| Revision as of 09:49, 13 October 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII').← Previous edit |
Latest revision as of 07:30, 22 May 2024 edit undo103.140.83.137 (talk)No edit summaryTags: Mobile edit Mobile web edit |
| (26 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 455346435 |
|
| ImageFile = Doxercalciferol.svg |
|
| ImageFile = Doxercalciferol.svg |
|
| ImageSize = 150px |
|
| ImageSize = 150px |
|
| IUPACName = (1''S'',3''R'',5''Z'',7''E'',22''E'')-9,10-Secoergosta-5,7,10,22-tetraene-1,3-diol |
|
| IUPACName = (1''S'',3''R'',5''Z'',7''E'',22''E'')-9,10-Secoergosta-5,7,10,22-tetraene-1,3-diol |
|
| OtherNames = 1-Hydroxyergocalciferol; 1-Hydroxyvitamin D2; 1α-Hydroxyergocalciferol; 1α-Hydroxyvitamin D2; Hectorol; TSA 840 |
|
| OtherNames = 1-Hydroxyergocalciferol; 1-Hydroxyvitamin D2; 1α-Hydroxyergocalciferol; 1α-Hydroxyvitamin D2; Hectorol; TSA 840 |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 2790 |
|
| CASNo = 54573-75-0 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 54573-75-0 |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 3DIZ9LF5Y9 |
|
| UNII = 3DIZ9LF5Y9 |
|
| PubChem = 5281107 |
|
| PubChem = 5281107 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
| ⚫ |
| ChemSpiderID = 4444554 |
|
|
|
| DrugBank = DB06410 |
| ⚫ |
| SMILES = O1CC(\C(=C)(O)C1)=C\C=C2/CCC3(2CC3(/C=C/(C)C(C)C)C)C |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| InChI = 1/C28H44O2/c1-18(2)19(3)9-10-20(4)25-13-14-26-22(8-7-15-28(25,26)6)11-12-23-16-24(29)17-27(30)21(23)5/h9-12,18-20,24-27,29-30H,5,7-8,13-17H2,1-4,6H3/b10-9+,22-11+,23-12-/t19-,20+,24+,25+,26-,27-,28+/m0/s1 |
|
|
⚫ |
| ChemSpiderID = 4444554 |
| ⚫ |
| InChIKey = HKXBNHCUPKIYDM-CGMHZMFXBN |
|
|
|
| ChEBI = 4712 |
| ⚫ |
| StdInChI = 1S/C28H44O2/c1-18(2)19(3)9-10-20(4)25-13-14-26-22(8-7-15-28(25,26)6)11-12-23-16-24(29)17-27(30)21(23)5/h9-12,18-20,24-27,29-30H,5,7-8,13-17H2,1-4,6H3/b10-9+,22-11+,23-12-/t19-,20+,24+,25+,26-,27-,28+/m0/s1 |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| StdInChIKey = HKXBNHCUPKIYDM-CGMHZMFXSA-N |
|
|
|
| ChEMBL = 1200810 |
|
⚫ |
| SMILES = O1CC(\C(=C)(O)C1)=C\C=C2/CCC3(2CC3(/C=C/(C)C(C)C)C)C |
|
⚫ |
| InChI = 1/C28H44O2/c1-18(2)19(3)9-10-20(4)25-13-14-26-22(8-7-15-28(25,26)6)11-12-23-16-24(29)17-27(30)21(23)5/h9-12,18-20,24-27,29-30H,5,7-8,13-17H2,1-4,6H3/b10-9+,22-11+,23-12-/t19-,20+,24+,25+,26-,27-,28+/m0/s1 |
|
⚫ |
| InChIKey = HKXBNHCUPKIYDM-CGMHZMFXBN |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C28H44O2/c1-18(2)19(3)9-10-20(4)25-13-14-26-22(8-7-15-28(25,26)6)11-12-23-16-24(29)17-27(30)21(23)5/h9-12,18-20,24-27,29-30H,5,7-8,13-17H2,1-4,6H3/b10-9+,22-11+,23-12-/t19-,20+,24+,25+,26-,27-,28+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = HKXBNHCUPKIYDM-CGMHZMFXSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=28|H=44|O=2 |
|
| C=28 | H=44 | O=2 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
| MainHazards = |
|
| ATCCode_prefix = H05 |
|
| FlashPt = |
|
| ATCCode_suffix = BX03 |
|
|
}} |
|
| Autoignition = |
|
|
|
|Section7={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Doxercalciferol''' (trade name '''Hectorol''') is drug for ] and ].<ref>{{cite journal | author = Sprague S M; Ho L T | title = Oral doxercalciferol therapy for secondary hyperparathyroidism in a peritoneal dialysis patient | journal = Clinical nephrology | year = 2002 | volume = 58 | issue = 2 | pages = 155–160 | pmid = 12227689}}</ref> It is a synthetic analog of ] (vitamin D<sub>2</sub>). It suppresses ] synthesis and secretion.<ref>{{cite web | url = http://www.drugs.com/ppa/doxercalciferol.html | title = Doxercalciferol | publisher = Drugs.com}}</ref> |
|
'''Doxercalciferol''' (or '''1-hydroxyergocalciferol''', trade name '''Hectorol''') is drug for ] and ].<ref>{{cite journal | author = Sprague S M | author2 = Ho L T | title = Oral doxercalciferol therapy for secondary hyperparathyroidism in a peritoneal dialysis patient | journal = Clinical Nephrology | year = 2002 | volume = 58 | issue = 2 | pages = 155–160 | doi = 10.5414/cnp58155 | pmid = 12227689}}</ref> It is a synthetic analog of ] (vitamin D<sub>2</sub>). It suppresses ] synthesis and secretion.<ref>{{cite web | url = https://www.drugs.com/ppa/doxercalciferol.html | title = Doxercalciferol | publisher = Drugs.com}}</ref> |
|
|
|
|
|
Doxercalciferol is the vitamin D<sub>2</sub> analogue of ].<ref>{{cite journal|last1=Upton|first1=R. A.|last2=Knutson|first2=J. C.|last3=Bishop|first3=C. W.|last4=LeVan|first4=L. W.|title=Pharmacokinetics of doxercalciferol, a new vitamin D analogue that lowers parathyroid hormone|journal=Nephrology Dialysis Transplantation|date=1 April 2003|volume=18|issue=4|pages=750–758|doi=10.1093/ndt/gfg030|pmid=12637645 |doi-access=free}}</ref> It undergoes 25-hydroxylation in the ] to become the active ], without the involvement of kidneys.<ref>{{cite web|title=HECTOROL INJECTION (doxercalciferol)|url=https://www.accessdata.fda.gov/drugsatfda_docs/label/2005/021027s012lbl.pdf|website=FDA accessdata|accessdate=21 April 2018}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
|
|
|
|
{{Calcium homeostasis}} |
|
{{pharma-stub}} |
|
|
|
{{Vitamin D receptor modulators}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{systemic-hormonal-drug-stub}} |