Misplaced Pages

Dupracetam: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 18:45, 10 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:← Previous edit Latest revision as of 13:51, 20 November 2023 edit undoOAbot (talk | contribs)Bots441,761 editsm Open access bot: doi updated in citation with #oabot. 
(21 intermediate revisions by 17 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| UNII_Ref = {{fdacite|correct|FDA}}
| Verifiedfields = changed
| UNII = BVM2UGN450
| verifiedrevid = 445993063 | verifiedrevid = 451559556
| IUPAC_name = 2-(2-oxopyrrolidin-1-yl)-N'-acetohydrazide
|
| image = Dupracetam.svg
|IUPAC_name = 2-(2-oxopyrrolidin-1-yl)-N'-acetohydrazide
| image = Dupracetam_structure.png
| width = 220 | width = 220

| CAS_number=59776-90-8
<!--Clinical data-->
| ATC_prefix=none
| tradename =
| ATC_suffix=
| pregnancy_category =
| ATC_supplemental=
| legal_status = Unscheduled
| PubChem=68793
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| metabolism =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 59776-90-8
| ATC_prefix = none
| PubChem = 68793
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2104359
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| UNII_Ref = {{fdacite|correct|FDA}}
| DrugBank=
| UNII = BVM2UGN450
| C=12|H=18|N=4|O=4
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| molecular_weight = 282.296 g/mol
| ChemSpiderID = 62033
| bioavailability=
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| metabolism =
| StdInChI = 1S/C12H18N4O4/c17-9(7-15-5-1-3-11(15)19)13-14-10(18)8-16-6-2-4-12(16)20/h1-8H2,(H,13,17)(H,14,18)
| elimination_half-life=
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| excretion =
| StdInChIKey = YPUPYVWSTBYCBY-UHFFFAOYSA-N

<!--Chemical data-->
| C=12 | H=18 | N=4 | O=4
| smiles = C1CC(=O)N(C1)CC(=O)NNC(=O)CN2CCCC2=O | smiles = C1CC(=O)N(C1)CC(=O)NNC(=O)CN2CCCC2=O
| pregnancy_category =
| legal_status = Unscheduled
| routes_of_administration=
}} }}


'''Dupracetam''' is a ] drug from the ] family.<ref name="pmid7294979">{{cite journal |author=Dell HD, Jacobi H, Kamp R, Kurz J, Wünsche C |title= |language=German |journal=Archiv Der Pharmazie |volume=314 |issue=8 |pages=697–702 |year=1981 |month=August |pmid=7294979 |doi= |url=}}</ref><ref name="pmid2829047">{{cite journal |author=Hall ED, Von Voigtlander PF |title=Facilitatory effects of piracetam on excitability of motor nerve terminals and neuromuscular transmission |journal=Neuropharmacology |volume=26 |issue=11 |pages=1573–9 |year=1987 |month=November |pmid=2829047 |doi= 10.1016/0028-3908(87)90003-7|url=}}</ref> '''Dupracetam''' is a ] drug from the ] family.<ref name="pmid7294979">{{cite journal | vauthors = Dell HD, Jacobi H, Kamp R, Kurz J, Wünsche C | title = | language = de | journal = Archiv der Pharmazie | volume = 314 | issue = 8 | pages = 697–702 | date = August 1981 | pmid = 7294979 | doi = 10.1002/ardp.19813140808 | s2cid = 95603731 }}</ref><ref name="pmid2829047">{{cite journal | vauthors = Hall ED, Von Voigtlander PF | title = Facilitatory effects of piracetam on excitability of motor nerve terminals and neuromuscular transmission | journal = Neuropharmacology | volume = 26 | issue = 11 | pages = 1573–1579 | date = November 1987 | pmid = 2829047 | doi = 10.1016/0028-3908(87)90003-7 | s2cid = 7759558 }}</ref>


One of its metabolites, 1-Methylhydantoin, displays renal toxicity in high doses.<ref>{{cite journal | vauthors = Yang B, Liu D, Li CZ, Liu FY, Peng YM, Jiang YS | title = 1-Methylhydantoin cytotoxicity on renal proximal tubular cells in vitro | journal = Renal Failure | volume = 29 | issue = 8 | pages = 1025–1029 | year = 2007 | pmid = 18067051 | doi = 10.1080/08860220701641272 | s2cid = 26843776 | doi-access = free }}</ref>


== See also ==

==See also==
* ] * ]


Line 39: Line 53:


] ]
]
] ]
] ]



{{nervous-system-drug-stub}} {{nervous-system-drug-stub}}