| Revision as of 11:02, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447613200 of page Encainide for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 16:37, 23 September 2024 edit JWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenol ethers; added Category:4-Methoxyphenyl compounds using HotCat |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 443722856 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = 4-methoxy-''N''-benzamide |
|
|
⚫ |
| verifiedrevid = 461093505 |
|
⚫ |
| IUPAC_name = 4-Methoxy-''N''-benzamide |
|
| image = Encainide.svg |
|
| image = Encainide.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Enkaid |
|
| Drugs.com = {{drugs.com|CONS|encainide}} |
|
| Drugs.com = {{drugs.com|CONS|encainide}} |
|
| MedlinePlus = a605040 |
|
| MedlinePlus = a605040 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_status = |
|
| legal_status = Withdrawn |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 66778-36-7 |
|
| CAS_number = 66778-36-7 |
|
| ATC_prefix = C01 |
|
| ATC_prefix = C01 |
|
| ATC_suffix = BC08 |
|
| ATC_suffix = BC08 |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 48041 |
|
| PubChem = 48041 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01228 |
|
| DrugBank = DB01228 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 315838 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 43697 |
|
| ChemSpiderID = 43697 |
| Line 43: |
Line 48: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=22 | H=28 | N=2 | O=2 |
|
| C=22 | H=28 | N=2 | O=2 |
|
|
| smiles = COc1ccc(C(=O)Nc2ccccc2CCC2CCCCN2C)cc1 |
|
| molecular_weight = 352.47 g/mol |
|
|
| smiles = CC(CN1CCCCC1)c3ccccc3NC(=O)c2ccc(OC)cc2 |
|
|
| InChI = 1/C22H28N2O2/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25) |
|
|
| InChIKey = PJWPNDMDCLXCOM-UHFFFAOYAR |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C22H28N2O2/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25) |
|
| StdInChI = 1S/C22H28N2O2/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25) |
| Line 53: |
Line 55: |
|
| StdInChIKey = PJWPNDMDCLXCOM-UHFFFAOYSA-N |
|
| StdInChIKey = PJWPNDMDCLXCOM-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Encainide''' (trade name '''Enkaid''') is a class Ic ]. It is no longer used because of its frequent ] side effects.<ref>{{cite journal | vauthors = Echt DS, Liebson PR, Mitchell LB, Peters RW, Obias-Manno D, Barker AH, Arensberg D, Baker A, Friedman L, Greene HL | display-authors = 6 | title = Mortality and morbidity in patients receiving encainide, flecainide, or placebo. The Cardiac Arrhythmia Suppression Trial | journal = The New England Journal of Medicine | volume = 324 | issue = 12 | pages = 781–8 | date = March 1991 | pmid = 1900101 | doi = 10.1056/NEJM199103213241201 | doi-access = free }}</ref> |
|
|
|
|
|
==Synthesis== |
|
|
] |
|
|
|
|
|
== See also == |
|
|
*] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Sodium channel blockers}} |
|
|
{{Antiarrhythmic agents}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{cardiovascular-drug-stub}} |