| Revision as of 18:30, 16 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 14:26, 3 December 2023 edit undoCitation bot (talk | contribs)Bots5,458,208 edits Add: doi-access. | Use this bot. Report bugs. | #UCB_CommandLine |
| (17 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{multiple issues|{{context|date=May 2014}} |
|
|
{{notability|date=May 2014}}}} |
|
{{chembox |
|
{{chembox |
|
|
| Name = Dimethylamino{{SHY}}propionylphenothiazine |
| ⚫ |
| verifiedrevid = 427439120 |
|
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Astra 1397.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| verifiedrevid = 450846536 |
| ⚫ |
|IUPACName=2-(Dimethylamino)-1-phenothiazin-10-ylpropan-1-one |
|
|
|
| ImageFile = Dimethylaminopropionylphenothiazine.png |
|
|OtherNames=Astra 1397 |
|
|
⚫ |
| ImageSize = 150 |
|
|
| ImageAlt = Skeletal formula of dimethylaminopropionylphenothiazine |
|
|
| ImageFile1 = Dimethylaminopropionylphenothiazine 3D spacefill.png |
|
|
| ImageSize1 = 160 |
|
|
| ImageAlt1 = Space-filling model of the Dimethylaminopropionylphenothiazine molecule |
|
⚫ |
| IUPACName=2-(Dimethylamino)-1-phenothiazin-10-ylpropan-1-one |
|
⚫ |
| OtherNames=Astra 1397 |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=63834-04-8 |
|
| CASNo=63834-04-8 |
| ⚫ |
| CASOther=<br> (]) |
|
|
|
| CASNo2_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| PubChem=113918 |
|
|
|
| CASNo2 = 51818-93-0 |
| ⚫ |
| SMILES=CC(C(=O)N1C2=CC=CC=C2SC3=CC=CC=C31)N(C)C |
|
|
|
| CASNo2_Comment =(]) |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 00435Z54H1 |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = R6LE8V69WA |
|
⚫ |
| UNII2_Comment = (]) |
|
⚫ |
| PubChem=113918 |
|
⚫ |
| SMILES=CC(C(=O)N1C2=CC=CC=C2SC3=CC=CC=C31)N(C)C |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 102089 |
|
|
| InChI = 1/C17H18N2OS/c1-12(18(2)3)17(20)19-13-8-4-6-10-15(13)21-16-11-7-5-9-14(16)19/h4-12H,1-3H3 |
|
|
| InChIKey = POZJNEBUHLZROM-UHFFFAOYAG |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C17H18N2OS/c1-12(18(2)3)17(20)19-13-8-4-6-10-15(13)21-16-11-7-5-9-14(16)19/h4-12H,1-3H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = POZJNEBUHLZROM-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>17</sub>H<sub>18</sub>N<sub>2</sub>OS |
|
| Formula=C<sub>17</sub>H<sub>18</sub>N<sub>2</sub>OS |
|
| MolarMass=298.40 g/mol |
|
| MolarMass=298.40 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
|
| ATCCode_prefix = A03 |
| ⚫ |
| MainHazards= |
|
|
|
| ATCCode_suffix = AC02 |
| ⚫ |
| FlashPt= |
|
|
|
}} |
|
| Autoignition= |
|
|
|
|Section7={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt= |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Dimethylaminopropionylphenothiazine''' or '''10-(alpha-dimethylaminopropionyl)phenothiazine ''' is an ]. |
|
'''Dimethylaminopropionylphenothiazine''' or '''10-(alpha-dimethylaminopropionyl)phenothiazine ''' is an ].<ref>{{cite journal | vauthors = Winnenburg R, Bodenreider O | title = A framework for assessing the consistency of drug classes across sources | journal = Journal of Biomedical Semantics | volume = 5 | issue = 1 | pages = 30 | date = 2014-07-09 | pmid = 25101165 | pmc = 4120719 | doi = 10.1186/2041-1480-5-30 | doi-access = free }}</ref> |
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
|
{{Drugs for functional gastrointestinal disorders}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |
|
{{gastrointestinal-drug-stub}} |