Revision as of 04:41, 11 August 2011 editFlowanda (talk | contribs)11,903 edits Removed content sourced to dead link at non-notable website not meeting WP:RS← Previous edit |
Latest revision as of 09:10, 21 May 2023 edit undo31.29.45.30 (talk) Changed link and wordingTag: Visual edit |
(19 intermediate revisions by 14 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 399897185 |
|
| verifiedrevid = 444200084 |
|
|ImageFile=Diethylamino hydroxybenzoyl hexyl benzoate.png |
|
| ImageFile=Diethylamino hydroxybenzoyl hexyl benzoate.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName=Hexyl 2-benzoate |
|
| PIN=Hexyl 2-benzoate |
|
|OtherNames=Uvinul A Plus |
|
| OtherNames=Uvinul A Plus |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8286957 |
|
| ChemSpiderID = 8286957 |
|
| InChI = 1/C24H31NO4/c1-4-7-8-11-16-29-24(28)20-13-10-9-12-19(20)23(27)21-15-14-18(17-22(21)26)25(5-2)6-3/h9-10,12-15,17,26H,4-8,11,16H2,1-3H3 |
|
| InChI = 1/C24H31NO4/c1-4-7-8-11-16-29-24(28)20-13-10-9-12-19(20)23(27)21-15-14-18(17-22(21)26)25(5-2)6-3/h9-10,12-15,17,26H,4-8,11,16H2,1-3H3 |
|
| InChIKey = FDATWRLUYRHCJE-UHFFFAOYAR |
|
| InChIKey = FDATWRLUYRHCJE-UHFFFAOYAR |
|
| SMILES1 = O=C(c1ccc(cc1O)N(CC)CC)c2ccccc2C(=O)OCCCCCC |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C24H31NO4/c1-4-7-8-11-16-29-24(28)20-13-10-9-12-19(20)23(27)21-15-14-18(17-22(21)26)25(5-2)6-3/h9-10,12-15,17,26H,4-8,11,16H2,1-3H3 |
|
| StdInChI = 1S/C24H31NO4/c1-4-7-8-11-16-29-24(28)20-13-10-9-12-19(20)23(27)21-15-14-18(17-22(21)26)25(5-2)6-3/h9-10,12-15,17,26H,4-8,11,16H2,1-3H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FDATWRLUYRHCJE-UHFFFAOYSA-N |
|
| StdInChIKey = FDATWRLUYRHCJE-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=302776-68-7 |
|
| CASNo=302776-68-7 |
|
| PubChem = 10111431 |
|
| PubChem = 10111431 |
|
|
| UNII = ANQ870JD20 |
|
| SMILES=CCCCCCOC(=O)C1=CC=CC=C1C(=O)C2=C(C(=CC=C2)N(CC)CC)O |
|
| SMILES=CCCCCCOC(=O)C1=CC=CC=C1C(=O)C2=C(C(=CC=C2)N(CC)CC)O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C= 24 | H=31 | N=1 | O=4 |
|
| Formula=C<sub>24</sub>H<sub>31</sub>NO<sub>4</sub> |
|
|
|
| Appearance= |
|
| MolarMass=397.51 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Diethylamino hydroxybenzoyl hexyl benzoate''' (]) is an ] used in ]s to absorb ] radiation. It is marketed as '''Uvinul A Plus''' by ]. DHHB has an absorption maximum of 354 nm.<ref>{{cite journal |
|
'''Diethylamino hydroxybenzoyl hexyl benzoate''' (]) is an ] used in ]s to absorb ] radiation. It is marketed as '''Parsol DHHB''' by ] and as '''Uvinul A Plus''' by ]. DHHB has an absorption maximum of 354 nm.<ref>{{cite journal |
|
| title=Sunscreens with an absorption maximum of > or =360 nm provide optimal protection against UVA1-induced expression of matrix metalloproteinase-1, interleukin-1, and interleukin-6 in human dermal fibroblasts |
|
| title=Sunscreens with an absorption maximum of > or =360 nm provide optimal protection against UVA1-induced expression of matrix metalloproteinase-1, interleukin-1, and interleukin-6 in human dermal fibroblasts |
|
| year=2006| month=March| pmid=16520862 |
|
| date=March 2006| pmid=16520862 |
|
| author=Vielhaber G, Grether-Beck S, Koch O, Johncock W, Krutmann J |
|
| vauthors=Vielhaber G, Grether-Beck S, Koch O, Johncock W, Krutmann J |
|
| journal= Photochem Photobiol Sci| volume=5| pages=275–82 |
|
| journal= Photochem Photobiol Sci| volume=5| pages=275–82 |
|
| doi=10.1039/b516702g |
|
| doi=10.1039/b516702g |
|
| issue=3 |
|
| issue=3 |
|
}}</ref><ref>, cosmetics.basf.de</ref> |
|
}}</ref><ref> {{Webarchive|url=https://web.archive.org/web/20101011052902/http://www.cosmetics.basf.de/%28ofnv5uj3xy3zfy45hgjburu3%29/pdf/Overview%20UV%20Absorber%20Portfolio_Performance%20Data%20and%20Regulatory%20Status.PDF |date=2010-10-11 }}, cosmetics.basf.de</ref> |
|
|
|
|
|
DHHB has excellent photostability and compatibility with other UV absorbers and other cosmetic ingredients.<ref>http://sciencelinks.jp/j-east/article/200216/000020021602A0553728.php</ref> |
|
DHHB has excellent photostability and compatibility with other UV absorbers and other cosmetic ingredients.<ref>{{Cite web |url=http://sciencelinks.jp/j-east/article/200216/000020021602A0553728.php |title=Science Links Japan | New raw materials and technologies for cosmetics. Functions and development of new UVA absorber |access-date=2008-08-27 |archive-url=https://web.archive.org/web/20120210025756/http://sciencelinks.jp/j-east/article/200216/000020021602A0553728.php |archive-date=2012-02-10 |url-status=dead }}</ref> |
|
|
|
|
|
DHHB has been approved for the use in sunscreens in the European Union since 2005 with a maximum of 10 per cent<ref>http://www.corporate.basf.com/en/investor/strategie/kunden/uvinul.htm</ref><ref>http://eur-lex.europa.eu/LexUriServ/site/en/consleg/1976/L/01976L0768-20060809-en.pdf</ref> and is also approved in South America, Mexico, Japan and Taiwan.<ref>http://www.cosmetics.basf.de/pdf/publications/Uvinul_A_Plus_Broschuere.pdf</ref> In the United States it can be used for product protection.<ref>http://www2.basf.us/corporate/news2004/02272004b.htm</ref> |
|
DHHB has been approved for the use in sunscreens in the European Union since 2005 with a maximum concentration of 10%<ref>{{Cite web |url=http://www.corporate.basf.com/en/investor/strategie/kunden/uvinul.htm |title=BASF Group: Uvinul® A Plus - for safer sunbathing |access-date=2008-08-25 |archive-url=https://web.archive.org/web/20081007125715/http://www.corporate.basf.com/en/investor/strategie/kunden/uvinul.htm |archive-date=2008-10-07 |url-status=dead }}</ref><ref>{{Cite web |url=http://eur-lex.europa.eu/LexUriServ/site/en/consleg/1976/L/01976L0768-20060809-en.pdf |title=Archived copy |access-date=2008-08-25 |archive-url=https://web.archive.org/web/20080814155936/http://eur-lex.europa.eu/LexUriServ/site/en/consleg/1976/L/01976L0768-20060809-en.pdf |archive-date=2008-08-14 |url-status=dead }}</ref> and is also approved in South America, Mexico, Japan and Taiwan.<ref>{{Cite web |url=http://www.cosmetics.basf.de/pdf/publications/Uvinul_A_Plus_Broschuere.pdf |title=Archived copy |access-date=2008-08-25 |archive-url=https://web.archive.org/web/20110718201608/http://www.cosmetics.basf.de/pdf/publications/Uvinul_A_Plus_Broschuere.pdf |archive-date=2011-07-18 |url-status=dead }}</ref> In the United States it can be used for product protection.<ref>{{Cite web |url=http://www2.basf.us/corporate/news2004/02272004b.htm |title=WebPublisher HTML Template |access-date=2009-07-11 |archive-url=https://web.archive.org/web/20110721044206/http://www2.basf.us/corporate/news2004/02272004b.htm |archive-date=2011-07-21 |url-status=dead }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
Line 54: |
Line 54: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
{{ketone-stub}} |
|
|
|
|
|
] |
|