| Revision as of 17:34, 13 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'DrugBank_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot← Previous edit |
Latest revision as of 01:33, 26 August 2023 edit undoGraeme Bartlett (talk | contribs)Administrators249,975 edits added Category:Ethyl esters using HotCat |
| (25 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 443694308 |
|
| verifiedrevid = 444660458 |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile = Dioxathion.svg |
|
| ImageFile = Dioxathion.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
|
| ImageAlt = Skeletal formula of dioxathion |
|
|
| ImageFile1 = Dioxathion 3D ball.png |
|
|
| ImageSize1 = 250 |
|
|
| ImageAlt1 = Ball-and-stick model of the dioxathion molecule |
|
| IUPACName = S,S'-1,4-dioxane-2,3-diyl O,O,O',O'-tetraethyl bis(dithiophosphate) |
|
| IUPACName = S,S'-1,4-dioxane-2,3-diyl O,O,O',O'-tetraethyl bis(dithiophosphate) |
|
| OtherNames = phosphorodithoic acic; S,S’-1,4-Dioxane- 2,3-Diyl<br> 0,0,0’,0’-Tetraethyl Ester; Navadel; Delnatex; <br>Delnav; Deltic; dioxane phosphate |
|
| OtherNames = phosphorodithoic acid; S,S’-1,4-Dioxane- 2,3-Diyl<br/ > 0,0,0’,0’-Tetraethyl Ester; Navadel; Delnatex; <br />Delnav; Deltic; dioxane phosphate<br />p-Dioxane-2,3-diyl ethyl phosphorodithioate<br /> 2,3-p-Dioxanethiol-S,S-bis(O,O-diethyl phosphoro-dithioate) |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| Abbreviations = |
|
| Abbreviations = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| Line 17: |
Line 21: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VBKKVDGJXVOLNE-UHFFFAOYSA-N |
|
| StdInChIKey = VBKKVDGJXVOLNE-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 78-34-2 |
|
| CASNo = 78-34-2 |
|
| EINECS = |
|
| EINECS = |
| Line 23: |
Line 28: |
|
| UNII = J2DF82JA7N |
|
| UNII = J2DF82JA7N |
|
| SMILES = S=P(SC1OCCOC1SP(=S)(OCC)OCC)(OCC)OCC |
|
| SMILES = S=P(SC1OCCOC1SP(=S)(OCC)OCC)(OCC)OCC |
|
| InChI = |
|
|
| RTECS = |
|
| RTECS = |
|
| MeSHName = |
|
| MeSHName = |
| Line 30: |
Line 34: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = |
|
| KEGG = |
|
|
}} |
|
| ATCCode_prefix = |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| ATCCode_suffix = |
|
|
| ATC_Supplemental =}} |
|
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
| Formula = ]<sub>12</sub>]<sub>26</sub>]<sub>6</sub>]<sub>2</sub>]<sub>4</sub> |
|
| Formula = ]<sub>12</sub>]<sub>26</sub>]<sub>6</sub>]<sub>2</sub>]<sub>4</sub> |
|
| MolarMass = 456.2 g/mol |
|
| MolarMass = 456.2 g/mol |
|
| Appearance = Thick reddish-brown liquid/powder, garlic odor |
|
| Appearance = Thick reddish-brown liquid/powder |
|
| Density = |
|
| Odor = garlicky |
|
|
| Density = 1.26 g/cm<sup>3</sup> |
|
| MeltingPt = −20 ºC |
|
| MeltingPtC = −20 |
|
| Melting_notes = |
|
|
|
| MeltingPt_notes = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Boiling_notes = |
|
| BoilingPt_notes = |
|
| Solubility = Insoluble |
|
| Solubility = Insoluble |
|
| SolubleOther = |
|
| SolubleOther = |
|
| Solvent = |
|
| Solvent = |
|
| pKa = |
|
| pKa = |
|
| pKb = }} |
|
| pKb = |
|
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| ExternalMSDS = |
|
| ExternalSDS = |
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
| MainHazards = |
|
| NFPA-H = |
|
| NFPA-H = |
|
| NFPA-F = |
|
| NFPA-F = |
|
| NFPA-R = |
|
| NFPA-R = |
|
| NFPA-O = |
|
| NFPA-S = |
|
⚫ |
| FlashPt = noncombustible |
|
| RPhrases = |
|
|
|
| FlashPt_ref = <ref name=PGCH/> |
|
| SPhrases = |
|
|
| RSPhrases = |
|
| AutoignitionPt = |
| ⚫ |
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
| ExploLimits = |
|
| PEL = }} |
|
| PEL = none<ref name=PGCH>{{PGCH|0238}}</ref> |
|
|
| IDLH = N.D.<ref name=PGCH/> |
|
|
| REL = TWA 0.2 mg/m<sup>3</sup><ref name=PGCH/> |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Dioxathion''', ] known as p-dioxane-2,3-diyl ethyl phosphorodithioate, is an ] ]. It is used as an ] on livestock and as an ] on citrus fruits, deciduous fruits and nuts. |
|
'''Dioxathion''', ] known as p-dioxane-2,3-diyl ethyl phosphorodithioate, is an ] ]. It is used as an ] on livestock and as an ] on citrus fruits, deciduous fruits and nuts. |
|
|
|
|
|
==Uses== |
|
==Uses== |
|
Under the trade name Delnav, it can be used to control insects and mites on apples, pears, quince, grapes, and walnuts, and finds use in the control of ticks, horn flies, lice and sheep keds in various livestock, either as a spray or as a dip. Under the trade name Deltic, it is a restricted use pesticide for exterior control of fleas, ticks and mites, in kennels, dog houses, yards, and other recreational areas. |
|
Under the trade name Delnav, it can be used to control insects and mites on apples, pears, quince, grapes, and walnuts, and finds use in the control of ticks, horn flies, lice and sheep ] in various livestock, either as a spray or as a dip. Under the trade name Deltic, it is a restricted use pesticide for exterior control of fleas, ticks and mites, in kennels, dog houses, yards, and other recreational areas. |
|
|
|
|
|
==Toxicity== |
|
==Toxicity== |
|
Dioxathion is an ], as defined by Section 302 of the ] ], and is no longer allowed to be sold in the United States. However, it continues to see use in some other countries. It has been known to cause inhibition of the ] ] in rats, and it is recommended that people who have exposure to dioxathion regularly get their ] and ] cholinesterase levels assessed. Persons exposed to other chemicals which affect cholinesterase levels, e.g. other organophosphates or ]s, may be at an increased risk. There are no known ]ic or ] effects, but long term exposure may result in ] damage, poor ], and personality changes of ], ] or ]. |
|
Dioxathion is an ], as defined by Section 302 of the ] ], and is no longer allowed to be sold in the United States. However, it continues to see use in some other countries. It has been known to cause inhibition of the ] ] in rats, and it is recommended that people who have exposure to dioxathion regularly get their ] and ] cholinesterase levels assessed. Persons exposed to other chemicals which affect cholinesterase levels, e.g. other organophosphates or ]s, may be at an increased risk. There are no known ]ic or ] effects, but long term exposure may result in ] damage, poor ], and personality changes of ], ] or ]. |
|
|
|
|
|
Short-term effects may include irritation to the ], ] and blurring of ], ] ]s, laboured breathing, ], ]ing, ], ] cramps and excess ]. These are mostly classic symptoms of ]. |
|
Short-term effects may include irritation to the ], ] and blurring of ], ] ]s, laboured breathing, ], ], ], ] cramps and excess ]. These are mostly classic symptoms of ]. |
|
|
|
|
|
Dioxathion must be stored away from ]s, ], ] and ]s. Contact can be avoided by using protective clothing and eyeware. If poisoning occurs, a ] may administer ], or ] in case of severe poisoning. |
|
Dioxathion must be stored away from ]s, ], ] and ]s. Contact can be avoided by using protective clothing and eyeware. If poisoning occurs, a ] may administer ], or ] in case of severe poisoning. |
|
|
|
|
|
==References== |
|
==References== |
|
|
{{Reflist}} |
| ⚫ |
* |
|
|
|
|
|
|
==External links== |
|
⚫ |
* |
|
|
* |
|
* |
|
* |
|
* |
|
|
* |
|
* |
|
* |
|
* |
|
|
|
|
|
{{insecticides}} |
|
{{Insecticides}} |
|
|
{{Acetylcholine metabolism and transport modulators}} |
|
{{Cholinergics}} |
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
|
|
|
] |
|