| Revision as of 19:07, 10 September 2011 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): nervous-system-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.← Previous edit |
Latest revision as of 10:24, 13 September 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,763 edits more ids |
| (18 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 424670089 |
|
| verifiedrevid = 449580268 |
|
| IUPAC_name = 5,7-dichloro-3-butyl]-3-ethyl-indolin-2-one |
|
| IUPAC_name = 5,7-dichloro-3-butyl]-3-ethyl-indolin-2-one |
|
| image = EGIS-12233_structure.png |
|
| image = EGIS-12,233.svg |
|
| width = 280 |
|
| width = 280 |
|
|
|
|
| Line 22: |
Line 24: |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 11525867 |
|
| PubChem = 11525867 |
|
|
| ChEMBL = 260870 |
|
|
| ChemSpiderID = 9700653 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=24 | H=28 | Cl=3 | N=3 | O=1 |
|
| C=24 | H=28 | Cl=3 | N=3 | O=1 |
|
|
| StdInChI=1S/C24H28Cl3N3O/c1-2-24(20-15-18(26)16-21(27)22(20)28-23(24)31)9-3-4-10-29-11-13-30(14-12-29)19-7-5-17(25)6-8-19/h5-8,15-16H,2-4,9-14H2,1H3,(H,28,31) |
|
| molecular_weight = 480.856 g/mol |
|
|
|
| StdInChIKey = NOWFIMHNXPZVSK-UHFFFAOYSA-N |
|
| smiles = c3cc(Cl)ccc3N4CCN(CC4)CCCCC1(CC)c2cc(Cl)cc(Cl)c2NC1=O |
|
| smiles = c3cc(Cl)ccc3N4CCN(CC4)CCCCC1(CC)c2cc(Cl)cc(Cl)c2NC1=O |
|
}} |
|
}} |
|
|
|
|
|
'''EGIS-12,233''' is a drug with applications in ], acting as a ] and ] ] for both the ] and ] ] ] subtypes, with good selectivity over other receptors.<ref>{{cite journal | last1 = Volk | first1 = B | last2 = Barkóczy | first2 = J | last3 = Hegedus | first3 = E | last4 = Udvari | first4 = S | last5 = Gacsályi | first5 = I | last6 = Mezei | first6 = T | last7 = Pallagi | first7 = K | last8 = Kompagne | first8 = H | last9 = Lévay | first9 = G | title = (Phenylpiperazinyl-butyl)oxindoles as selective 5-HT7 receptor antagonists | journal = Journal of medicinal chemistry | volume = 51 | issue = 8 | pages = 2522–32 | year = 2008 | pmid = 18361484 | doi = 10.1021/jm070279v }}</ref> It has been shown to increase ] release in ]r tissue, suggesting a role for the 5-HT<sub>6</sub> and 5-HT<sub>7</sub> receptors in regulation of the ] system.<ref>{{cite journal | last1 = Doleviczényi | first1 = Z | last2 = Vizi | first2 = ES |authorlink2 = Vizi ES| last3 = Gacsályi | first3 = I | last4 = Pallagi | first4 = K | last5 = Volk | first5 = B | last6 = Hársing Jr | first6 = LG | last7 = Halmos | first7 = G | last8 = Lendvai | first8 = B | last9 = Zelles | first9 = T | title = 5-HT6/7 receptor antagonists facilitate dopamine release in the cochlea via a GABAergic disinhibitory mechanism | journal = Neurochemical research | volume = 33 | issue = 11 | pages = 2364–72 | year = 2008 | pmid = 18663573 | doi = 10.1007/s11064-008-9796-4 }}</ref> |
|
'''EGIS-12,233''' is a drug with applications in ], acting as a ] and ] ] for both the ] and ] ] ] subtypes, with good selectivity over other receptors.<ref>{{cite journal | vauthors = Volk B, Barkóczy J, Hegedus E, Udvari S, Gacsályi I, Mezei T, Pallagi K, Kompagne H, Lévay G, Egyed A, Hársing LG, Spedding M, Simig G | display-authors = 6 | title = (Phenylpiperazinyl-butyl)oxindoles as selective 5-HT7 receptor antagonists | journal = Journal of Medicinal Chemistry | volume = 51 | issue = 8 | pages = 2522–32 | date = April 2008 | pmid = 18361484 | doi = 10.1021/jm070279v }}</ref> It has been shown to increase ] release in ]r tissue, suggesting a role for the 5-HT<sub>6</sub> and 5-HT<sub>7</sub> receptors in regulation of the ] system.<ref>{{cite journal | vauthors = Doleviczényi Z, Vizi ES, Gacsályi I, Pallagi K, Volk B, Hársing LG, Halmos G, Lendvai B, Zelles T | display-authors = 6 | title = 5-HT6/7 receptor antagonists facilitate dopamine release in the cochlea via a GABAergic disinhibitory mechanism | journal = Neurochemical Research | volume = 33 | issue = 11 | pages = 2364–72 | date = November 2008 | pmid = 18663573 | doi = 10.1007/s11064-008-9796-4 | s2cid = 11148455 | authorlink2 = Vizi ES }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist|2}} |
|
{{Reflist}} |
|
|
|
|
|
{{Serotonergics}} |
|
{{Serotonergics}} |
|
{{Piperazines}} |
|
{{Piperazines}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{nervous-system-drug-stub}} |