| Revision as of 07:45, 18 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 12:03, 29 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Nitrobenzene derivatives; added Category:4-Nitrophenyl compounds using HotCat |
| (20 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 392220636 |
|
| verifiedrevid = 414585451 |
|
| Name = Disperse Orange 1 |
|
| Name = Disperse Orange 1 |
|
| ImageFile = DisperseOrange1.png |
|
|
|
| ImageFile = Disperse Orange 1.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Chemical structure of Disperse Orange 1 |
|
| ImageName = Chemical structure of Disperse Orange 1 |
|
|
| IUPACName = |
|
|
| OtherNames = 4-Anilino-4'-nitroazobenzene<br/> C.I. 11080 (]) |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>18</sub>H<sub>14</sub>N<sub>4</sub>O<sub>2</sub> |
|
| Formula = C<sub>18</sub>H<sub>14</sub>N<sub>4</sub>O<sub>2</sub> |
|
| MolarMass = 318.33476 g/mol |
|
| MolarMass = 318.33476 g/mol |
|
| MeltingPtC = 160.0 |
|
| MeltingPtC = 160.0 |
|
}} |
|
}} |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|chemspider}} |
|
| CASNo = 2581-69-3 |
|
|
| EINECS = 219-954-6 |
|
| CASNo = 2581-69-3 |
|
|
| EINECS = 219-954-6 |
|
|
| ChemSpiderID = 16477 |
|
|
| PubChem = 17414 |
|
|
| UNII = 1592R4P97H |
|
|
| StdInChI=1S/C18H14N4O2/c23-22(24)18-12-10-17(11-13-18)21-20-16-8-6-15(7-9-16)19-14-4-2-1-3-5-14/h1-13,19H |
|
|
| StdInChIKey = YFVXLROHJBSEDW-UHFFFAOYSA-N |
|
|
| SMILES = C1=CC=C(C=C1)NC2=CC=C(C=C2)N=NC3=CC=C(C=C3)(=O) |
|
}} |
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|317}} |
|
|
| PPhrases = {{P-phrases|261|272|280|302+352|321|333+313|363|501}} |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Disperse Orange 1''' (4-anilino-4'-nitroazobenzene) is a ] of the ] class. Disperse Orange 1 contains approximately 25% dye by weight, with the remaining mass consisting of ] and other salts<ref> Hair, S. R.; Taylor, G. A. and Schultz, L. W. J. Chem. Educ. 1990, 67, 709. ] </ref>. This dye is useful in conducting experiments with ] due to the ] effect between the trans-4A4N and cis-4A4N states that occurs during photo relaxation.{{Citation needed|date=August 2009}} |
|
'''Disperse Orange 1''', or '''4-anilino-4'-nitroazobenzene''', is an ]. Commercial samples contain approximately 25% dye by weight, with the remaining mass consisting of ] and other salts. |
|
|
|
|
|
This dye is useful in conducting experiments with ] due to the ] effect between the trans-4A4N and cis-4A4N states that occurs during photo relaxation.<ref>{{cite journal|author1=Hair, S. R. |author2=Taylor, G. A. |author3=Schultz, L. W. J. |title=An Easily Implemented Flash Photolysis Experiment for the Physical Chemistry Laboratory: the Isomerization of 4-Anilino-4'-Nitroazobenzene|journal=Journal of Chemical Education|year=1990|volume=67|issue=8|page=709|doi=10.1021/ed067p709|bibcode=1990JChEd..67..709H }}</ref><ref>Wildes, P. D.; Pacifici, J. G.; Irick, G.; Whitten, D. G. J. Am. Chem. Soc., 1971, 93, 2004.</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 22: |
Line 41: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |