| Revision as of 04:42, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit |
Latest revision as of 06:02, 26 October 2024 edit undo76.174.0.57 (talk) Cats. |
| (22 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444200308 |
|
⚫ |
| IUPAC_name = 2-(Dimethylamino)-2-methylpropyl 2-hydroxy-2,2-diphenylacetate |
|
⚫ |
| image = Difemerine.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|difemerine}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 80387-96-8 |
|
⚫ |
| ATC_prefix = A03 |
|
⚫ |
| ATC_suffix = AA09 |
|
⚫ |
| PubChem = 165124 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChEMBL = 2106534 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 843C4UPZ2F |
|
| UNII = 843C4UPZ2F |
| ⚫ |
| verifiedrevid = 437164473 |
|
| ⚫ |
| IUPAC_name = 2-(Dimethylamino)-2-methylpropyl 2-hydroxy-2,2-diphenylacetate |
|
| ⚫ |
| image = Difemerine.png |
|
| ⚫ |
| CAS_number = 3477-97-2 |
|
| ⚫ |
| ATC_prefix = A03 |
|
| ⚫ |
| ATC_suffix = AA09 |
|
| ⚫ |
| PubChem = 165124 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07079 |
|
| KEGG = D07079 |
|
|
| ChemSpiderID = 10662416 |
|
| C=20|H=25|N=1|O=3 |
|
|
|
| smiles = OC(C(=O)OC(C)(C)CN(C)C)(c1ccccc1)c2ccccc2 |
|
| molecular_weight = 327.42 g/mol |
|
|
|
| StdInChI = 1S/C20H25NO3/c1-19(2,15-21(3)4)24-18(22)20(23,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,23H,15H2,1-4H3 |
| ⚫ |
| bioavailability = |
|
|
|
| StdInChIKey = WJIZVQNUJVMJAZ-UHFFFAOYSA-N |
| ⚫ |
| protein_bound = |
|
|
|
|
| ⚫ |
| metabolism = |
|
|
|
<!--Chemical data--> |
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| C=20 | H=25 | N=1 | O=3 |
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Difemerine''' is a little known ]<ref>{{Cite web|url=http://drugcentral.org/drugcard/877|title=difemerine|website=drugcentral.org|access-date=2019-04-21}}</ref> drug sold under the name Luostyl. <ref>{{Cite web|url=https://www.drugs.com/international/luostyl.html|title=Luostyl|website=Drugs.com|language=en|access-date=2019-04-21|archive-date=2019-04-21|archive-url=https://web.archive.org/web/20190421092824/https://www.drugs.com/international/luostyl.html|url-status=dead}}</ref> |
|
'''Difemerine''' is an ]. |
|
|
|
|
|
|
|
==References== |
|
|
{{Reflist|2}} |
|
|
|
|
|
|
|
|
|
{{Drugs for functional gastrointestinal disorders}} |
|
{{Drugs for functional gastrointestinal disorders}} |
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
|
|
|
| ⚫ |
] |
|
|
] |
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
|
|
|
|
|
|