| Revision as of 16:04, 22 March 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid) per Chem/Drugbox validation (report errors or bugs)← Previous edit |
Latest revision as of 12:00, 3 July 2024 edit undo0dorkmann (talk | contribs)258 editsm img |
| (38 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
{{unreferenced|date=December 2008}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 351377246 |
|
|
|
| Watchedfields = changed |
|
|ImageFile=Dimethylphenylenediamine.png |
|
|
⚫ |
| verifiedrevid = 414584828 |
|
|ImageSize=200px |
|
|
|
| ImageFile=N,N-dimethyl-p-phenylenediamine.svg |
|
|IUPACName=N,N-dimethylbenzene-1,4-diamine |
|
|
|
| PIN=''N''<sup>1</sup>,''N''<sup>1</sup>-Dimethylbenzene-1,4-diamine |
|
|OtherNames=DMPD; p-Aminodimethylaniline; N,N-Dimethyl-p-phenylenediamine; 4-(Dimethylamino)aniline; p-Amino-N,N-dimethylaniline; p-(Dimethylamino)aniline; DMPPDA; Dimethyl-p-phenylenediamine; 4-Amino-N,N-dimethylaniline; p-Dimethylaminophenylamine |
|
| OtherNames= ''p''-Aminodimethylaniline; ''N'',''N''-Dimethyl-''p''-phenylenediamine; 4-(Dimethylamino)aniline; ''p''-Amino-''N'',''N''-dimethylaniline; ''p''-(Dimethylamino)aniline; DMPPDA; Dimethyl-''p''-phenylenediamine; 4-Amino-''N'',''N''-dimethylaniline; ''p''-Dimethylaminophenylamine; DMPD |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 7192 |
|
| ChemSpiderID = 13884246 |
|
| CASNo_Ref = {{cascite}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=99-98-9 |
|
| CASNo=99-98-9 |
| ⚫ |
| PubChem=7472 |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| SMILES=CN(C)C1=CC=C(C=C1)N |
|
|
|
| UNII = 7GZH2FMK7X |
| ⚫ |
}} |
|
|
⚫ |
| PubChem=7472 |
|
⚫ |
| SMILES=CN(C)C1=CC=C(C=C1)N |
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=8 | H=12 | N=2 |
|
| Formula=C<sub>8</sub>H<sub>12</sub>N<sub>2</sub> |
|
|
|
| Appearance=Reddish-violet crystals<ref name=Merck>'']'', 11th Edition, '''3242'''</ref> |
|
| MolarMass=136.19428 |
|
|
|
| MeltingPtC = 53 |
|
| Appearance= |
|
|
|
| MeltingPt_ref = <ref name=Merck/> |
|
| Density= |
|
|
|
| BoilingPtC= 262 |
|
| MeltingPt= |
|
|
|
| BoilingPt_ref = <ref name=Merck/> |
|
| BoilingPt= |
|
|
⚫ |
}} |
|
| Solubility= |
|
| ⚫ |
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Dimethyl-4-phenylenediamine''' is an ]. It has been used as an accelerator for the vulcanization of rubber.<ref>{{cite journal |last1=Geer |first1=W. C. |last2=Bedford |first2=C. W. |date= January 24, 1925 |title= The History of Organic Accelerators in the Rubber Industry|journal= Industrial and Engineering Chemistry|volume= 17|issue= 4|pages= 393–396 |doi=10.1021/ie50184a021 |author1-link=William C. Geer }}</ref> It can be used in ]s. |
|
'''Dimethyl-4-phenylenediamine''' is a molecule used in the ]. |
|
|
|
|
|
|
|
==Synthesis== |
| ⚫ |
] |
|
|
|
Dimethyl-4-phenylenediamine is made by the ] of ] followed by reduction. |
|
|
|
|
|
|
==Applications== |
|
|
Dimethyl-4-phenylenediamine can be converted to ] by reaction with ] and ] in several steps:<ref>{{cite encyclopedia|author=Horst Berneth|title=Azine Dyes|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|year=2012|publisher=Wiley-VCH|place=Weinheim|doi=10.1002/14356007.a03_213.pub3|isbn=9783527303854 }}</ref> |
|
|
|
|
|
|
:] |
|
{{organic-compound-stub}} |
|
|
|
|
|
|
|
It is used as accelerator for the vulcanization of rubber, being first converted to the corresponding ]. |
|
] |
|
|
|
|
|
|
:] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
⚫ |
] |
|
|
] |
|
|
] |