| Revision as of 09:38, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:W← Previous edit |
Latest revision as of 10:15, 4 July 2024 edit undo46.222.235.84 (talk)No edit summaryTags: Visual edit Mobile edit Mobile web edit |
| (28 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414420910 |
|
| verifiedrevid = 444413670 |
|
| Name = Dichloroisocyanuric acid |
|
| Name = Dichloroisocyanuric acid |
|
| ImageFileL1 = Troclosene.svg |
|
| ImageFileL1 = Troclosene.svg |
|
| ImageSizeL1 = 120px |
|
| ImageSizeL1 = 120px |
|
| ImageNameL1 = Dichlor |
|
|
| ImageFileR1 = Troclosene3d.png |
|
| ImageNameL1 = Dichlor |
|
|
| ImageFileR1 = Troclosene3d.png |
|
| ImageSizeR1 = 140px |
|
| ImageSizeR1 = 140px |
|
| ImageNameR1 = Dichlor |
|
| ImageNameR1 = Dichlor |
|
| IUPACName = 1,3-dichloro-1,3,5-triazinane-2,4,6-trione |
|
| PIN = 1,3-Dichloro-1,3,5-triazinane-2,4,6-trione |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 15857 |
|
| ChemSpiderID = 15857 |
|
| PubChem = 16726 |
|
| PubChem = 16726 |
| Line 22: |
Line 23: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CEJLBZWIKQJOAT-UHFFFAOYSA-N |
|
| StdInChIKey = CEJLBZWIKQJOAT-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 2782-57-2 |
|
| CASNo = 2782-57-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = C1(=O)NC(=O)N(C(=O)N1Cl)Cl |
|
|
|
| UNII = PHR838Y52L |
|
⚫ |
| SMILES = C1(=O)NC(=O)N(C(=O)N1Cl)Cl |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>3</sub>HCl<sub>2</sub>N<sub>3</sub>O<sub>3</sub> |
|
| Formula = C<sub>3</sub>HCl<sub>2</sub>N<sub>3</sub>O<sub>3</sub> |
|
| MolarMass = 197.96 g/mol |
|
| MolarMass = 197.96 g/mol |
|
| Density = 2.2 g/cm<sup>3</sup> |
|
| Density = 2.2 g/cm<sup>3</sup> |
|
| MeltingPt = 225 °C |
|
| MeltingPtC = 225 |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Dichloroisocyanuric acid''', also known as '''dichlor''' or '''dichloro-s-triazinetrione''' and which marketed under many names (e.g. '''troclosene'''), is a ] with the formula (C(O)NCl)<sub>2</sub>(C(O)NH). This colourless solid is the active ingredient in commercial bacteriocides, algicides, and cleaning agents. It is an oxidizer that reacts with water to form ], a compound related to the active ingredient in ]. |
|
'''Dichloroisocyanuric acid''', also known as '''dichlor''' or '''dichloro-s-triazinetrione''' and is marketed under many names (e.g. '''troclosene'''), is a ] with the formula (C(O)NCl)<sub>2</sub>(C(O)NH). |
|
|
|
|
|
|
==Synthesis== |
|
It is manufactured by ] of ]:<ref name=Ullmann>Klaus Huthmacher, Dieter Most "Cyanuric Acid and Cyanuric Chloride" Ullmann's Encyclopedia of Industrial Chemistry" 2005, Wiley-VCH, Weinheim. ISBN 10.1002/14356007.a08 191</ref> |
|
Dichloroisocyanuric acid is manufactured by ] of ]:<ref name=Ullmann>{{ Ullmann |author1=Huthmacher, K.|author2=Most, D. | title = Cyanuric Acid and Cyanuric Chloride | doi = 10.1002/14356007.a08_191 }}</ref> |
|
:(C(O)NH)<sub>3</sub> + 2 Cl<sub>2</sub> → (C(O)NCl)<sub>2</sub>(C(O)NH) + 2 HCl |
|
:(C(O)NH)<sub>3</sub> + 2 Cl<sub>2</sub> → (C(O)NCl)<sub>2</sub>(C(O)NH) + 2 HCl |
|
|
It is a colourless solid.<ref name=pubchem/> |
|
|
|
|
|
|
==Mechanism of action== |
|
The sodium salt of dichloroisocyanuric acid, ], is the active ingredient in the powderized cleanser ] and is also used as a pool disinfectant. |
|
|
|
{{missing information|section|why it is used over hypochlorite — something to do with ]?|date=January 2022}} |
|
|
Dichloroisocyanuric acid is an ], reacting with water to form chlorine gas.<ref name=pubchem>{{cite web | url=https://pubchem.ncbi.nlm.nih.gov/compound/Dichloroisocyanuric-acid | title= Pubchem Dichloroisocyanuric acid |date=Apr 17, 2021}}</ref> |
|
|
|
|
|
Although the ] in most chlorine based bleach is ], the sodium salt of dichloroisocyanuric acid, ], is the active ingredient in commercial ] bacteriocides, ], and ]<ref>{{cite web | url=https://www.fishersci.com/shop/products/dichloroisocyanuric-acid-sodium-salt-97-dry-wt-water-3/AAB2350414 | title=Alfa Aesar™ Dichloroisocyanuric acid sodium salt, 97% (dry wt.), water <3% | access-date=April 22, 2021}}</ref> such as the pulverized cleanser ].<ref>{{cite web |title=Procter&Gamble MSDS Comet Powder | url=http://www2.merlino.com/wp-content/uploads/2015/08/MSDS-Comet-Powder.pdf | date=Oct 15, 2013 }}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
|
*] (trichlor) |
|
* ] (trichlor) |
|
|
|
|
|
==References== |
|
==References== |
|
|
{{reflist}} |
|
<references/> |
|
|
|
|
|
|
] |
|
] |
| Line 50: |
Line 60: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
] |
|