| Revision as of 19:55, 16 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Wik← Previous edit |
Latest revision as of 08:49, 23 December 2023 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits added Category:Methyl esters using HotCat |
| (16 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 415822143 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Dicrotophos Structural Formulae .V.1.svg |
|
|
⚫ |
| verifiedrevid = 429445900 |
| ⚫ |
|ImageSize=280px |
|
|
⚫ |
| ImageFile=Dicrotophos Structural Formulae .V.1.svg |
| ⚫ |
|IUPACName= |
|
|
⚫ |
| ImageSize=280px |
|
|OtherNames= |
|
|
⚫ |
| PIN=(2''E'')-4-(Dimethylamino)-4-oxobut-2-en-2-yl dimethyl phosphate |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| OtherNames=Bidrin, Carbicron, 2-Dimethyl-cis-2-dimethylcarbamoyl-1-methylvinylphosphate<ref name=PGCH/> |
| ⚫ |
| CASNo=3735-78-2 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| PubChem=5371560 |
|
|
|
| CASNo_Ref = {{cascite|changed|??}} |
| ⚫ |
| SMILES=C/C(=C\C(=O)N(C)C)/OP(=O)(OC)OC |
|
|
⚫ |
| CASNo=141-66-2 |
| ⚫ |
| MeSHName= |
|
|
|
| EINECS = 205-494-3 |
|
⚫ |
| PubChem=5371560 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4522051 |
|
⚫ |
| SMILES=C/C(=C\C(=O)N(C)C)/OP(=O)(OC)OC |
|
|
| InChI = 1/C8H16NO5P/c1-7(6-8(10)9(2)3)14-15(11,12-4)13-5/h6H,1-5H3/b7-6+ |
|
|
| InChIKey = VEENJGZXVHKXNB-VOTSOKGWBK |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C8H16NO5P/c1-7(6-8(10)9(2)3)14-15(11,12-4)13-5/h6H,1-5H3/b7-6+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = VEENJGZXVHKXNB-VOTSOKGWSA-N |
|
⚫ |
| MeSHName= |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C18656 |
|
| KEGG = C18656 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 38658 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1876467 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = B541I65WBL |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>8</sub>H<sub>16</sub>NO<sub>5</sub>P |
|
| Formula=C<sub>8</sub>H<sub>16</sub>NO<sub>5</sub>P |
|
| MolarMass=237.190 |
|
| MolarMass=237.190 g/mol |
|
| Appearance= |
|
| Appearance=Yellow-brown liquid with a mild, ester odor |
|
| Density= |
|
| Density=1.22 g/mL |
|
| MeltingPt= |
|
| MeltingPt= |
|
|
| BoilingPtC= 400 |
|
| BoilingPt= |
|
|
| Solubility= |
|
| Solubility= miscible<ref name=PGCH/> |
|
|
| VaporPressure = 0.0001 mmHg<ref name=PGCH/> |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards=Toxic |
|
| MainHazards=Toxic |
|
| FlashPt= |
|
| FlashPt= > 93.3°C |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
|
| PEL = none<ref name=PGCH>{{PGCH|0203}}</ref> |
|
|
| IDLH = N.D.<ref name=PGCH/> |
|
|
| REL = TWA 0.25 mg/m<sup>3</sup> <ref name=PGCH/> |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Dicrotophos''' is an ] ] used as an ]. Some common brand names for dicrotophos include Bidrin, Carbicron, Diapadrin, Dicron and Ektafos.<ref name="OregonState1">{{cite web|url=http://extoxnet.orst.edu/pips/dicrotop.htm|title=DICROTOPHOS|publisher=Oregon State University|accessdate=2009-04-13}}</ref> |
|
'''Dicrotophos''' is an ] ] used as an ]. Some common brand names for dicrotophos include Bidrin, Carbicron, Diapadrin, Dicron and Ektafos.<ref name="OregonState1">{{cite web|url=http://extoxnet.orst.edu/pips/dicrotop.htm|title=DICROTOPHOS|publisher=Oregon State University|access-date=2009-04-13}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
|
{{Insecticides}} |
|
{{Insecticides}} |
|
|
{{Acetylcholine metabolism and transport modulators}} |
|
{{Cholinergics}} |
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|