| Revision as of 16:14, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 469142668 of page Diphemanil_metilsulfate for the Chem/Drugbox validation project (updated: 'ChEMBL'). |
Latest revision as of 14:51, 19 June 2022 edit Ffffrr (talk | contribs)Extended confirmed users99,459 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 460791488 |
|
| verifiedrevid = 470455243 |
|
| IUPAC_name = 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methylsulfate |
|
| IUPAC_name = 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methylsulfate |
|
| image = Diphemanil metilsulfate.png |
|
| image = Diphemanil metilsulfate.png |
|
| drug_name = Diphemanil Methylsulfate |
|
| drug_name = |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
| Line 18: |
Line 17: |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
| Line 25: |
Line 23: |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 62-97-5 |
|
| CAS_number = 62-97-5 |
| Line 43: |
Line 39: |
|
| ChEBI = 59782 |
|
| ChEBI = 59782 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1200880 --> |
|
| ChEMBL = 1200880 |
|
|
<!--Chemical data--> |
|
| C=21 | H=27 | N=1 | O=4 | S=1 |
|
| C=21 | H=27 | N=1 | O=4 | S=1 |
|
| molecular_weight = 389.51 g/mol |
|
|
| smiles = S(=O)(=O)OC.c3c(\C(=C1/CC(C)(C)CC1)c2ccccc2)cccc3 |
|
| smiles = S(=O)(=O)OC.c3c(\C(=C1/CC(C)(C)CC1)c2ccccc2)cccc3 |
|
| InChI = 1/C20H24N.CH4O4S/c1-21(2)15-13-19(14-16-21)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-5-6(2,3)4/h3-12H,13-16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
|
|
| InChIKey = BREMLQBSKCSNNH-REWHXWOFAY |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H24N.CH4O4S/c1-21(2)15-13-19(14-16-21)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-5-6(2,3)4/h3-12H,13-16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
|
| StdInChI = 1S/C20H24N.CH4O4S/c1-21(2)15-13-19(14-16-21)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-5-6(2,3)4/h3-12H,13-16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| Line 54: |
Line 48: |
|
| StdInChIKey = BREMLQBSKCSNNH-UHFFFAOYSA-M |
|
| StdInChIKey = BREMLQBSKCSNNH-UHFFFAOYSA-M |
|
}} |
|
}} |
|
|
|
|
|
In the field of ], '''diphemanil metilsulfate''' also known as '''diphemanil methylsulfate''' is an ] (an agent that blocks the action of the natural ] acetylcholine).<ref name="pmid21482">{{cite journal | vauthors = Finkbeiner AE, Bissada NK, Welch LT | title = Uropharmacology: part VI. Parasympathetic depressants | journal = Urology | volume = 10 | issue = 5 | pages = 503–10 | date = November 1977 | pmid = 21482 | doi = 10.1016/0090-4295(77)90149-2 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
|
|
|
{{Drugs for functional gastrointestinal disorders}} |
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |