| Revision as of 17:01, 29 January 2011 editJoseph20202021 (talk | contribs)Extended confirmed users97,223 editsm Delete </br>← Previous edit |
Latest revision as of 06:15, 20 October 2021 edit undoCitation bot (talk | contribs)Bots5,458,618 edits Add: title. Changed bare reference to CS1/2. | Use this bot. Report bugs. | Suggested by BrownHairedGirl | Linked from User:BrownHairedGirl/Articles_with_new_bare_URL_refs | #UCB_webform_linked 717/2197 |
| (20 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{Unreferenced stub|auto=yes|date=December 2009}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 399910648 |
|
|
|
| Watchedfields = changed |
|
|ImageFile=Disodium-glutamate-2D-skeletal.png |
|
|
⚫ |
| verifiedrevid = 410784202 |
| ⚫ |
|ImageSize=200px |
|
|
|IUPACName=Disodium 2-aminopentanedioate |
|
| ImageFile=Disodium-glutamate-2D-skeletal.png |
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames=DSG |
|
|
|
| IUPACName=Disodium 2-aminopentanedioate |
|
⚫ |
| OtherNames=DSG |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 7969883 |
|
| ChemSpiderID = 7969883 |
|
| InChI = 1/C5H9NO4.2Na/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
|
| InChI = 1/C5H9NO4.2Na/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| Line 16: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PXEDJBXQKAGXNJ-UHFFFAOYSA-L |
|
| StdInChIKey = PXEDJBXQKAGXNJ-UHFFFAOYSA-L |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo= |
|
| CASNo= 142-47-2 |
| ⚫ |
| PubChem=9794116 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C(CC(=O))C(C(=O))N.. |
|
|
|
| UNII = C3C196L9FG |
|
⚫ |
| PubChem=9794116 |
|
⚫ |
| SMILES=C(CC(=O))C(C(=O))N.. |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>5</sub>H<sub>7</sub>NNa<sub>2</sub>O<sub>4</sub> |
|
| Formula=C<sub>5</sub>H<sub>7</sub>NNa<sub>2</sub>O<sub>4</sub> |
|
| MolarMass=191.09 g/mol |
|
| MolarMass=191.09 g/mol |
|
| Appearance= |
|
| Appearance= white crystalline powder |
|
|
| Odor = practically odorless |
|
| Density= |
|
|
| MeltingPt= |
|
| Density= |
|
| BoilingPt= |
|
| MeltingPt= |
|
|
| BoilingPtC= 225 |
|
| Solubility= |
|
|
|
| BoilingPt_notes = (decomposes) |
|
|
| Solubility= 73.9 g/100 mL (25 °C) |
|
|
| SolubleOther = sparingly soluble in ] |
|
|
| pKa = 6.8 |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
|
| LD50 = 16600 mg.mg (rat, oral) |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Disodium glutamate''', abbreviated '''DSG''', (Na<sub>2</sub>C<sub>5</sub>H<sub>7</sub>NO<sub>4</sub>) is a ] ] of ]. |
|
'''Disodium glutamate''', abbreviated '''DSG''', (Na<sub>2</sub>C<sub>5</sub>H<sub>7</sub>NO<sub>4</sub>) is a ] ] of ].<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/Sodium-L-glutamate|title=Sodium L-glutamate}}</ref> It is used as a flavoring agent to impart ] flavor. |
|
|
|
|
|
==Formation== |
|
==Formation== |
| Line 42: |
Line 51: |
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
|
|
|
{{DEFAULTSORT:Disodium Glutamate}} |
|
{{DEFAULTSORT:Disodium Glutamate}} |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Organic-compound-stub}} |
|
{{Organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|