Revision as of 13:13, 1 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 23:19, 12 August 2024 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,083 editsNo edit summary |
(23 intermediate revisions by 22 users not shown) |
Line 1: |
Line 1: |
|
|
{{single source|date=June 2019}} |
|
{{chembox |
|
{{chembox |
|
|
| Name = EEE |
|
| verifiedrevid = 399913837 |
|
| verifiedrevid = 399915146 |
|
| ImageFile1 = EEE.png |
|
|
|
| ImageFile = 2,4,5-Triethoxyamphetamine.svg |
|
| ImageSize1 = 200px |
|
|
| ImageFile2 = EEE-3d-sticks.png |
|
| ImageFile1 = EEE-3d-sticks.png |
|
| ImageSize2 = 180px |
|
| ImageSize1 = 200px |
|
|
| ImageFile2 = EEE psychedelic spacefill PubChem.png |
|
| IUPACName = 1-Methyl-2-(2,4,5-triethoxyphenyl)ethylamine |
|
|
| OtherNames = |
|
| ImageSize2 = 180px |
|
|
| PIN = 1-(2,4,5-Triethoxyphenyl)propan-2-amine |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| OtherNames = 2,4,5-Triethoxyamphetamine |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| InChI = 1/C15H25NO3/c1-5-17-13-10-15(19-7-3)14(18-6-2)9-12(13)8-11(4)16/h9-11H,5-8,16H2,1-4H3 |
|
| InChI = 1/C15H25NO3/c1-5-17-13-10-15(19-7-3)14(18-6-2)9-12(13)8-11(4)16/h9-11H,5-8,16H2,1-4H3 |
|
| InChIKey = PVOHHXSVHWUAMS-UHFFFAOYAO |
|
| InChIKey = PVOHHXSVHWUAMS-UHFFFAOYAO |
Line 14: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PVOHHXSVHWUAMS-UHFFFAOYSA-N |
|
| StdInChIKey = PVOHHXSVHWUAMS-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 23693-42-7 |
|
| CASNo = 23693-42-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = DY8NEE4XXW |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID=21106296 |
|
| ChemSpiderID=21106296 |
|
| PubChem = |
|
| PubChem = 44719557 |
|
| SMILES = CCOc1cc(OCC)c(cc1OCC)CC(C)N |
|
| SMILES = CCOc1cc(OCC)c(cc1OCC)CC(C)N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C=15 |
|
| Formula = C<sub>15</sub>H<sub>25</sub>NO<sub>3</sub> |
|
|
|
| H=25 |
|
| MolarMass = 267.36 g/mol |
|
|
|
| N=1 |
|
|
| O=3 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
Line 28: |
Line 36: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''EEE''', or 2,4,5-]], is a lesser-known ]. It is the ] ] of ]. EEE was first synthesized by ]. In his book '']'', both the dosage and duration are unknown. EEE produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of EEE. |
|
'''EEE''' ('''2,4,5-triethoxyamphetamine''') is a lesser-known ]. It is the ] ] of ]. EEE was first synthesized by ]. In his book '']'', both the ] and duration are unknown.<ref></ref> EEE produces few to no effects. Very little data exists about the ] properties, ], and toxicity of EEE. |
|
|
|
|
|
== See also == |
|
== See also == |
|
|
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
== External links == |
|
== References == |
|
|
{{reflist}} |
|
* |
|
|
* |
|
|
|
|
|
|
|
] |
|
{{PiHKAL}} |
|
|
⚫ |
] |
|
⚫ |
] |
|
|
|
|
⚫ |
] |
|
⚫ |
] |
|
|
|
|
|
|
{{Psychoactive-stub}} |
|
{{Psychoactive-stub}} |