| Revision as of 23:59, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drugbox← Previous edit |
Latest revision as of 23:56, 28 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,984 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (14 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{more citations needed|date=February 2022}} |
|
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444355205 |
|
⚫ |
| IUPAC_name = ethyl 2-acetate |
|
⚫ |
| image = Efloxate.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 119-41-5 |
|
|
| ATC_prefix = C01 |
|
⚫ |
| ATC_suffix = DX13 |
|
⚫ |
| PubChem = 8395 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = CZU6V3902K |
|
| UNII = CZU6V3902K |
|
|
| ChemSpiderID = 8089 |
| ⚫ |
| verifiedrevid = 443323451 |
|
|
|
| ChEMBL = 1349073 |
| ⚫ |
| IUPAC_name = ethyl 2-acetate |
|
|
|
|
| ⚫ |
| image = Efloxate.png |
|
|
|
<!--Chemical data--> |
| ⚫ |
| CAS_number = |
|
|
| ATC_prefix = C01 |
|
| C=19 | H=16 | O=5 |
|
|
| smiles = CCOC(=O)COc1ccc2c(=O)cc(oc2c1)c3ccccc3 |
| ⚫ |
| ATC_suffix = DX13 |
|
|
|
| StdInChI = 1S/C19H16O5/c1-2-22-19(21)12-23-14-8-9-15-16(20)11-17(24-18(15)10-14)13-6-4-3-5-7-13/h3-11H,2,12H2,1H3 |
| ⚫ |
| PubChem = 8395 |
|
|
|
| StdInChIKey = ZVXBAHLOGZCFTP-UHFFFAOYSA-N |
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
|
| C=19|H=16|O=5 |
|
|
| molecular_weight = 324.33 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Efloxate''' is a ].<ref name="Tomasi_1977">{{cite journal | vauthors = Tomasi AM, Masoni A | title = | language = Italian | journal = La Clinica Terapeutica | volume = 82 | issue = 3 | pages = 227–41 | date = August 1977 | pmid = 334448 | doi = | url = }}</ref> |
|
'''Efloxate''' is a ]. |
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Vasodilators used in cardiac diseases}} |
|
{{Vasodilators used in cardiac diseases}} |
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{cardiovascular-drug-stub}} |
|
{{cardiovascular-drug-stub}} |
|
|
|
|
] |
|