| Revision as of 22:53, 29 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 03:04, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,459,789 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:O-methylated flavans | #UCB_Category 1/3 |
| (16 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 426638751 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Diffutin |
|
|
⚫ |
| verifiedrevid = 426640180 |
|
⚫ |
| Name = Diffutin |
|
| ImageFile = Diffutin.svg |
|
| ImageFile = Diffutin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Chemical structure of diffutin |
|
| ImageName = Chemical structure of diffutin |
|
| ImageAlt = Chemical structure of diffutin |
|
| ImageAlt = Chemical structure of diffutin |
|
| IUPACName = <nowiki> beta-D-glucopyranoside</nowiki> |
|
| IUPACName = (2''S'')-2-(3,4-Dimethoxyphenyl)-7-hydroxy-3,4-dihydro-2''H''-1-benzopyran-5-yl β-<small>D</small>-glucopyranoside |
|
|
| SystematicName = (2''S'',3''R'',4''S'',5''S'',6''R'')-2-{oxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 89289-91-8 |
|
| CASNo = 89289-91-8 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
| SMILES = c(c4)(c(OC)cc(c4)(O3)CCc(c31)c(O((O)2)OC(CO)(2O)O)cc(O)c1)OC |
|
| SMILES = c(c4)(c(OC)cc(c4)(O3)CCc(c31)c(O((O)2)OC(CO)(2O)O)cc(O)c1)OC |
|
| PubChem = 442352 |
|
| PubChem = 442352 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 390804 |
|
| ChemSpiderID = 390804 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| ChEBI = 4536 |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZNWIOJJMPZWSQO-YRDUZITASA-N |
|
| StdInChIKey = ZNWIOJJMPZWSQO-YRDUZITASA-N |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C23H28O10/c1-29-15-5-3-11(7-18(15)30-2)14-6-4-13-16(31-14)8-12(25)9-17(13)32-23-22(28)21(27)20(26)19(10-24)33-23/h3,5,7-9,14,19-28H,4,6,10H2,1-2H3/t14-,19+,20+,21-,22+,23+/m0/s1 |
|
| StdInChI=1S/C23H28O10/c1-29-15-5-3-11(7-18(15)30-2)14-6-4-13-16(31-14)8-12(25)9-17(13)32-23-22(28)21(27)20(26)19(10-24)33-23/h3,5,7-9,14,19-28H,4,6,10H2,1-2H3/t14-,19+,20+,21-,22+,23+/m0/s1 |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=23 | H=28 | O=10 |
|
| Formula = C<sub>23</sub>H<sub>28</sub>O<sub>10</sub> |
|
|
| MolarMass = 464.46 g/mol |
|
|
| ExactMass = 464.168247116 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R}}, {{R}}, {{R}}, {{R}} etc. --> |
|
| RPhrases = <!-- {{R}}, {{R}}, {{R}}, {{R}} etc. --> |
|
| SPhrases = <!-- {{S}}, {{S}}, {{S}}, {{S}}, {{S}}, {{S}}, {{S}} etc. --> |
|
| SPhrases = <!-- {{S}}, {{S}}, {{S}}, {{S}}, {{S}}, {{S}}, {{S}} etc. --> |
|
}} |
|
}} |
|
}} |
|
}} |
| ⚫ |
'''Diffutin''' is a ], a type of flavonoid. It can be found in '']''<ref name=Ghosal>Diffutin, a new adaptogenic glucosyloxyflavan from Canscora diffusa. Shibnath Ghosal, Saini K. S. and Sinha B. N., Journal of chemical research. Synopses, 1983, no12<!--, {{doi|}} --></ref> and in '']''.<ref>Dichotosin and dichotosinin, two adaptogenic glucosyloxy flavans from Hoppea dichotoma. Shibnath Ghosal, Dinesh K. Jaiswal, Sushil K. Singh and Radhey S. Srivastava, Phytochemistry, Volume 24, Issue 4, 1985, Pages 831-833, {{doi|10.1016/S0031-9422(00)84903-1}}</ref> |
|
|
|
|
|
|
⚫ |
'''Diffutin''' is a ], a type of ]. It can be found in '']''<ref name=Ghosal>{{cite journal | title = Diffutin, a new adaptogenic glucosyloxyflavan from Canscora diffusa | author = Shibnath Ghosal, Saini K. S. and Sinha B. N. | journal = Journal of Chemical Research, Synopses | date = 1983 | issue = 12}}</ref> and in '']''.<ref>{{cite journal | doi = 10.1016/S0031-9422(00)84903-1| title = Dichotosin and dichotosinin, two adaptogenic glucosyloxy flavans from Hoppea dichotoma| journal = Phytochemistry| volume = 24| issue = 4| pages = 831–833| year = 1985| last1 = Ghosal| first1 = Shibnath| last2 = k. Jaiswal| first2 = Dinesh| last3 = k. Singh| first3 = Sushil| last4 = s. Srivastava| first4 = Radhey| bibcode = 1985PChem..24..831G}}</ref> |
| ⚫ |
==Metabolism== |
|
|
|
|
|
⚫ |
== Metabolism == |
|
Diffutin is a ] of ].<ref name=Ghosal/> |
|
Diffutin is a ] of ].<ref name=Ghosal/> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Flavan}} |
|
{{Flavan}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{natural-phenol-stub}} |
|
{{phenol-stub}} |