| Revision as of 15:35, 4 June 2011 editAmirobot (talk | contribs)56,602 editsm r2.7.1) (robot Adding: ar:ثنائي أيزو هبتيل فثالات← Previous edit |
Latest revision as of 01:51, 25 November 2021 edit undoGraeme Bartlett (talk | contribs)Administrators250,229 edits more ids and hazard upgrade |
| (16 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 307738793 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 432531405 |
|
|Reference=<ref> at ]</ref> |
|
|Reference=<ref> at ]</ref> |
|
|ImageFile=diisoheptyl phthalate.png |
|
|ImageFile=diisoheptyl phthalate.png |
|
|ImageSize=180px |
|
|ImageSize=180px |
|
|
| ImageFile1 = Diisoheptyl phthalate 3D.png |
|
|IUPACName= |
|
|
|
| PIN = Bis(5-methylhexyl) benzene-1,2-dicarboxylate |
|
|OtherNames= 1,2-benzenedicarboxylic acid, bis(isoheptyl) ester |
|
| OtherNames = Bis(5-methylhexyl) phthalate<br />1,2-Benzenedicarboxylic acid bis(isoheptyl) ester |
|
|Section1= {{Chembox Identifiers |
|
|Section1= {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=41451-28-9 |
|
| CASNo = 41451-28-9 |
|
| CASOther= <br> (C6-C8 esters) |
|
|
|
| ChEMBL = 1893293 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = |
|
| ChemSpiderID = 513939 |
|
|
| EC_number = 276-158-1 |
|
| SMILES=variable |
|
|
| MeSHName= |
|
| MeSHName= |
|
|
| PubChem = 591200 |
| ⚫ |
}} |
|
|
|
| UNII = 9JJP9B98FG |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C22H34O4/c1-17(2)11-7-9-15-25-21(23)19-13-5-6-14-20(19)22(24)26-16-10-8-12-18(3)4/h5-6,13-14,17-18H,7-12,15-16H2,1-4H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = RKELNIPLHQEBJO-UHFFFAOYSA-N |
|
|
| SMILES = O=C(OCCCCC(C)C)C1=CC=CC=C1C(OCCCCC(C)C)=O |
|
⚫ |
}} |
|
|Section2= {{Chembox Properties |
|
|Section2= {{Chembox Properties |
|
| Formula=C<sub>22</sub>H<sub>34</sub>O<sub>4</sub> |
|
| C=22|H=34|O=4 |
|
| MolarMass =362.50 g/mol |
|
|
| Appearance= |
|
| Appearance= |
|
| Density= 0.99 g/cm<sup>3</sup> |
|
| Density= 0.99 g/cm<sup>3</sup> |
| Line 23: |
Line 34: |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3= {{Chembox Hazards |
|
| FlashPt=113 °C |
|
| FlashPtC = 113 |
|
| RPhrases = {{R62}} {{R63}} |
|
| GHSPictograms = {{GHS08}} |
|
|
| GHSSignalWord = Warning |
|
| SPhrases = {{S23}} {{S36/37}} |
|
|
|
| HPhrases = {{H-phrases|360D}} |
|
|
|
|
|
| PPhrases = {{P-phrases|201|202|281|308+313|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Diisoheptyl phthalate''' is a ] used as a ].<ref> |
|
'''Diisoheptyl phthalate''' is a ] used as a ].<ref>{{Cite web |url=http://www.exxonmobilchemical.com/Public_Files/Oxo/Plasticizers/NorthAmerica/Jayflex_77_salesspec.pdf |title=Jayflex 77 Product Sheet |access-date=2009-08-13 |archive-url=https://web.archive.org/web/20061120192854/http://www.exxonmobilchemical.com/Public_Files/Oxo/Plasticizers/NorthAmerica/Jayflex_77_salesspec.pdf |archive-date=2006-11-20 |url-status=dead }}</ref> Diisoheptyl phthalate is typically a mixture of chemical compounds consisting of various ] esters of ] with the ] C<sub>22</sub>H<sub>34</sub>O<sub>4</sub>. |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 38: |
Line 50: |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
{{HealthIssuesOfPlastics}} |
|
|
|
|
|
{{ester-stub}} |
|
{{ester-stub}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
] |
|