Misplaced Pages

EEE (psychedelic): Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 13:13, 1 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit Latest revision as of 23:19, 12 August 2024 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,083 editsNo edit summary 
(23 intermediate revisions by 22 users not shown)
Line 1: Line 1:
{{single source|date=June 2019}}
{{chembox {{chembox
| Name = EEE
| verifiedrevid = 399913837 | verifiedrevid = 399915146
| ImageFile1 = EEE.png
| ImageFile = 2,4,5-Triethoxyamphetamine.svg
| ImageSize1 = 200px
| ImageFile2 = EEE-3d-sticks.png | ImageFile1 = EEE-3d-sticks.png
| ImageSize2 = 180px | ImageSize1 = 200px
| ImageFile2 = EEE psychedelic spacefill PubChem.png
| IUPACName = 1-Methyl-2-(2,4,5-triethoxyphenyl)ethylamine
| OtherNames = | ImageSize2 = 180px
| PIN = 1-(2,4,5-Triethoxyphenyl)propan-2-amine
| Section1 = {{Chembox Identifiers
| OtherNames = 2,4,5-Triethoxyamphetamine
| Section1 = {{Chembox Identifiers
| InChI = 1/C15H25NO3/c1-5-17-13-10-15(19-7-3)14(18-6-2)9-12(13)8-11(4)16/h9-11H,5-8,16H2,1-4H3 | InChI = 1/C15H25NO3/c1-5-17-13-10-15(19-7-3)14(18-6-2)9-12(13)8-11(4)16/h9-11H,5-8,16H2,1-4H3
| InChIKey = PVOHHXSVHWUAMS-UHFFFAOYAO | InChIKey = PVOHHXSVHWUAMS-UHFFFAOYAO
Line 14: Line 17:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PVOHHXSVHWUAMS-UHFFFAOYSA-N | StdInChIKey = PVOHHXSVHWUAMS-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 23693-42-7 | CASNo = 23693-42-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = DY8NEE4XXW
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID=21106296 | ChemSpiderID=21106296
| PubChem = | PubChem = 44719557
| SMILES = CCOc1cc(OCC)c(cc1OCC)CC(C)N | SMILES = CCOc1cc(OCC)c(cc1OCC)CC(C)N
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| C=15
| Formula = C<sub>15</sub>H<sub>25</sub>NO<sub>3</sub>
| H=25
| MolarMass = 267.36 g/mol
| N=1
| O=3
| Appearance = | Appearance =
| Density = | Density =
Line 28: Line 36:
| BoilingPt = | BoilingPt =
| Solubility = }} | Solubility = }}
| Section3 = {{Chembox Hazards | Section3 = {{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = }} | AutoignitionPt = }}
}} }}


'''EEE''', or 2,4,5-]], is a lesser-known ]. It is the ] ] of ]. EEE was first synthesized by ]. In his book '']'', both the dosage and duration are unknown. EEE produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of EEE. '''EEE''' ('''2,4,5-triethoxyamphetamine''') is a lesser-known ]. It is the ] ] of ]. EEE was first synthesized by ]. In his book '']'', both the ] and duration are unknown.<ref></ref> EEE produces few to no effects. Very little data exists about the ] properties, ], and toxicity of EEE.


== See also == == See also ==

* ] * ]
* ] * ]


== External links == == References ==
{{reflist}}
*
*


]
{{PiHKAL}}
]
]


]
]


{{Psychoactive-stub}} {{Psychoactive-stub}}