| Revision as of 20:20, 1 September 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits Ditazole.svg← Previous edit |
Latest revision as of 00:37, 23 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,975 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (13 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 443728625 |
|
| verifiedrevid = 447915856 |
|
| IUPAC_name = 2,2'-(4,5-Diphenyloxazol-2-ylazanediyl)diethanol |
|
| IUPAC_name = 2,2'-(4,5-Diphenyloxazol-2-ylazanediyl)diethanol |
|
| image = Ditazole.svg |
|
| image = Ditazole.svg |
| Line 26: |
Line 28: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 18471-20-0 |
|
| CAS_number = 18471-20-0 |
|
| ATC_prefix = B01 |
|
| ATC_prefix = B01 |
|
| ATC_suffix = AC01 |
|
| ATC_suffix = AC01 |
|
| PubChem = 29088 |
|
| PubChem = 29088 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB08994 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = H2BQI5Z8FT |
|
| UNII = H2BQI5Z8FT |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07138 |
|
| KEGG = D07138 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 27061 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=20 | N=2 | O=3 |
|
| C=19 | H=20 | N=2 | O=3 |
|
|
| smiles = C1=CC=C(C=C1)C2=C(OC(=N2)N(CCO)CCO)C3=CC=CC=C3 |
|
| molecular_weight = 324.374 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C19H20N2O3/c22-13-11-21(12-14-23)19-20-17(15-7-3-1-4-8-15)18(24-19)16-9-5-2-6-10-16/h1-10,22-23H,11-14H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = UUCMDZWCRNZCOY-UHFFFAOYSA-N |
|
}} |
|
}} |
|
'''Ditazole''' is a ] aggregation ]. It is marketed in ] and ] under the trade name '''Ageroplas'''.<ref></ref><ref>The Merck Index, 12th Edition. 3432</ref> |
|
'''Ditazole''' is a non-steroidal anti-inflammatory agent with analgesic and antipyretic activity similar to phenylbutazone.<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/Ditazole|title = Ditazole | work = PubChem | publisher = U.S. National Library of Medicine }}</ref> It is also a ] aggregation ] which is marketed in ] and ] under the trade name '''Ageroplas'''.<ref>{{cite book |title=The Merck index : an encyclopedia of chemicals, drugs, and biologicals |date=1996 |publisher=Merck |location=Whitehouse Station, NJ |isbn=978-0-911910-12-4 |edition=12th | id = 3432 | vauthors = Budavari S, O'Neil M, Smith A, Heckelman P, Obenchain J }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
| Line 47: |
Line 56: |
|
|
|
|
|
{{Antithrombotics}} |
|
{{Antithrombotics}} |
|
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{blood-drug-stub}} |
|
{{blood-drug-stub}} |
|
|
|
|
] |
|
|
] |
|