| Revision as of 21:03, 30 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or bugs)← Previous edit |
Latest revision as of 10:09, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,413 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (13 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443636469 |
|
|
|
| Watchedfields = changed |
|
|
|
|
⚫ |
| verifiedrevid = 447550756 |
|
<!--Combo data--> |
|
<!--Combo data--> |
|
| type = combo |
|
| type = combo |
| Line 8: |
Line 10: |
|
| component2 = Chloral hydrate |
|
| component2 = Chloral hydrate |
|
| class2 = ] |
|
| class2 = ] |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
| Line 21: |
Line 22: |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 480-30-8 |
|
| CAS_number = 480-30-8 |
|
| ATC_prefix = N05 |
|
| ATC_prefix = N05 |
| Line 35: |
Line 36: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03785 |
|
| KEGG = D03785 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| smiles = ClC(Cl)(Cl)C(O)O.ClC(Cl)(Cl)C(O)O.O=C2\C=C(/N(N2c1ccccc1)C)C |
|
|
| InChI = 1/C11H12N2O.2C2H3Cl3O2/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10;2*3-2(4,5)1(6)7/h3-8H,1-2H3;2*1,6-7H |
|
|
| InChIKey = ATKXDQOHNICLQW-UHFFFAOYAV |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C11H12N2O.2C2H3Cl3O2/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10;2*3-2(4,5)1(6)7/h3-8H,1-2H3;2*1,6-7H |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = ATKXDQOHNICLQW-UHFFFAOYSA-N |
|
|
}} |
|
}} |
| ⚫ |
'''Dichloralphenazone''' is a 1:2 mixture of ] with ]. In combination with ] and ], it is the active ingredient of medications for migraine and vascular (tension) headaches, including Epidrin and ]. Performance impairments are common with this drug and caution is advised, for example when driving motor vehicles. Additional uses of dichloralphenazone include sedation for the treatment of short-term ], although there are probably better drug choices for the treatment of insomnia.<ref>{{cite journal | author = Hindmarch I | coauthors = Parrott AC. | year = 1980 | month = | title = The effects of combined sedative and anxiolytic preparations on subjective aspects of sleep and objective measures of arousal and performance the morning following nocturnal medication. I: Acute doses. | journal = Arzneimittelforschung. | volume = 30 | issue = 6 | pages = 1025–8 | pmid = 6106498 }}</ref> |
|
|
|
|
|
|
⚫ |
'''Dichloralphenazone''' is a 1:2 mixture of ] with ]. In combination with ] and ], it is the active ingredient of medications for migraine and tension headaches, including '''Epidrin''' and ''']'''. Performance impairments are common with this drug and caution is advised, for example when driving motor vehicles. Additional uses of dichloralphenazone include sedation for the treatment of short-term ], although there are probably better drug choices for the treatment of insomnia.<ref>{{cite journal | vauthors = Hindmarch I, Parrott AC | title = The effects of combined sedative and anxiolytic preparations on subjective aspects of sleep and objective measures of arousal and performance the morning following nocturnal medication. I: Acute doses | journal = Arzneimittel-Forschung | volume = 30 | issue = 6 | pages = 1025–8 | year = 1980 | pmid = 6106498 }}</ref> |
| ⚫ |
==References== |
|
|
<references/> |
|
|
|
|
|
|
==External links== |
|
== See also == |
|
|
* ] |
|
|
|
|
⚫ |
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
== External links == |
|
* {{ATC|N05|CC04}} |
|
* {{ATC|N05|CC04}} |
|
|
|
|
|
{{Hypnotics and sedatives}} |
|
{{Hypnotics and sedatives}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
{{sedative-stub}} |
|
|
|
|
{{nervous-system-drug-stub}} |
|