Misplaced Pages

Digallic acid: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 07:24, 25 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wik← Previous edit Latest revision as of 20:37, 19 December 2023 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits −Category:Vinylogous carboxylic acids; ±Category:Pyrogallols→Category:Gallate esters using HotCat 
(29 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{chembox {{Chembox
| Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 401013811 | verifiedrevid = 441307529
| ImageFile = Digallic acid.svg | ImageFile = Digallic Acid Structural Formula V1.svg
| ImageSize = | ImageSize =
| ImageCaption = meta-depside bond digalloyl ester | ImageCaption =
| IUPACName = 3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoic acid | PIN = 3,4-Dihydroxy-5-benzoic acid
| OtherNames = Digallate<br>3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyloxy)benzoate<br>m-digallic acid<br>Digalloyl ester | OtherNames = Digallate<br>3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyloxy)benzoate<br>m-digallic acid<br>Digalloyl ester
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| Abbreviations = | Abbreviations =
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 536-08-3 | CASNo = 536-08-3
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 404KO0584X
| Beilstein = | Beilstein =
| EINECS = | EINECS =
| PubChem = 341 | PubChem = 341
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 366356
| SMILES = C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O) | SMILES = C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
⚫ | InChI =
| ChemSpiderID = 334
| SMILES2 = O=C(O)c2cc(O)c(O)c(OC(=O)c1cc(O)c(O)c(O)c1)c2
| InChI = 1/C14H10O9/c15-7-2-6(3-8(16)11(7)18)14(22)23-10-4-5(13(20)21)1-9(17)12(10)19/h1-4,15-19H,(H,20,21)
| InChIKey = COVFEVWNJUOYRL-UHFFFAOYAG
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C14H10O9/c15-7-2-6(3-8(16)11(7)18)14(22)23-10-4-5(13(20)21)1-9(17)12(10)19/h1-4,15-19H,(H,20,21)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = COVFEVWNJUOYRL-UHFFFAOYSA-N
| RTECS = | RTECS =
| MeSHName = | MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = | ChEBI =
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = | KEGG =
}}
| ATCvet =
⚫ |Section2={{Chembox Properties
| ATCCode_prefix =
| C=14 | H=10 | O=9
| ATCCode_suffix =
| ATC_Supplemental =}}
⚫ | Section2 = {{Chembox Properties
| Formula = C<sub>14</sub>H<sub>10</sub>O<sub>9</sub>
| MolarMass = 322.22 g/mol
| ExactMass = 322.032481 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| Melting_notes = | MeltingPt_notes =
| BoilingPt = | BoilingPt =
| Boiling_notes = | BoilingPt_notes =
| Solubility = | Solubility =
| SolubleOther = | SolubleOther =
| Solvent = | Solvent =
| pKa = | pKa =
| pKb = }} | pKb =
}}
| Section7 = {{Chembox Hazards |Section7={{Chembox Hazards
| ExternalMSDS = | ExternalSDS =
| EUClass =
| EUIndex =
| MainHazards = | MainHazards =
| NFPA-H = | NFPA-H =
| NFPA-F = | NFPA-F =
| NFPA-R = | NFPA-R =
| NFPA-O = | NFPA-S =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt = | FlashPt =
| Autoignition = | AutoignitionPt =
| ExploLimits = | ExploLimits =
| PEL = }} | PEL =
}}
}} }}
'''Digallic acid''' is a polyphenolic compound found in '']''.<ref>Study of genotoxic, antigenotoxic and antioxidant activities of the digallic acid isolated from Pistacia lentiscus fruits. Wissem Bhouri, Safa Derbel, Ines Skandrani, Jihed Boubaker, Ines Bouhlel, Mohamed B. Sghaier, Soumaya Kilani, Anne M. Mariotte, Marie G. Dijoux-Franca, Kamel Ghedira and Leila Chekir-Ghedir, Toxicology in Vitro, Volume 24, Issue 2, March 2010, pp. 509-515, {{doi|10.1016/j.tiv.2009.06.024}}</ref> Digallic acid is also present in the molecule of ].<ref>Analysis of gallic, digallic and trigallic acids in tannic acids by high-performance liquid chromatography. P. Delahaye and M. Verzele, Journal of Chromatography A, Volume 265, 1983, pp. 363-367, {{doi|10.1016/S0021-9673(01)96734-2}}</ref> Digalloyl esters involve either ''-meta'' or ''-para'' ] bonds.<ref></ref>


'''Digallic acid''' is a polyphenolic compound found in '']''.<ref>{{Cite journal | last1 = Bhouri | first1 = W. | last2 = Derbel | first2 = S. | last3 = Skandrani | first3 = I. | last4 = Boubaker | first4 = J. | last5 = Bouhlel | first5 = I. | last6 = Sghaier | first6 = M. B. | last7 = Kilani | first7 = S. | last8 = Mariotte | first8 = A. M. | last9 = Dijoux-Franca | first9 = M. G. | last10 = Ghedira | doi = 10.1016/j.tiv.2009.06.024 | first10 = K. | last11 = Chekir-Ghedira | first11 = L. | title = Study of genotoxic, antigenotoxic and antioxidant activities of the digallic acid isolated from Pistacia lentiscus fruits | journal = Toxicology in Vitro | volume = 24 | issue = 2 | pages = 509–515 | year = 2010 | pmid = 19563883}}</ref> Digallic acid is also present in the molecule of ].<ref>{{Cite journal | last1 = Delahaye | first1 = P. | last2 = Verzele | first2 = M. | doi = 10.1016/S0021-9673(01)96734-2 | title = Analysis of gallic, digallic and trigallic acids in tannic acids by high-performance liquid chromatography | journal = Journal of Chromatography A | volume = 265 | pages = 363–367 | year = 1983 }}</ref> Digalloyl esters involve either ''-meta,'' or ''-para'' ] bonds.<ref>{{cite web | url = http://www.users.miamioh.edu/hagermae/ | title = The Tannin Handbook | author = Ann E. Hagerman | publisher = Miami University }}</ref>
⚫ ] is an enzyme that uses digallate to produce ].


⚫ ] is an enzyme that uses digallate to produce ]. This enzyme can also be used to produce digallic acid from ]s.<ref>{{Cite journal
⚫ ==References==
| last1 = Nierenstein | first1 = M.
| title = A biological synthesis of m-digallic acid
| journal = The Biochemical Journal
| volume = 26
⚫ | issue = 4
| pages = 1093–1094
| year = 1932
| pmid = 16744910
| pmc = 1261008
| doi=10.1042/bj0261093
}}</ref>

⚫ == References ==
{{Reflist}} {{Reflist}}

<!-- ==External links==
{{commons}} -->


{{Gallotannin}} {{Gallotannin}}
Line 70: Line 86:
{{DEFAULTSORT:Digallic Acid}} {{DEFAULTSORT:Digallic Acid}}
] ]
]
]
]



{{Natural-phenol-stub}} {{aromatic-stub}}