552094 }}</ref> Most ibuprofen formulations contain a ] of both isomers. |
|
|
|
|
|
|
Dexibuprofen is a ] of racemic ibuprofen. The chiral carbon in dexibuprofen is assigned an absolute configuration of (''S'') per the ].<ref>{{Cite journal| vauthors = Cahn RS, Ingold C, Prelog V |date=1966|title=Specification of Molecular Chirality |journal=Angewandte Chemie International Edition in English |volume=5 |issue=4 |pages=385–415 |doi=10.1002/anie.196603851 |issn=0570-0833}}</ref><ref>{{Cite journal| vauthors = Cahn RS, Ingold CK, Prelog V |date=1956 |title=The specification of asymmetric configuration in organic chemistry |journal=Experientia |volume=12 |issue=3 |pages=81–94 |doi=10.1007/bf02157171 |s2cid=43026989 |issn=0014-4754}}</ref> Dexibuprofen is also called as '''.''' |
|
{{Anti-inflammatory and antirheumatic products}} |
|
|
{{NSAIDs}} |
|
|
|
|
|
|
|
Ibuprofen is an α-arylpropionic acid used largely in the treatment of ] and widely used over-the counter drug for headache and minor pains. This drug has a ] and exists as a pair of ]. (''S'')-Ibuprofen, the ], is responsible for the desired therapeutic effect. The inactive (''R'')-enantiomer, the ], undergoes a unidirectional chiral inversion to give the active (''S'')-enantiomer, the former acting as a ] for the latter.<ref>{{cite journal | vauthors = Caldwell J, Hutt AJ, Fournel-Gigleux S | title = The metabolic chiral inversion and dispositional enantioselectivity of the 2-arylpropionic acids and their biological consequences | journal = Biochemical Pharmacology | volume = 37 | issue = 1 | pages = 105–114 | date = January 1988 | pmid = 3276314 | doi = 10.1016/0006-2952(88)90762-9 }}</ref><ref>{{cite journal | vauthors = Hutt AJ, Caldwell J | title = The metabolic chiral inversion of 2-arylpropionic acids--a novel route with pharmacological consequences | journal = The Journal of Pharmacy and Pharmacology | volume = 35 | issue = 11 | pages = 693–704 | date = November 1983 | pmid = 6139449 | doi = 10.1111/j.2042-7158.1983.tb02874.x | doi-access = | s2cid = 40669413 }}</ref><ref>{{cite journal | vauthors = Adams SS, Bresloff P, Mason CG | title = Pharmacological differences between the optical isomers of ibuprofen: evidence for metabolic inversion of the (-)-isomer | journal = The Journal of Pharmacy and Pharmacology | volume = 28 | issue = 3 | pages = 256–257 | date = March 1976 | pmid = 6706 | doi = 10.1111/j.2042-7158.1976.tb04144.x | s2cid = 38614295 }}</ref><ref>{{cite journal | vauthors = Hao H, Wang G, Sun J | title = Enantioselective pharmacokinetics of ibuprofen and involved mechanisms | journal = Drug Metabolism Reviews | volume = 37 | issue = 1 | pages = 215–234 | date = 2005 | pmid = 15747501 | doi = 10.1081/dmr-200047999 | s2cid = 43433812 }}</ref><ref>{{Cite web | vauthors = Kannappan V |title= Dexibuprofen – Chiralpedia |url=https://chiralpedia.com/blog/dexibuprofen/ |access-date=2022-08-27 |language=en-US}}</ref> That is, when the ibuprofen is administered as a racemate the distomer is converted ''in vivo'' into the eutomer while the latter is unaffected. |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
|
|
== See also == |
|
{{musculoskeletal-drug-stub}} |
|
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
{{Anti-inflammatory products}} |
|
|
{{Prostanoid signaling modulators}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
{{Musculoskeletal-drug-stub}} |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|