| Revision as of 00:29, 4 January 2011 edit24.240.36.218 (talk) ester changed to diester← Previous edit |
Latest revision as of 04:32, 23 July 2024 edit undoSimLibrarian (talk | contribs)Extended confirmed users124,467 editsm Subscript use for LD50Tag: Visual edit |
| (31 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 402000786 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 405788978 |
|
| ImageFile = Dioctyl adipate.svg |
|
| ImageFile = Dioctyl adipate.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| IUPACName = Dioctyl hexanedioate |
|
| PIN = Di(octyl) hexanedioate |
|
| OtherNames = |
|
| OtherNames = Di-''n''-octyl adipate |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 29011 |
|
| ChemSpiderID = 29011 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = MBY1SL921L |
|
| UNII = 2BD76YG9SI |
|
| InChI = 1/C22H42O4/c1-3-5-7-9-11-15-19-25-21(23)17-13-14-18-22(24)26-20-16-12-10-8-6-4-2/h3-20H2,1-2H3 |
|
| InChI = 1/C22H42O4/c1-3-5-7-9-11-15-19-25-21(23)17-13-14-18-22(24)26-20-16-12-10-8-6-4-2/h3-20H2,1-2H3 |
|
| InChIKey = NEHDRDVHPTWWFG-UHFFFAOYAJ |
|
| InChIKey = NEHDRDVHPTWWFG-UHFFFAOYAJ |
| Line 16: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NEHDRDVHPTWWFG-UHFFFAOYSA-N |
|
| StdInChIKey = NEHDRDVHPTWWFG-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|changed|CAS}} |
|
| CASNo =103-23-1 |
|
| CASNo =123-79-5 |
|
| PubChem = 31271 |
|
| PubChem = 31271 |
|
| SMILES = O=C(OCCCCCCCC)CCCCC(=O)OCCCCCCCC |
|
| SMILES = O=C(OCCCCCCCC)CCCCC(=O)OCCCCCCCC |
|
|
| EINECS = 204-652-9 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=22 | H=42 | O=4 |
|
| Formula =C<sub>22</sub>H<sub>42</sub>O<sub>4</sub> |
|
|
|
| Appearance = Colourless to yellowish liquid<ref name=GESTIS>{{GESTIS|ZVG= 12820}}</ref> |
|
| MolarMass=370.57 g/mol |
|
|
|
| Density = 0.98 g/mL<ref name=GESTIS/> |
|
| Appearance = |
|
|
| Density = 0.92 g/mL |
|
| MeltingPtC = -7.48 |
|
|
| MeltingPt_ref = <ref name=GESTIS/> |
|
| MeltingPt = -67.8 °C |
|
|
|
| BoilingPtC = 404.84 |
|
| BoilingPt = 214 °C (at 0.67 kPa) |
|
|
|
| BoilingPt_ref = <ref name=GESTIS/> |
|
| Solubility = |
|
|
|
| Solubility = 0.78 mg/L (22 °C)<ref name=GESTIS/> |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Dioctyl adipate''' or '''DOA''' is a ]. DOA is a ] of ] and two equivalents of ]. Its chemical formula is {{Carbon}}<sub>22</sub>{{Hydrogen}}<sub>42</sub>{{Oxygen}}<sub>4</sub>. |
|
|
|
|
|
|
|
'''Dioctyl adipate''' ('''DOA''') is an ] with the formula (CH<sub>2</sub>CH<sub>2</sub>CO<sub>2</sub>C<sub>8</sub>H<sub>17</sub>)<sub>2</sub>. It is a colorless oily liquid . As well as related ]s derived from ], ], isodecanol, etc., it is used as a ].<ref name="Ullmann">{{cite book | first = M. T. | last = Musser | chapter = Adipic Acid | title = Ullmann's Encyclopedia of Industrial Chemistry | publisher = Wiley-VCH | location = Weinheim | year = 2005 | doi = 10.1002/14356007.a01_269| isbn = 3527306730 }}</ref><ref>{{cite web | url = http://www.chemicalland21.com/industrialchem/solalc/DIMETHYL%20ADIPATE.htm | title = Dimethyl Adipate | publisher = chemicalland21.com}}</ref> |
| ⚫ |
] is sometimes incorrectly called dioctyl adipate. |
|
|
|
|
|
|
⚫ |
] is sometimes incorrectly called dioctyl adipate. The abbreviation DOA has also been used for bis(2-ethylhexyl) adipate (CAS # 103-23-1). |
|
DOA features flexibility at low temperatures, good electrical properties, good resistance to ], and good stability to heat. DOA is used to produce clear films for ] applications. In addition, it is compatible with ], ], most ]s, and high-butyryl cellulose acetate butyrates. Short chain esters are used as high-boiling, ], low-toxicity ]s and ]s. Long chain ]s of adipic acid are used as ]s for the functions of stability, superior lubricity, corrosion protection, biodegradability, and excellent performance at both high and low temperatures. Adipic acid esters (C5 - C10) are used as low-temperature-resistant and low-viscosity ]s for ]s and cellulose esters. |
|
|
|
|
|
|
|
==Toxicity== |
|
Harmonised tariff code 32151100 |
|
|
|
Esters of adipic acid exhibit low acute toxicities in animal models. The ] of the related ethylhexanoate is estimated at 900 mg/kg (rat, i.v.).<ref name="Ullmann"/> |
|
|
|
|
|
==External links== |
|
==References== |
|
*{{ICSC|1292|12}} |
|
{{reflist}} |
|
*] Monograph "" |
|
|
|
|
|
|
{{HealthIssuesOfPlastics}} |
|
{{HealthIssuesOfPlastics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
] |
|