| Revision as of 16:56, 13 May 2011 editDcirovic (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers253,275 editsNo edit summary← Previous edit |
Latest revision as of 09:37, 13 December 2024 edit undoGraeme Bartlett (talk | contribs)Administrators250,229 edits more ids |
| (27 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 407255362 |
|
| verifiedrevid = 428948268 |
|
| ImageFile=Dynorphin A.svg |
|
| ImageFile=Dynorphin A.svg |
|
| ImageSize=300px |
|
| ImageSize=300px |
|
| IUPACName= |
|
| IUPACName= |
|
| OtherNames=Dynorphin 1-13 |
|
| OtherNames=Dynorphin 1-13 |
|
| Reference=<ref>, ].</ref> |
|
| Reference=<ref>, ].</ref> |
|
| Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=72957-38-1 |
|
| CASNo=72957-38-1 |
|
|
| ChEMBL = 411557 |
|
|
| ChemSpiderID = 17287683 |
|
|
| DrugBank = DB16146 |
|
|
| IUPHAR_ligand = 1620 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = VFC23V742Z |
|
| PubChem=16130969 |
|
| PubChem=16130969 |
|
|
| StdInChI=1S/C75H126N24O15/c1-7-45(6)61(70(111)94-53(25-17-35-87-75(83)84)71(112)99-36-18-26-58(99)69(110)93-50(21-11-13-31-76)64(105)96-56(38-44(4)5)67(108)95-54(72(113)114)22-12-14-32-77)98-65(106)52(24-16-34-86-74(81)82)91-63(104)51(23-15-33-85-73(79)80)92-66(107)55(37-43(2)3)97-68(109)57(40-46-19-9-8-10-20-46)90-60(102)42-88-59(101)41-89-62(103)49(78)39-47-27-29-48(100)30-28-47/h8-10,19-20,27-30,43-45,49-58,61,100H,7,11-18,21-26,31-42,76-78H2,1-6H3,(H,88,101)(H,89,103)(H,90,102)(H,91,104)(H,92,107)(H,93,110)(H,94,111)(H,95,108)(H,96,105)(H,97,109)(H,98,106)(H,113,114)(H4,79,80,85)(H4,81,82,86)(H4,83,84,87)/t45-,49-,50-,51-,52-,53-,54?,55-,56-,57-,58-,61-/m0/s1 |
|
| SMILES= |
|
|
|
| StdInChIKey = OVVIBUHLQIYUEU-LCBAMVSPSA-N |
|
|
| SMILES = Isomeric SMILES |
|
|
CC(C)(C(=O)N(CCCNC(=N)N)C(=O)N1CCC1C(=O)N(CCCCN)C(=O)N(CC(C)C)C(=O)NC(CCCCN)C(=O)O)NC(=O)(CCCNC(=N)N)NC(=O)(CCCNC(=N)N)NC(=O)(CC(C)C)NC(=O)(CC2=CC=CC=C2)NC(=O)CNC(=O)CNC(=O)(CC3=CC=C(C=C3)O)N |
|
}} |
|
}} |
|
| Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=75 | H=126 | N=24 | O=15 |
|
| C=75 | H=126 | N=24 | O=15 |
|
| MolarMass=1603.95474 |
|
| MolarMass=1603.95474 |
| Line 20: |
Line 30: |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
| Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Dynorphin A''' is a form of ], it is an endogenous ] whose sequence is: Tyr - Gly - Gly - Phe - Leu - Arg - Arg - Ile - Arg - Pro - Lys - Leu - Lys. |
|
|
|
'''Dynorphin A''' is a ], an ] ] that activates the ].<ref name=":0">{{Cite journal |last1=Wang |first1=Yue |last2=Zhuang |first2=Youwen |last3=DiBerto |first3=Jeffrey F. |last4=Zhou |first4=X. Edward |last5=Schmitz |first5=Gavin P. |last6=Yuan |first6=Qingning |last7=Jain |first7=Manish K. |last8=Liu |first8=Weiyi |last9=Melcher |first9=Karsten |last10=Jiang |first10=Yi |last11=Roth |first11=Bryan L. |last12=Xu |first12=H. Eric |date=2023-01-12 |title=Structures of the entire human opioid receptor family |journal=Cell |language=en |volume=186 |issue=2 |pages=413–427.e17 |doi=10.1016/j.cell.2022.12.026|pmid=36638794 |s2cid=255750597 |doi-access=free }}</ref> Its ] is Tyr-Gly-Gly-Phe-Leu-Arg-Arg-Ile-Arg-Pro-Lys-Leu-Lys, a tridecapeptide. |
|
|
|
|
|
'''Dynorphin A<sub>1–8</sub>''' is a truncated form of dynorphin A with the amino acid sequence: Tyr-Gly-Gly-Phe-Leu-Arg-Arg-Ile.<ref name="HMDB Dynorphin A 1-8">{{cite encyclopedia | title=Dynorphin A 1-8 | url=http://www.hmdb.ca/metabolites/HMDB0012933 | encyclopedia=HMDB Version 4.0 | publisher=Human Metabolome Database | access-date=20 October 2017 | date=27 September 2017 }}</ref><ref name="IUPHAR - Dynorphin A-(1-8) - Biological activity">{{cite web | title=Dynorphin A-(1-8): Biological activity | url=http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?tab=biology&ligandId=1621 | work= IUPHAR/BPS Guide to PHARMACOLOGY | publisher=International Union of Basic and Clinical Pharmacology | access-date= 20 October 2017 | quote = Principal endogenous agonists at κ receptor}}</ref> Dynorphin A<sub>1–8</sub> is an ] at the mu-, kappa-, and delta-]s;<ref name="IUPHAR - Dynorphin A-(1-8) - Biological activity" /> it has the highest binding affinity for the ].<ref name="IUPHAR - Dynorphin A-(1-8) - Biological activity" /> Structures of dynorphin A bound to the κ-opioid receptor have been reported.<ref name=":0" /><ref>{{Cite journal |last1=Chen |first1=Yuxiang |last2=Chen |first2=Bo |last3=Wu |first3=Tingting |last4=Zhou |first4=Fangfang |last5=Xu |first5=Fei |date=2022-08-05 |title=Cryo-EM structure of human κ-opioid receptor-Gi complex bound to an endogenous agonist dynorphin A |url=https://academic.oup.com/proteincell/advance-article/doi/10.1093/procel/pwac033/6656488 |journal=Protein & Cell |volume=14 |issue=6 |language=en |pages=464–468 |doi=10.1093/procel/pwac033 |pmid=37285260 |issn=1674-800X|pmc=10246719 }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{Reflist|2}} |
|
|
|
|
|
{{Opioid peptides}} |
|
{{Opioid peptides}} |
|
|
{{Opioidergics}} |
|
|
|
|
{{biochem-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
{{organic-compound-stub}} |
|
] |
|