| Revision as of 06:16, 7 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Resorcinols using HotCat← Previous edit |
Latest revision as of 02:14, 29 July 2023 edit undoJosve05a (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers155,023 edits →References: why |
| (44 intermediate revisions by 25 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| Name = Diosmetin |
|
|
|
| Watchedfields = changed |
|
| ImageFile = Diosmetin.svg |
|
|
|
| verifiedrevid = 401008559 |
| ⚫ |
| ImageSize = 250px |
|
|
| ImageName = Diosmetin structure |
|
| Name = Diosmetin |
|
⚫ |
| ImageFile = Diosmetin.svg |
| ⚫ |
| IUPACName = 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)chromen-4-one |
|
|
⚫ |
| ImageSize = 220px |
| ⚫ |
| OtherNames = Luteolin 4'-methyl ether |
|
|
|
| ImageName = Diosmetin structure |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageFile1 = Diosmetin molecule ball.png |
| ⚫ |
| CASNo= 520-34-3 |
|
|
|
| ImageSize1 = 220 |
| ⚫ |
| SMILES = COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
|
|
|
| ImageAlt1 = Ball-and-stick model of diosmetin |
| ⚫ |
| InChI = |
|
|
|
| IUPACName = 3′,5,7-Trihydroxy-4′-methoxyflavone |
| ⚫ |
| PubChem = 5281612 |
|
|
⚫ |
| SystematicName = 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4''H''-benzopyran-4-one |
|
⚫ |
| OtherNames = Luteolin 4′-methyl ether |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 520-34-3 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = TWZ37241OT |
|
⚫ |
| SMILES = COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4444931 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MBNGWHIJMBWFHU-UHFFFAOYSA-N |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 90568 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 4630 |
|
⚫ |
| PubChem = 5281612 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>6</sub> |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>6</sub> |
|
| MolarMass = 300.26 g/mol |
|
| MolarMass = 300.26 g/mol |
|
⚫ |
| Density = |
|
| ExactMass = 300.063388 |
|
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Diosmetin''' is an ], a chemical compound that can be found in the Caucasian ]<ref></ref> |
|
|
|
|
|
|
|
'''Diosmetin''', also known as '''5,7,3′-trihydroxy-4′-methoxyflavone''', is an ], a chemical compound that can be found in the Caucasian ].<ref>{{cite journal | url=https://doi.org/10.1007%2FBF02465832 | doi=10.1007/BF02465832 | title=Diosmetin glycosides from caucasian vetch: Isolation and study of biological activity | year=1998 | last1=Andreeva | first1=O. A. | last2=Ivashev | first2=M. N. | last3=Ozimina | first3=I. I. | last4=Maslikova | first4=G. V. | journal=Pharmaceutical Chemistry Journal | volume=32 | issue=11 | pages=595–597 | s2cid=21434373 }}</ref> |
| ⚫ |
==]== |
|
|
|
|
| ⚫ |
Diosmetin is the ] aglycone. |
|
|
|
It has been found to act as a weak ] ].<ref name="pmid20133810">{{cite journal | vauthors = Jang SW, Liu X, Yepes M, Shepherd KR, Miller GW, Liu Y, Wilson WD, Xiao G, Blanchi B, Sun YE, Ye K | title = A selective TrkB agonist with potent neurotrophic activities by 7,8-dihydroxyflavone | journal = Proc. Natl. Acad. Sci. U.S.A. | volume = 107 | issue = 6 | pages = 2687–92 | year = 2010 | pmid = 20133810 | pmc = 2823863 | doi = 10.1073/pnas.0913572107 | bibcode = 2010PNAS..107.2687J | doi-access = free }}</ref> |
|
|
|
|
⚫ |
==Glycosides== |
|
⚫ |
Diosmetin is the ] of ]. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
<!-- ==External links== --> |
|
|
|
|
|
|
{{flavone}} |
|
{{Flavones}} |
|
|
{{Growth factor receptor modulators}} |
|
|
|
|
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
|
|
|
|
{{Polyphenol-stub}} |
|
{{Aromatic-stub}} |
|
|
|
|
] |
|
|
] |
|