| Revision as of 23:36, 30 June 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - updated '') per Chem/Drugbox validation (report errors or bugs)← Previous edit |
Latest revision as of 21:07, 13 February 2024 edit undoMichael7604 (talk | contribs)Extended confirmed users8,895 edits recategorized from Bromoarenes to Bromobenzene derivatives |
| (18 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 437137104 |
|
| Verifiedfields = changed |
|
|
⚫ |
| ImageFile=dibrompropamidine.png |
| ⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
| ImageSize= |
|
|
| PIN=4,4′-bis(3-bromobenzene-1-carboximidamide) |
|
⚫ |
| OtherNames= |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 269M3QL74S |
|
| UNII = 269M3QL74S |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| verifiedrevid = 414418468 |
|
| ⚫ |
|ImageFile=dibrompropamidine.png |
|
| ⚫ |
|ImageSize= |
|
|
|IUPACName=3-bromo-4-benzamidine |
|
| ⚫ |
|OtherNames= |
|
| ⚫ |
|Section1= {{Chembox Identifiers |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 11479 |
|
| ChemSpiderID = 11479 |
|
| InChI = 1/C17H18Br2N4O2/c18-12-8-10(16(20)21)2-4-14(12)24-6-1-7-25-15-5-3-11(17(22)23)9-13(15)19/h2-5,8-9H,1,6-7H2,(H3,20,21)(H3,22,23) |
|
| InChI = 1/C17H18Br2N4O2/c18-12-8-10(16(20)21)2-4-14(12)24-6-1-7-25-15-5-3-11(17(22)23)9-13(15)19/h2-5,8-9H,1,6-7H2,(H3,20,21)(H3,22,23) |
| Line 20: |
Line 19: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = GMJFVGRUYJHMCO-UHFFFAOYSA-N |
|
| StdInChIKey = GMJFVGRUYJHMCO-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=496-00-4 |
|
| CASNo=496-00-4 |
|
| PubChem=11974 |
|
| PubChem=11974 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07204 |
|
| KEGG = D07204 |
|
| SMILES=C1=CC(=C(C=C1C(=N)N)Br)OCCCOC2=C(C=C(C=C2)C(=N)N)Br |
|
| SMILES=C1=CC(=C(C=C1C(=N)N)Br)OCCCOC2=C(C=C(C=C2)C(=N)N)Br |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>17</sub>H<sub>18</sub>Br<sub>2</sub>N<sub>4</sub>O<sub>2</sub> |
|
| Formula=C<sub>17</sub>H<sub>18</sub>Br<sub>2</sub>N<sub>4</sub>O<sub>2</sub> |
|
| MolarMass=470.16 g/mol |
|
| MolarMass=470.16 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
|
| ATCCode_prefix = D08 |
| ⚫ |
| MainHazards= |
|
|
|
| ATCCode_suffix = AC01 |
| ⚫ |
| FlashPt= |
|
|
|
| ATC_Supplemental = {{ATC|S01|AX14}} |
|
| Autoignition= |
|
|
|
}} |
|
|
|Section7={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Dibrompropamidine''' is an ] and ]. As dibrompropamidine isethionate, it is used in eyedrops and ointment for the treatment of minor eye and eyelid infections in adults and children. In the UK, such preparations are sold under the brand names Brolene (]), Golden Eye (Typharm Ltd) and Brulidine (Manx Healthcare). |
|
'''Dibrompropamidine''' is an ] and ].<ref>{{Cite web |last=PubChem |title=Dibrompropamidine |url=https://pubchem.ncbi.nlm.nih.gov/compound/11974 |access-date=2022-11-24 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> As dibrompropamidine isethionate, it is used in eyedrops and ointment for the treatment of minor eye and eyelid infections in adults and children. In the UK, such preparations are sold under the brand names Brolene (]), Golden Eye (Typharm Ltd), and Brulidine (Manx Healthcare). |
|
|
|
|
|
==Characteristics== |
|
==Characteristics== |
|
A white or almost white, crystalline powder; odourless or almost odourless. |
|
Dibrompropamidine is a white or almost white crystalline powder. It is odourless or almost odourless. Dibrompropamidine is freely soluble in water, soluble in glycerol, sparingly soluble in ethanol (96%), and practically insoluble in chloroform, in ether, in liquid paraffin and in fixed oils. |
|
|
==References== |
|
|
|
|
|
{{reflist}} |
|
Freely soluble in water ; soluble in glycerol ; sparingly soluble in ethanol (96%); practically insoluble in chloroform, in ether , in liquid paraffin and in fixed oils. |
|
|
|
|
|
{{Antiseptics and disinfectants}} |
|
{{Antiseptics and disinfectants}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
{{dermatologic-drug-stub}} |
|
|
|
|
{{pharmacology-stub}} |
|